Merge branch 'main' into nav-overlay

config.json

@@ -19,6 +19,7 @@
   "MusicPlayer_path": "MusicPlayer.json",
   "Note": "",
   "ObjectStates_order": [
+    "GUIDReferenceHandler.123456",
     "HandTrigger.5fe087",
     "HandTrigger.be2f17",
     "HandTrigger.0285cc",
@@ -101,7 +102,7 @@
     "ClueCounter.d86b7c",
     "MasterClueCounter.4a3aa4",
     "LegacyAssets.7165a9",
-    "Playarea.721ba2",
+    "PlayArea.721ba2",
     "BarkhamHorror.308439",
     "ChaosBagStatTracker.766620",
     "Blesstokens.afa06b",
@@ -131,11 +132,11 @@
     "EdgeoftheEarth.895eaa",
     "TheDream-Eaters.a16a1a",
     "ReturntoTheCircleUndone.757324",
-    "Playermat4Red.0840d5",
-    "Playermat3Green.383d8b",
     "OtherDoominPlay.652ff3",
     "Playermat1White.8b081b",
     "Playermat2Orange.bd0ff4",
+    "Playermat3Green.383d8b",
+    "Playermat4Red.0840d5",
     "Neutral.2691e1",
     "Neutral.748245",
     "Neutral.271b17",
@@ -198,6 +199,7 @@
     "TokenArranger.022907",
     "ChaosBagManager.023240",
     "ArkhamSCE330-1092023-Page1.964222",
+    "PlaceholderBoxDummy.a93466",
     "SoulsofDarkness.a94e6b"
   ],
   "PlayArea": 1,
@@ -218,5 +220,5 @@
   "Tags": [],
   "Turns_path": "Turns.json",
   "VersionNumber": "v13.2.2",
-  "XmlUI": "\u003cInclude src=\"Global.xml\"/\u003e"
+  "XmlUI": "\u003cInclude src=\"Global/Global.xml\"/\u003e"
 }

modsettings/ComponentTags.json

@@ -12,10 +12,6 @@
       "displayed": "LinkedPhaseTracker",
       "normalized": "linkedphasetracker"
     },
-    {
-      "displayed": "chaosBag",
-      "normalized": "chaosBag"
-    },
     {
       "displayed": "displacement_excluded",
       "normalized": "displacement_excluded"
@@ -60,10 +56,6 @@
       "displayed": "chaosBag",
       "normalized": "chaosbag"
     },
-    {
-      "displayed": "arkham_setup_memory_object",
-      "normalized": "arkham_setup_memory_object"
-    },
     {
       "displayed": "ActionToken",
       "normalized": "actiontoken"
@@ -72,10 +64,6 @@
       "displayed": "LargeBox",
       "normalized": "largebox"
     },
-    {
-      "displayed": "SoundCube",
-      "normalized": "soundcube"
-    },
     {
       "displayed": "CampaignBox",
       "normalized": "campaignbox"
@@ -83,10 +71,6 @@
     {
       "displayed": "CameraZoom_ignore",
       "normalized": "camerazoom_ignore"
-    },
-    {
-      "displayed": "TokenArranger",
-      "normalized": "tokenarranger"
     }
   ]
 }

modsettings/CustomUIAssets.json

@@ -218,5 +218,20 @@
     "Name": "FinnIcon",
     "Type": 0,
     "URL": "http://cloud-3.steamusercontent.com/ugc/2037357792052848566/5DA900C430E97D3DFF2C9B8A3DB1CB2271791FC7/"
+  },
+  {
+    "Name": "box-cover-mask-small",
+    "Type": 0,
+    "URL": "http://cloud-3.steamusercontent.com/ugc/2115061298536631564/F29C2ED9DD8431A1D1E21C7FFAFF1FFBC0AF0BF3/"
+  },
+  {
+    "Name": "box-cover-mask-big",
+    "Type": 0,
+    "URL": "http://cloud-3.steamusercontent.com/ugc/2115061298536631429/D075D2EECE6EE091AD3BEA5800DEF9C7B02B745B/"
+  },
+  {
+    "Name": "box-cover-mask-wide",
+    "Type": 0,
+    "URL": "http://cloud-3.steamusercontent.com/ugc/2115061298538827369/A20C2ECB8ECDC1B0AD8B2B38F68CA1C1F5E07D37/"
   }
 ]

objects/AllPlayerCards.15bb07.json

@@ -1557,7 +1557,14 @@
     "StallforTime.7b6ed1",
     "WrongPlaceRightTime.d5944e",
     "SparrowMask.975d79",
-    "Pitchfork.45a724"
+    "Pitchfork.45a724",
+    "JimsTrumpet.7dfd5f",
+    "JimCulverParallel.72bf31",
+    "JimCulverParallelFront.c5fc80",
+    "VengefulShade.73bc8e",
+    "FinalRhapsody.561775",
+    "JimCulverParallelBack.aba863",
+    "TheBeyond.37ab47"
   ],
   "ContainedObjects_path": "AllPlayerCards.15bb07",
   "Description": "",

objects/AllPlayerCards.15bb07/FinalRhapsody.561775.gmnotes

@@ -0,0 +1,8 @@
+{
+  "id": "90051",
+  "type": "Treachery",
+  "class": "Neutral",
+  "traits": "Endtimes.",
+  "weakness": true,
+  "cycle": "The Dunwich Legacy"
+}

objects/AllPlayerCards.15bb07/FinalRhapsody.561775.json

@@ -0,0 +1,61 @@
+{
+  "AltLookAngle": {
+    "x": 0,
+    "y": 0,
+    "z": 0
+  },
+  "Autoraise": true,
+  "CardID": 847001,
+  "ColorDiffuse": {
+    "b": 0.71324,
+    "g": 0.71324,
+    "r": 0.71324
+  },
+  "CustomDeck": {
+    "8470": {
+      "BackIsHidden": false,
+      "BackURL": "https://i.imgur.com/EcbhVuh.jpg/",
+      "FaceURL": "http://cloud-3.steamusercontent.com/ugc/2149964195986880793/517FBB4FF8F72900B9E123DB865BCAD625F6506C/",
+      "NumHeight": 2,
+      "NumWidth": 2,
+      "Type": 0,
+      "UniqueBack": false
+    }
+  },
+  "Description": "Advanced",
+  "DragSelectable": true,
+  "GMNotes_path": "AllPlayerCards.15bb07/FinalRhapsody.561775.gmnotes",
+  "GUID": "561775",
+  "Grid": true,
+  "GridProjection": false,
+  "Hands": true,
+  "HideWhenFaceDown": true,
+  "IgnoreFoW": false,
+  "LayoutGroupSortIndex": 0,
+  "Locked": false,
+  "LuaScript": "",
+  "LuaScriptState": "",
+  "MeasureMovement": false,
+  "Name": "Card",
+  "Nickname": "Final Rhapsody",
+  "SidewaysCard": false,
+  "Snap": true,
+  "Sticky": true,
+  "Tags": [
+    "PlayerCard"
+  ],
+  "Tooltip": true,
+  "Transform": {
+    "posX": 78.419,
+    "posY": 3.193,
+    "posZ": 23.541,
+    "rotX": 0,
+    "rotY": 270,
+    "rotZ": 0,
+    "scaleX": 1,
+    "scaleY": 1,
+    "scaleZ": 1
+  },
+  "Value": 0,
+  "XmlUI": ""
+}

objects/AllPlayerCards.15bb07/JimCulverParallel.72bf31.gmnotes

@@ -0,0 +1,11 @@
+{
+  "id": "02004-p",
+  "type": "Investigator",
+  "class": "Mystic",
+  "traits": "Performer. Cursed.",
+  "willpowerIcons": 4,
+  "intellectIcons": 3,
+  "combatIcons": 3,
+  "agilityIcons": 2,
+  "cycle": "The Dunwich Legacy"
+}

objects/AllPlayerCards.15bb07/JimCulverParallel.72bf31.json

@@ -0,0 +1,62 @@
+{
+  "AltLookAngle": {
+    "x": 0,
+    "y": 0,
+    "z": 0
+  },
+  "Autoraise": true,
+  "CardID": 846700,
+  "ColorDiffuse": {
+    "b": 0.71324,
+    "g": 0.71324,
+    "r": 0.71324
+  },
+  "CustomDeck": {
+    "8467": {
+      "BackIsHidden": false,
+      "BackURL": "http://cloud-3.steamusercontent.com/ugc/2149964195987018702/54C63785F3AA474F635F58BC506C86A318432BD7/",
+      "FaceURL": "http://cloud-3.steamusercontent.com/ugc/2149964195987018793/0AED4BF62C4FF3206778AD36FDB9C8E482CD3F9E/",
+      "NumHeight": 2,
+      "NumWidth": 4,
+      "Type": 0,
+      "UniqueBack": true
+    }
+  },
+  "Description": "The Musician",
+  "DragSelectable": true,
+  "GMNotes_path": "AllPlayerCards.15bb07/JimCulverParallel.72bf31.gmnotes",
+  "GUID": "72bf31",
+  "Grid": true,
+  "GridProjection": false,
+  "Hands": true,
+  "HideWhenFaceDown": false,
+  "IgnoreFoW": false,
+  "LayoutGroupSortIndex": 0,
+  "Locked": false,
+  "LuaScript": "",
+  "LuaScriptState": "",
+  "MeasureMovement": false,
+  "Name": "Card",
+  "Nickname": "Jim Culver (Parallel)",
+  "SidewaysCard": true,
+  "Snap": true,
+  "Sticky": true,
+  "Tags": [
+    "Investigator",
+    "PlayerCard"
+  ],
+  "Tooltip": true,
+  "Transform": {
+    "posX": 82.182,
+    "posY": 3.193,
+    "posZ": 26.386,
+    "rotX": 0,
+    "rotY": 180,
+    "rotZ": 0,
+    "scaleX": 1.15,
+    "scaleY": 1,
+    "scaleZ": 1.15
+  },
+  "Value": 0,
+  "XmlUI": ""
+}

objects/AllPlayerCards.15bb07/JimCulverParallelBack.aba863.gmnotes

@@ -0,0 +1,11 @@
+{
+  "id": "02004-pb",
+  "type": "Investigator",
+  "class": "Mystic",
+  "traits": "Performer.",
+  "willpowerIcons": 4,
+  "intellectIcons": 3,
+  "combatIcons": 3,
+  "agilityIcons": 2,
+  "cycle": "The Dunwich Legacy"
+}

objects/AllPlayerCards.15bb07/JimCulverParallelBack.aba863.json

@@ -0,0 +1,62 @@
+{
+  "AltLookAngle": {
+    "x": 0,
+    "y": 0,
+    "z": 0
+  },
+  "Autoraise": true,
+  "CardID": 846805,
+  "ColorDiffuse": {
+    "b": 0.71324,
+    "g": 0.71324,
+    "r": 0.71324
+  },
+  "CustomDeck": {
+    "8468": {
+      "BackIsHidden": false,
+      "BackURL": "http://cloud-3.steamusercontent.com/ugc/2149964195987018702/54C63785F3AA474F635F58BC506C86A318432BD7/",
+      "FaceURL": "http://cloud-3.steamusercontent.com/ugc/1656727981627737050/3CFF9E3825033909543AD1CF843361D9243538EE/",
+      "NumHeight": 2,
+      "NumWidth": 4,
+      "Type": 0,
+      "UniqueBack": true
+    }
+  },
+  "Description": "The Musician",
+  "DragSelectable": true,
+  "GMNotes_path": "AllPlayerCards.15bb07/JimCulverParallelBack.aba863.gmnotes",
+  "GUID": "aba863",
+  "Grid": true,
+  "GridProjection": false,
+  "Hands": true,
+  "HideWhenFaceDown": false,
+  "IgnoreFoW": false,
+  "LayoutGroupSortIndex": 0,
+  "Locked": false,
+  "LuaScript": "",
+  "LuaScriptState": "",
+  "MeasureMovement": false,
+  "Name": "Card",
+  "Nickname": "Jim Culver (Parallel Back)",
+  "SidewaysCard": true,
+  "Snap": true,
+  "Sticky": true,
+  "Tags": [
+    "Investigator",
+    "PlayerCard"
+  ],
+  "Tooltip": true,
+  "Transform": {
+    "posX": 82.206,
+    "posY": 3.193,
+    "posZ": 18.459,
+    "rotX": 0,
+    "rotY": 180,
+    "rotZ": 0,
+    "scaleX": 1.15,
+    "scaleY": 1,
+    "scaleZ": 1.15
+  },
+  "Value": 0,
+  "XmlUI": ""
+}

objects/AllPlayerCards.15bb07/JimCulverParallelFront.c5fc80.gmnotes

@@ -0,0 +1,11 @@
+{
+  "id": "02004-pf",
+  "type": "Investigator",
+  "class": "Mystic",
+  "traits": "Performer. Cursed.",
+  "willpowerIcons": 4,
+  "intellectIcons": 3,
+  "combatIcons": 3,
+  "agilityIcons": 2,
+  "cycle": "The Dunwich Legacy"
+}

objects/AllPlayerCards.15bb07/JimCulverParallelFront.c5fc80.json

@@ -0,0 +1,62 @@
+{
+  "AltLookAngle": {
+    "x": 0,
+    "y": 0,
+    "z": 0
+  },
+  "Autoraise": true,
+  "CardID": 846905,
+  "ColorDiffuse": {
+    "b": 0.71324,
+    "g": 0.71324,
+    "r": 0.71324
+  },
+  "CustomDeck": {
+    "8469": {
+      "BackIsHidden": false,
+      "BackURL": "http://cloud-3.steamusercontent.com/ugc/1656727981627737648/F371339538812F68E38AAC0D520C525250DAC5C0/",
+      "FaceURL": "http://cloud-3.steamusercontent.com/ugc/2149964195987018793/0AED4BF62C4FF3206778AD36FDB9C8E482CD3F9E/",
+      "NumHeight": 2,
+      "NumWidth": 4,
+      "Type": 0,
+      "UniqueBack": true
+    }
+  },
+  "Description": "The Musician",
+  "DragSelectable": true,
+  "GMNotes_path": "AllPlayerCards.15bb07/JimCulverParallelFront.c5fc80.gmnotes",
+  "GUID": "c5fc80",
+  "Grid": true,
+  "GridProjection": false,
+  "Hands": true,
+  "HideWhenFaceDown": false,
+  "IgnoreFoW": false,
+  "LayoutGroupSortIndex": 0,
+  "Locked": false,
+  "LuaScript": "",
+  "LuaScriptState": "",
+  "MeasureMovement": false,
+  "Name": "Card",
+  "Nickname": "Jim Culver (Parallel Front)",
+  "SidewaysCard": true,
+  "Snap": true,
+  "Sticky": true,
+  "Tags": [
+    "Investigator",
+    "PlayerCard"
+  ],
+  "Tooltip": true,
+  "Transform": {
+    "posX": 82.087,
+    "posY": 3.193,
+    "posZ": 22.484,
+    "rotX": 0,
+    "rotY": 180,
+    "rotZ": 0,
+    "scaleX": 1.15,
+    "scaleY": 1,
+    "scaleZ": 1.15
+  },
+  "Value": 0,
+  "XmlUI": ""
+}

objects/AllPlayerCards.15bb07/JimsTrumpet.03c6a7.json

@@ -22,7 +22,7 @@
       "UniqueBack": false
     }
   },
-  "Description": "",
+  "Description": "The Dead Listen",
   "DragSelectable": true,
   "GMNotes_path": "AllPlayerCards.15bb07/JimsTrumpet.03c6a7.gmnotes",
   "GUID": "03c6a7",

objects/AllPlayerCards.15bb07/JimsTrumpet.7dfd5f.gmnotes

@@ -0,0 +1,10 @@
+{
+  "id": "90050",
+  "type": "Asset",
+  "class": "Neutral",
+  "cost": 2,
+  "traits": "Item. Instrument. Relic.",
+  "willpowerIcons": 2,
+  "wildIcons": 2,
+  "cycle": "The Dunwich Legacy"
+}

objects/AllPlayerCards.15bb07/JimsTrumpet.7dfd5f.json

@@ -0,0 +1,62 @@
+{
+  "AltLookAngle": {
+    "x": 0,
+    "y": 0,
+    "z": 0
+  },
+  "Autoraise": true,
+  "CardID": 847000,
+  "ColorDiffuse": {
+    "b": 0.71324,
+    "g": 0.71324,
+    "r": 0.71324
+  },
+  "CustomDeck": {
+    "8470": {
+      "BackIsHidden": false,
+      "BackURL": "https://i.imgur.com/EcbhVuh.jpg/",
+      "FaceURL": "http://cloud-3.steamusercontent.com/ugc/2149964195986880793/517FBB4FF8F72900B9E123DB865BCAD625F6506C/",
+      "NumHeight": 2,
+      "NumWidth": 2,
+      "Type": 0,
+      "UniqueBack": false
+    }
+  },
+  "Description": "The Dead Speak (Advanced)",
+  "DragSelectable": true,
+  "GMNotes_path": "AllPlayerCards.15bb07/JimsTrumpet.7dfd5f.gmnotes",
+  "GUID": "7dfd5f",
+  "Grid": true,
+  "GridProjection": false,
+  "Hands": true,
+  "HideWhenFaceDown": true,
+  "IgnoreFoW": false,
+  "LayoutGroupSortIndex": 0,
+  "Locked": false,
+  "LuaScript": "",
+  "LuaScriptState": "",
+  "MeasureMovement": false,
+  "Name": "Card",
+  "Nickname": "Jim's Trumpet",
+  "SidewaysCard": false,
+  "Snap": true,
+  "Sticky": true,
+  "Tags": [
+    "Asset",
+    "PlayerCard"
+  ],
+  "Tooltip": true,
+  "Transform": {
+    "posX": 78.511,
+    "posY": 3.229,
+    "posZ": 27.011,
+    "rotX": 359,
+    "rotY": 270,
+    "rotZ": 0,
+    "scaleX": 1,
+    "scaleY": 1,
+    "scaleZ": 1
+  },
+  "Value": 0,
+  "XmlUI": ""
+}

objects/AllPlayerCards.15bb07/TheBeyond.37ab47.gmnotes

@@ -0,0 +1,8 @@
+{
+  "id": "90052",
+  "type": "Asset",
+  "class": "Neutral",
+  "permanent": true,
+  "startsInPlay": true,
+  "cycle": "Laid to Rest"
+}

objects/AllPlayerCards.15bb07/TheBeyond.37ab47.json

@@ -0,0 +1,62 @@
+{
+  "AltLookAngle": {
+    "x": 0,
+    "y": 0,
+    "z": 0
+  },
+  "Autoraise": true,
+  "CardID": 847100,
+  "ColorDiffuse": {
+    "b": 0.71324,
+    "g": 0.71324,
+    "r": 0.71324
+  },
+  "CustomDeck": {
+    "8471": {
+      "BackIsHidden": true,
+      "BackURL": "http://cloud-3.steamusercontent.com/ugc/2149964195986881059/864F6EBBD2900ED6D145B8AF12F2F8C180375C83/",
+      "FaceURL": "http://cloud-3.steamusercontent.com/ugc/2149964195986880989/13172BC914A0D729B4EFD9845FA9FDFCAB6F77F7/",
+      "NumHeight": 1,
+      "NumWidth": 1,
+      "Type": 0,
+      "UniqueBack": false
+    }
+  },
+  "Description": "Bleak Netherworld",
+  "DragSelectable": true,
+  "GMNotes_path": "AllPlayerCards.15bb07/TheBeyond.37ab47.gmnotes",
+  "GUID": "37ab47",
+  "Grid": true,
+  "GridProjection": false,
+  "Hands": true,
+  "HideWhenFaceDown": true,
+  "IgnoreFoW": false,
+  "LayoutGroupSortIndex": 0,
+  "Locked": false,
+  "LuaScript": "",
+  "LuaScriptState": "",
+  "MeasureMovement": false,
+  "Name": "CardCustom",
+  "Nickname": "The Beyond",
+  "SidewaysCard": false,
+  "Snap": true,
+  "Sticky": true,
+  "Tags": [
+    "Asset",
+    "PlayerCard"
+  ],
+  "Tooltip": true,
+  "Transform": {
+    "posX": 78.532,
+    "posY": 3.193,
+    "posZ": 17.888,
+    "rotX": 0,
+    "rotY": 270,
+    "rotZ": 0,
+    "scaleX": 1,
+    "scaleY": 1,
+    "scaleZ": 1
+  },
+  "Value": 0,
+  "XmlUI": ""
+}

objects/AllPlayerCards.15bb07/VengefulShade.73bc8e.gmnotes

@@ -0,0 +1,8 @@
+{
+  "id": "90053",
+  "type": "Enemy",
+  "class": "Neutral",
+  "traits": "Monster. Geist",
+  "weakness": true,
+  "cycle": "Laid to Rest"
+}

objects/AllPlayerCards.15bb07/VengefulShade.73bc8e.json

@@ -0,0 +1,61 @@
+{
+  "AltLookAngle": {
+    "x": 0,
+    "y": 0,
+    "z": 0
+  },
+  "Autoraise": true,
+  "CardID": 847002,
+  "ColorDiffuse": {
+    "b": 0.71324,
+    "g": 0.71324,
+    "r": 0.71324
+  },
+  "CustomDeck": {
+    "8470": {
+      "BackIsHidden": false,
+      "BackURL": "https://i.imgur.com/EcbhVuh.jpg/",
+      "FaceURL": "http://cloud-3.steamusercontent.com/ugc/2149964195986880793/517FBB4FF8F72900B9E123DB865BCAD625F6506C/",
+      "NumHeight": 2,
+      "NumWidth": 2,
+      "Type": 0,
+      "UniqueBack": false
+    }
+  },
+  "Description": "",
+  "DragSelectable": true,
+  "GMNotes_path": "AllPlayerCards.15bb07/VengefulShade.73bc8e.gmnotes",
+  "GUID": "73bc8e",
+  "Grid": true,
+  "GridProjection": false,
+  "Hands": true,
+  "HideWhenFaceDown": true,
+  "IgnoreFoW": false,
+  "LayoutGroupSortIndex": 0,
+  "Locked": false,
+  "LuaScript": "",
+  "LuaScriptState": "",
+  "MeasureMovement": false,
+  "Name": "Card",
+  "Nickname": "Vengeful Shade",
+  "SidewaysCard": false,
+  "Snap": true,
+  "Sticky": true,
+  "Tags": [
+    "PlayerCard"
+  ],
+  "Tooltip": true,
+  "Transform": {
+    "posX": 78.455,
+    "posY": 3.193,
+    "posZ": 20.547,
+    "rotX": 0,
+    "rotY": 270,
+    "rotZ": 0,
+    "scaleX": 1,
+    "scaleY": 1,
+    "scaleZ": 1
+  },
+  "Value": 0,
+  "XmlUI": ""
+}

objects/AllPlayerCards.15bb07/WendyAdamsParallel.fd91ea.gmnotes

@@ -2,7 +2,7 @@
   "id": "01005-p",
   "type": "Investigator",
   "class": "Survivor",
-  "traits": "Drifter.",
+  "traits": "Drifter. Blessed. Cursed.",
   "willpowerIcons": 4,
   "intellectIcons": 3,
   "combatIcons": 1,

objects/AllPlayerCards.15bb07/WendyAdamsParallelFront.61503e.gmnotes

@@ -2,7 +2,7 @@
   "id": "01005-pf",
   "type": "Investigator",
   "class": "Survivor",
-  "traits": "Drifter.",
+  "traits": "Drifter. Blessed. Cursed.",
   "willpowerIcons": 4,
   "intellectIcons": 3,
   "combatIcons": 1,

objects/ArkhamDeckCutter.445115.json

@@ -28,9 +28,6 @@
   "Nickname": "Arkham Deck Cutter",
   "Snap": true,
   "Sticky": true,
-  "Tags": [
-    "arkham_setup_memory_object"
-  ],
   "Tooltip": true,
   "Transform": {
     "posX": 78,

objects/Blesstokens.afa06b.json

@@ -67,6 +67,7 @@
   "Snap": true,
   "Sticky": true,
   "Tags": [
+    "CleanUpHelper_ignore",
     "displacement_excluded"
   ],
   "Tooltip": true,

objects/Cluetokens.11e0cf.json

@@ -44,6 +44,9 @@
   "Nickname": "Clue tokens",
   "Snap": true,
   "Sticky": true,
+  "Tags": [
+    "CleanUpHelper_ignore"
+  ],
   "Tooltip": true,
   "Transform": {
     "posX": 2.857,

objects/Community-CreatedPlayerCardsInvestigators.ed4ca7/BuffytheVampireSlayer.6bf40f.json

@@ -83,4 +83,4 @@
   },
   "Value": 0,
   "XmlUI": ""
-}
+}

objects/Community-CreatedPlayerCardsInvestigators.ed4ca7/CartoonInvestigators.524fbc.json

@@ -49,6 +49,9 @@
   "Nickname": "Cartoon Investigators",
   "Snap": true,
   "Sticky": true,
+  "Tags": [
+    "LargeBox"
+  ],
   "Tooltip": true,
   "Transform": {
     "posX": -23.615,
@@ -61,9 +64,6 @@
     "scaleY": 0.14,
     "scaleZ": 1
   },
-  "Tags": [
-    "LargeBox"
-  ],
   "Value": 0,
   "XmlUI": ""
 }

objects/Community-CreatedPlayerCardsInvestigators.ed4ca7/CircusExMortisInvestigatorExpansion.195936.json

@@ -83,4 +83,4 @@
   },
   "Value": 0,
   "XmlUI": ""
-}
+}

objects/Community-CreatedPlayerCardsInvestigators.ed4ca7/CityofSecrets.1ee775.json

@@ -83,4 +83,4 @@
   },
   "Value": 0,
   "XmlUI": ""
-}
+}

objects/Community-CreatedPlayerCardsInvestigators.ed4ca7/TheGhostsOfOnigawaInvestigatorExpansion.c19cfa.json

@@ -49,6 +49,9 @@
   "Nickname": "The Ghosts Of Onigawa (Investigator Expansion)",
   "Snap": true,
   "Sticky": true,
+  "Tags": [
+    "LargeBox"
+  ],
   "Tooltip": true,
   "Transform": {
     "posX": -47.192,
@@ -61,9 +64,6 @@
     "scaleY": 0.14,
     "scaleZ": 1
   },
-  "Tags": [
-    "LargeBox"
-  ],
   "Value": 0,
   "XmlUI": ""
 }

objects/Community-CreatedPlayerCardsInvestigators.ed4ca7/TheRedCoterie.de13e3.json

@@ -83,4 +83,4 @@
   },
   "Value": 0,
   "XmlUI": ""
-}
+}

objects/Community-CreatedPlayerCardsInvestigators.ed4ca7/TheSandsOfMemphisInvestigatorExpansion.073201.json

@@ -49,6 +49,9 @@
   "Nickname": "The Sands Of Memphis (Investigator Expansion)",
   "Snap": true,
   "Sticky": true,
+  "Tags": [
+    "LargeBox"
+  ],
   "Tooltip": true,
   "Transform": {
     "posX": -47.192,
@@ -61,9 +64,6 @@
     "scaleY": 0.14,
     "scaleZ": 1
   },
-  "Tags": [
-    "LargeBox"
-  ],
   "Value": 0,
   "XmlUI": ""
-}
+}

objects/Connectionmarkers.170f10.json

@@ -44,6 +44,9 @@
   "Nickname": "Connection markers",
   "Snap": true,
   "Sticky": true,
+  "Tags": [
+    "CleanUpHelper_ignore"
+  ],
   "Tooltip": true,
   "Transform": {
     "posX": -51,

objects/Cursetokens.bd0253.json

@@ -67,6 +67,7 @@
   "Snap": true,
   "Sticky": true,
   "Tags": [
+    "CleanUpHelper_ignore",
     "displacement_excluded"
   ],
   "Tooltip": true,

objects/DoomCounter.85c4c6.json

@@ -40,6 +40,9 @@
   "Nickname": "Doom Counter",
   "Snap": true,
   "Sticky": true,
+  "Tags": [
+    "CleanUpHelper_ignore"
+  ],
   "Tooltip": true,
   "Transform": {
     "posX": -5.3,

objects/Doomtokens.47ffc3.json

@@ -44,6 +44,9 @@
   "Nickname": "Doom tokens",
   "Snap": true,
   "Sticky": true,
+  "Tags": [
+    "CleanUpHelper_ignore"
+  ],
   "Tooltip": true,
   "Transform": {
     "posX": -55.48,

objects/Doomtokens.b015d8.json

@@ -44,6 +44,9 @@
   "Nickname": "Doom tokens",
   "Snap": true,
   "Sticky": true,
+  "Tags": [
+    "CleanUpHelper_ignore"
+  ],
   "Tooltip": true,
   "Transform": {
     "posX": 2.761,

objects/Fan-MadeAccessories.aa8b38/Auto-failCounter.a9a321.json

@@ -54,4 +54,4 @@
   },
   "Value": 0,
   "XmlUI": ""
-}
+}

objects/Fan-MadeAccessories.aa8b38/ElderSignCounter.e62cb5.json

@@ -54,4 +54,4 @@
   },
   "Value": 0,
   "XmlUI": ""
-}
+}

objects/Fan-MadeAccessories.aa8b38/Subject5U-21Helper.1335e8.json

@@ -73,4 +73,4 @@
   },
   "Value": 0,
   "XmlUI": ""
-}
+}

objects/Fan-MadeScenariosCampaignsMiscellany.66e97c/Fan-MadeCampaigns.89c32e/HeartofDarkness.cc95ff.json

@@ -83,4 +83,4 @@
   },
   "Value": 0,
   "XmlUI": ""
-}
+}

objects/Fan-MadeScenariosCampaignsMiscellany.66e97c/Fan-MadeCampaigns.89c32e/SoulsofDarkness.a94e6b.json

@@ -82,4 +82,4 @@
   },
   "Value": 0,
   "XmlUI": ""
-}
+}

objects/Fan-MadeScenariosCampaignsMiscellany.66e97c/Fan-MadeCampaigns.89c32e/TheSandsOfMemphisCampaignExpansion.2634e3.json

@@ -66,4 +66,4 @@
   },
   "Value": 0,
   "XmlUI": ""
-}
+}

objects/GUIDReferenceHandler.123456.json

@@ -0,0 +1,45 @@
+{
+  "AltLookAngle": {
+    "x": 0,
+    "y": 0,
+    "z": 0
+  },
+  "Autoraise": true,
+  "ColorDiffuse": {
+    "b": 0.116,
+    "g": 0.116,
+    "r": 0.716
+  },
+  "Description": "This object handles GUID references to objects.",
+  "DragSelectable": true,
+  "GMNotes": "",
+  "GUID": "123456",
+  "Grid": true,
+  "GridProjection": false,
+  "Hands": false,
+  "HideWhenFaceDown": false,
+  "IgnoreFoW": false,
+  "LayoutGroupSortIndex": 0,
+  "Locked": true,
+  "LuaScript": "require(\"core/GUIDReferenceHandler\")",
+  "LuaScriptState": "",
+  "MeasureMovement": false,
+  "Name": "go_game_piece_white",
+  "Nickname": "GUID Reference Handler",
+  "Snap": true,
+  "Sticky": true,
+  "Tooltip": true,
+  "Transform": {
+    "posX": 78,
+    "posY": 1.328,
+    "posZ": -8,
+    "rotX": 0,
+    "rotY": 0,
+    "rotZ": 0,
+    "scaleX": 1,
+    "scaleY": 1,
+    "scaleZ": 1
+  },
+  "Value": 0,
+  "XmlUI": ""
+}

objects/MasterClueCounter.4a3aa4.json

@@ -19,7 +19,7 @@
     },
     "ImageScalar": 1,
     "ImageSecondaryURL": "",
-    "ImageURL": "http://cloud-3.steamusercontent.com/ugc/1758068501357164917/1D06F1DC4D6888B6F57124BD2AFE20D0B0DA15A8/",
+    "ImageURL": "http://cloud-3.steamusercontent.com/ugc/784129913444610342/7903BA89870C1656A003FD69C79BFA99BD1AAC24/",
     "WidthScale": 0
   },
   "Description": "Click to remove all clues from all investigators",
@@ -37,9 +37,12 @@
   "LuaScriptState": "false",
   "MeasureMovement": false,
   "Name": "Custom_Token",
-  "Nickname": "Master Clue Counter\n",
+  "Nickname": "Master Clue Counter",
   "Snap": true,
   "Sticky": true,
+  "Tags": [
+    "CleanUpHelper_ignore"
+  ],
   "Tooltip": true,
   "Transform": {
     "posX": -5.3,

objects/MythosArea.9f334f.json

@@ -66,6 +66,9 @@
   "Nickname": "Mythos Area",
   "Snap": true,
   "Sticky": true,
+  "Tags": [
+    "CleanUpHelper_ignore"
+  ],
   "Tooltip": false,
   "Transform": {
     "posX": -1.309,

objects/OfficialStandaloneChallengeScenarios.0ef5c8/ChallengeScenarios.9f6801.json

@@ -14,11 +14,12 @@
     "r": 1
   },
   "ContainedObjects_order": [
-    "BadBlood.451eaa",
-    "RedTideRising.5302f2",
     "AllorNothing.72ab92",
+    "BadBlood.451eaa",
+    "BytheBook.cc7eb3",
+    "LaidtoRest.e2dd57",
     "ReadorDie.9e73fa",
-    "BytheBook.cc7eb3"
+    "RedTideRising.5302f2"
   ],
   "ContainedObjects_path": "ChallengeScenarios.9f6801",
   "CustomMesh": {
@@ -64,7 +65,7 @@
   "Tooltip": true,
   "Transform": {
     "posX": -9,
-    "posY": 1.481,
+    "posY": 1.482,
     "posZ": -76,
     "rotX": 0,
     "rotY": 270,

objects/OfficialStandaloneChallengeScenarios.0ef5c8/ChallengeScenarios.9f6801.luascriptstate

@@ -1 +1 @@
-{"ml":{"451eaa":{"lock":false,"pos":{"x":12.2499580383301,"y":1.46560525894165,"z":3.98636198043823},"rot":{"x":359.920135498047,"y":269.999908447266,"z":0.016873624175787}},"5302f2":{"lock":false,"pos":{"x":12.2504663467407,"y":1.45853757858276,"z":-20.013650894165},"rot":{"x":359.920135498047,"y":270.00146484375,"z":0.0168716721236706}},"72ab92":{"lock":false,"pos":{"x":12.2520532608032,"y":1.4679582118988,"z":11.9863719940186},"rot":{"x":359.920135498047,"y":270,"z":0.0168737415224314}},"9e73fa":{"lock":false,"pos":{"x":12.2500581741333,"y":1.46089386940002,"z":-12.0136384963989},"rot":{"x":359.920135498047,"y":269.999847412109,"z":0.0168744903057814}},"cc7eb3":{"lock":false,"pos":{"x":12.2495565414429,"y":1.46325027942657,"z":-4.01364088058472},"rot":{"x":359.920135498047,"y":269.999908447266,"z":0.0168744102120399}}}}
+{"ml":{"451eaa":{"lock":false,"pos":{"x":12.252,"y":1.4815,"z":11.986},"rot":{"x":0,"y":269.9999,"z":0}},"5302f2":{"lock":false,"pos":{"x":12.2505,"y":1.4815,"z":-20.0137},"rot":{"x":0,"y":270.0014,"z":0}},"72ab92":{"lock":false,"pos":{"x":12.25,"y":1.4815,"z":19.986},"rot":{"x":0,"y":269.9999,"z":0}},"9e73fa":{"lock":false,"pos":{"x":12.2501,"y":1.4815,"z":-12.0137},"rot":{"x":0,"y":269.9998,"z":0}},"cc7eb3":{"lock":false,"pos":{"x":12.25,"y":1.4815,"z":3.986},"rot":{"x":0,"y":269.9999,"z":0}},"e2dd57":{"lock":false,"pos":{"x":12.25,"y":1.4815,"z":-4.014},"rot":{"x":0,"y":270,"z":0}}}}

objects/OfficialStandaloneChallengeScenarios.0ef5c8/ChallengeScenarios.9f6801/AllorNothing.72ab92.json

@@ -71,9 +71,9 @@
   "Sticky": true,
   "Tooltip": true,
   "Transform": {
-    "posX": 12.252,
+    "posX": 12.25,
-    "posY": 1.468,
+    "posY": 1.481,
-    "posZ": 11.986,
+    "posZ": 19.986,
     "rotX": 0,
     "rotY": 270,
     "rotZ": 0,

objects/OfficialStandaloneChallengeScenarios.0ef5c8/ChallengeScenarios.9f6801/BadBlood.451eaa.json

@@ -71,9 +71,9 @@
   "Sticky": true,
   "Tooltip": true,
   "Transform": {
-    "posX": 12.25,
+    "posX": 12.252,
-    "posY": 1.466,
+    "posY": 1.481,
-    "posZ": 3.986,
+    "posZ": 11.986,
     "rotX": 0,
     "rotY": 270,
     "rotZ": 0,

objects/OfficialStandaloneChallengeScenarios.0ef5c8/ChallengeScenarios.9f6801/BytheBook.cc7eb3.json

@@ -72,8 +72,8 @@
   "Tooltip": true,
   "Transform": {
     "posX": 12.25,
-    "posY": 1.463,
+    "posY": 1.481,
-    "posZ": -4.014,
+    "posZ": 3.986,
     "rotX": 0,
     "rotY": 270,
     "rotZ": 0,

objects/OfficialStandaloneChallengeScenarios.0ef5c8/ChallengeScenarios.9f6801/LaidtoRest.e2dd57.json

@@ -0,0 +1,86 @@
+{
+  "AltLookAngle": {
+    "x": 0,
+    "y": 0,
+    "z": 0
+  },
+  "AttachedDecals": [
+    {
+      "CustomDecal": {
+        "ImageURL": "http://cloud-3.steamusercontent.com/ugc/959719855119695911/931B9829687A20F4DEADB36DA57B7E6D76792231/",
+        "Name": "dunwich_back",
+        "Size": 7.4
+      },
+      "Transform": {
+        "posX": 0,
+        "posY": 0,
+        "posZ": 0,
+        "rotX": 270,
+        "rotY": 0,
+        "rotZ": 0,
+        "scaleX": 2,
+        "scaleY": 2,
+        "scaleZ": 2
+      }
+    }
+  ],
+  "Autoraise": true,
+  "ColorDiffuse": {
+    "a": 0.27451,
+    "b": 1,
+    "g": 1,
+    "r": 1
+  },
+  "CustomMesh": {
+    "CastShadows": true,
+    "ColliderURL": "",
+    "Convex": true,
+    "CustomShader": {
+      "FresnelStrength": 0,
+      "SpecularColor": {
+        "b": 1,
+        "g": 1,
+        "r": 1
+      },
+      "SpecularIntensity": 0,
+      "SpecularSharpness": 2
+    },
+    "DiffuseURL": "http://cloud-3.steamusercontent.com/ugc/2115061845788468343/B7611EC7DCD2008B87D6518EBEFF0AD36EFE5B54/",
+    "MaterialIndex": 3,
+    "MeshURL": "https://raw.githubusercontent.com/RobMayer/TTSLibrary/master/advboxes/tuckbox_h_MSH.obj",
+    "NormalURL": "",
+    "TypeIndex": 0
+  },
+  "Description": "Challenge Scenario",
+  "DragSelectable": true,
+  "GMNotes": "scenarios/challenge_laid_to_rest.json",
+  "GUID": "e2dd57",
+  "Grid": true,
+  "GridProjection": false,
+  "Hands": true,
+  "HideWhenFaceDown": false,
+  "IgnoreFoW": false,
+  "LayoutGroupSortIndex": 0,
+  "Locked": false,
+  "LuaScript": "require(\"core/DownloadBox\")",
+  "LuaScriptState": "",
+  "MeasureMovement": false,
+  "Name": "Custom_Model",
+  "Nickname": "Laid to Rest",
+  "Snap": true,
+  "Sticky": true,
+  "Tooltip": true,
+  "Transform": {
+    "posX": 12.25,
+    "posY": 1.481,
+    "posZ": -4.014,
+    "rotX": 0,
+    "rotY": 270,
+    "rotZ": 0,
+    "scaleX": 2.21,
+    "scaleY": 0.46,
+    "scaleZ": 2.42
+  },
+  "Value": 0,
+  "XmlUI": ""
+}

objects/OfficialStandaloneChallengeScenarios.0ef5c8/ChallengeScenarios.9f6801/ReadorDie.9e73fa.json

@@ -72,7 +72,7 @@
   "Tooltip": true,
   "Transform": {
     "posX": 12.25,
-    "posY": 1.461,
+    "posY": 1.481,
     "posZ": -12.014,
     "rotX": 0,
     "rotY": 270,

objects/OfficialStandaloneChallengeScenarios.0ef5c8/ChallengeScenarios.9f6801/RedTideRising.5302f2.json

@@ -72,7 +72,7 @@
   "Tooltip": true,
   "Transform": {
     "posX": 12.25,
-    "posY": 1.459,
+    "posY": 1.481,
     "posZ": -20.014,
     "rotX": 0,
     "rotY": 270,

objects/PlaceholderBoxDummy.a93466.json

@@ -0,0 +1,45 @@
+{
+  "AltLookAngle": {
+    "x": 0,
+    "y": 0,
+    "z": 0
+  },
+  "Autoraise": true,
+  "ColorDiffuse": {
+    "b": 0.82353,
+    "g": 0.20157,
+    "r": 0
+  },
+  "Description": "This dummy is there to hold the up-to-date script file for placeholder boxes to be available for placeholder box spawning.",
+  "DragSelectable": true,
+  "GMNotes": "",
+  "GUID": "a93466",
+  "Grid": true,
+  "GridProjection": false,
+  "Hands": false,
+  "HideWhenFaceDown": false,
+  "IgnoreFoW": false,
+  "LayoutGroupSortIndex": 0,
+  "Locked": true,
+  "LuaScript": "require(\"core/DownloadBox\")",
+  "LuaScriptState": "",
+  "MeasureMovement": false,
+  "Name": "BlockRectangle",
+  "Nickname": "Placeholder Box Dummy",
+  "Snap": true,
+  "Sticky": true,
+  "Tooltip": true,
+  "Transform": {
+    "posX": 78,
+    "posY": 1.645,
+    "posZ": -33,
+    "rotX": 0,
+    "rotY": 0,
+    "rotZ": 0,
+    "scaleX": 1,
+    "scaleY": 1,
+    "scaleZ": 1
+  },
+  "Value": 0,
+  "XmlUI": ""
+}

objects/Playarea.721ba2.json

@@ -974,7 +974,7 @@
   "LuaScriptState": "{\"trackedLocations\":[]}",
   "MeasureMovement": false,
   "Name": "Custom_Token",
-  "Nickname": "Playarea",
+  "Nickname": "Play Area",
   "Snap": true,
   "Sticky": true,
   "Tags": [

objects/Playermat1White.8b081b.json

@@ -343,9 +343,10 @@
   "IgnoreFoW": false,
   "LayoutGroupSortIndex": 0,
   "Locked": true,
+  "LuaScript": "require(\"playermat/Playmat\")",
   "LuaScriptState_path": "Playermat1White.8b081b.luascriptstate",
-  "LuaScript_path": "Playermat1White.8b081b.ttslua",
   "MeasureMovement": false,
+  "Memo": "White",
   "Name": "Custom_Tile",
   "Nickname": "Playermat 1: White",
   "Snap": true,

objects/Playermat1White.8b081b.ttslua

@@ -1,11 +0,0 @@
----------------------------------------------------------
--- specific setup (different for each playmat)
----------------------------------------------------------
-
-TRASHCAN_GUID         = "147e80"
-STAT_TRACKER_GUID     = "e598c2"
-RESOURCE_COUNTER_GUID = "4406f0"
-CLUE_COUNTER_GUID     = "d86b7c"
-CLUE_CLICKER_GUID     = "db85d6"
-
-require("playermat/Playmat")

objects/Playermat2Orange.bd0ff4.json

@@ -343,9 +343,10 @@
   "IgnoreFoW": false,
   "LayoutGroupSortIndex": 0,
   "Locked": true,
+  "LuaScript": "require(\"playermat/Playmat\")",
   "LuaScriptState_path": "Playermat2Orange.bd0ff4.luascriptstate",
-  "LuaScript_path": "Playermat2Orange.bd0ff4.ttslua",
   "MeasureMovement": false,
+  "Memo": "Orange",
   "Name": "Custom_Tile",
   "Nickname": "Playermat 2: Orange",
   "Snap": true,

objects/Playermat2Orange.bd0ff4.ttslua

@@ -1,11 +0,0 @@
----------------------------------------------------------
--- specific setup (different for each playmat)
----------------------------------------------------------
-
-TRASHCAN_GUID         = "f7b6c8"
-STAT_TRACKER_GUID     = "b4a5f7"
-RESOURCE_COUNTER_GUID = "816d84"
-CLUE_COUNTER_GUID     = "1769ed"
-CLUE_CLICKER_GUID     = "3f22e5"
-
-require("playermat/Playmat")

objects/Playermat3Green.383d8b.json

@@ -343,9 +343,10 @@
   "IgnoreFoW": false,
   "LayoutGroupSortIndex": 0,
   "Locked": true,
+  "LuaScript": "require(\"playermat/Playmat\")",
   "LuaScriptState_path": "Playermat3Green.383d8b.luascriptstate",
-  "LuaScript_path": "Playermat3Green.383d8b.ttslua",
   "MeasureMovement": false,
+  "Memo": "Green",
   "Name": "Custom_Tile",
   "Nickname": "Playermat 3: Green",
   "Snap": true,

objects/Playermat3Green.383d8b.ttslua

@@ -1,11 +0,0 @@
----------------------------------------------------------
--- specific setup (different for each playmat)
----------------------------------------------------------
-
-TRASHCAN_GUID         = "5f896a"
-STAT_TRACKER_GUID     = "af7ed7"
-RESOURCE_COUNTER_GUID = "cd15ac"
-CLUE_COUNTER_GUID     = "032300"
-CLUE_CLICKER_GUID     = "891403"
-
-require("playermat/Playmat")

objects/Playermat4Red.0840d5.json

@@ -343,9 +343,10 @@
   "IgnoreFoW": false,
   "LayoutGroupSortIndex": 0,
   "Locked": true,
+  "LuaScript": "require(\"playermat/Playmat\")",
   "LuaScriptState_path": "Playermat4Red.0840d5.luascriptstate",
-  "LuaScript_path": "Playermat4Red.0840d5.ttslua",
   "MeasureMovement": false,
+  "Memo": "Red",
   "Name": "Custom_Tile",
   "Nickname": "Playermat 4: Red",
   "Snap": true,

objects/Playermat4Red.0840d5.ttslua

@@ -1,11 +0,0 @@
----------------------------------------------------------
--- specific setup (different for each playmat)
----------------------------------------------------------
-
-TRASHCAN_GUID         = "4b8594"
-STAT_TRACKER_GUID     = "e74881"
-RESOURCE_COUNTER_GUID = "a4b60d"
-CLUE_COUNTER_GUID     = "37be78"
-CLUE_CLICKER_GUID     = "4111de"
-
-require("playermat/Playmat")

objects/RulesReference.d99993.json

@@ -14,7 +14,7 @@
     "PDFPage": 0,
     "PDFPageOffset": 0,
     "PDFPassword": "",
-    "PDFUrl": "https://images-cdn.fantasyflightgames.com/filer_public/c4/b0/c4b0d66c-d79e-411b-bdb5-b5d8c457d4bc/ahc01_rules_reference_web.pdf"
+    "PDFUrl": "http://cloud-3.steamusercontent.com/ugc/2115061845793806189/6FC67F9AF9224452E2D8F25E63B88D702B21B0DC/"
   },
   "Description": "",
   "DragSelectable": true,

objects/SoundCube.3c988f.json

@@ -35,9 +35,6 @@
   "Nickname": "SoundCube",
   "Snap": true,
   "Sticky": true,
-  "Tags": [
-    "SoundCube"
-  ],
   "Tooltip": true,
   "Transform": {
     "posX": 78,

objects/TokenArranger.022907.json

@@ -40,9 +40,6 @@
   "Nickname": "Token Arranger",
   "Snap": true,
   "Sticky": true,
-  "Tags": [
-    "TokenArranger"
-  ],
   "Tooltip": true,
   "Transform": {
     "posX": -42.3,

src/accessories/CampaignImporterExporter.ttslua

@@ -1,11 +1,12 @@
-local blessCurseApi = require("chaosbag/BlessCurseManagerApi")
+local blessCurseApi     = require("chaosbag/BlessCurseManagerApi")
-local chaosBagApi = require("chaosbag/ChaosBagApi")
+local chaosBagApi       = require("chaosbag/ChaosBagApi")
-local deckImporterApi = require("arkhamdb/DeckImporterApi")
+local deckImporterApi   = require("arkhamdb/DeckImporterApi")
-local optionPanelApi = require("core/OptionPanelApi")
+local guidReferenceApi  = require("core/GUIDReferenceApi")
-local playAreaApi = require("core/PlayAreaApi")
+local optionPanelApi    = require("core/OptionPanelApi")
+local playAreaApi       = require("core/PlayAreaApi")
+local playmatApi        = require("playermat/PlaymatApi")
 
 local campaignTokenData = {
-  GUID = "51b1c9",
   Name = "Custom_Model",
   Transform = {
     posX = -21.25,
@@ -18,9 +19,7 @@ local campaignTokenData = {
     scaleY = 2,
     scaleZ = 2
   },
-  Nickname = "Arkham Coin",
   Description = "SCED Importer Token",
-  GMNotes = "",
   Tags = {
     "ImporterToken"
   },
@@ -33,56 +32,48 @@ local campaignTokenData = {
     MaterialIndex = 2,
     TypeIndex = 0,
     CustomShader = {
-    SpecularColor = {
+      SpecularColor = {
-      r = 0.7222887,
+        r = 0.7222887,
-      g = 0.507659256,
+        g = 0.507659256,
-      b = 0.339915335
+        b = 0.339915335
-    },
+      },
-    SpecularIntensity = 0.4,
+      SpecularIntensity = 0.4,
-    SpecularSharpness = 7.0,
+      SpecularSharpness = 7.0,
-    FresnelStrength = 0.0
+      FresnelStrength = 0.0
     },
     CastShadows = true
   }
 }
+local COLORS = { "White", "Orange", "Green", "Red" }
 
--- counter GUIDS (4x damage and 4x horror)
+function onLoad()
-local DAMAGE_HORROR_GUIDS = {
-  "eb08d6"; "e64eec"; "1f5a0a"; "591a45";
-  "468e88"; "0257d9"; "7b5729"; "beb964";
-  }
-
-local TOUR_GUID = "0e5aa8"
-local campaignBoxGUID
-
-function onLoad(save_state)
-  campaignBoxGUID = ""
-
   self.createButton({
     click_function = "findCampaignFromToken",
     function_owner = self,
     label = "Import",
-    tooltip = "Load in a campaign save from a token!\n\n(Token can be anywhere on the table, but ensure there is only 1!)",    
+    tooltip = "Load in a campaign save from a token!\n\n(Token can be anywhere on the table, but ensure there is only 1!)",
-    position = {x=-1, y=0.2, z=0},
+    position = { x = -1, y = 0.2, z = 0 },
     font_size = 400,
     width = 1400,
     height = 600,
-    scale = {0.5, 1, 0.5},
+    scale = { 0.5, 1, 0.5 },
   })
   self.createButton({
     click_function = "createCampaignToken",
     function_owner = self,
     label = "Export",
     tooltip = "Create a campaign save token!\n\n(Ensure all chaos tokens have been unsealed!)",
-    position = {x=1, y=0.2, z=0},
+    position = { x = 1, y = 0.2, z = 0 },
     font_size = 400,
     width = 1400,
     height = 600,
-    scale = {0.5, 1, 0.5},
+    scale = { 0.5, 1, 0.5 },
   })
 end
 
--- The main import functions.  Due to timing concerns, has to be split up into several separate methods to allow for Wait conditions
+---------------------------------------------------------
+-- main import functions (split up to allow for Wait conditions)
+---------------------------------------------------------
 
 -- Identifies import token, determines campaign box and downloads it (if needed)
 function findCampaignFromToken(_, _, _)
@@ -91,11 +82,13 @@ function findCampaignFromToken(_, _, _)
   if #coinObjects == 0 then
     broadcastToAll("Could not find importer token", Color.Red)
   elseif #coinObjects > 1 then
-    broadcastToAll("More than 1 importer token found. Please delete all but 1 importer token", Color.Yellow)    
+    broadcastToAll("More than 1 importer token found. Please delete all but 1 importer token", Color.Yellow)
   else
     coin = coinObjects[1]
+
     local importData = JSON.decode(coin.getGMNotes())
     campaignBoxGUID = importData["box"]
+
     local campaignBox = getObjectFromGUID(campaignBoxGUID)
     if campaignBox.type == "Generic" then
       campaignBox.call("buttonClick_download")
@@ -110,24 +103,24 @@ function findCampaignFromToken(_, _, _)
       end,
       function()
         local obj = getObjectFromGUID(campaignBoxGUID)
-        if obj == nil then 
+        if obj == nil then
-          return false 
+          return false
         else
           return obj.type == "Bag" and obj.getLuaScript() ~= ""
         end
       end,
       2,
       function() broadcastToAll("Error loading campaign box") end
-    ) 
+    )
   end
 end
 
 -- After box has been downloaded, places content on table
 function placeCampaignFromToken(importData)
-  getObjectFromGUID(campaignBoxGUID).call("buttonClick_place")
+  getObjectFromGUID(importData["box"]).call("buttonClick_place")
   Wait.condition(
     function() createCampaignFromToken(importData) end,
-    function() return findCampaignLog() ~= nil end,
+    function() return findUniqueObjectWithTag("CampaignLog") ~= nil end,
     2,
     function() broadcastToAll("Error placing campaign box") end
   )
@@ -135,82 +128,86 @@ end
 
 -- After content is placed on table, conducts all the other import operations
 function createCampaignFromToken(importData)
-  findCampaignLog().destruct()
+  -- destroy existing campaign log and load saved campaign log
-  --create campaign log
+  findUniqueObjectWithTag("CampaignLog").destruct()
-  spawnObjectData({data = importData["log"]}) 
+  spawnObjectData({ data = importData["log"] })
-  --create chaos bag
+  
   chaosBagApi.setChaosBagState(importData["bag"])
-  --populate trauma values
+
+  -- populate trauma values
   if importData["trauma"] then
-    updateCounters(importData["trauma"])
+    setTrauma(importData["trauma"])
   end
-  --populate ArkhamDB deck IDs
+
+  -- populate ArkhamDB deck IDs
   if importData["decks"] then
     deckImporterApi.setUiState(importData["decks"])
   end
-  --set investigator count
+
   playAreaApi.setInvestigatorCount(importData["clueCount"])
-  --set campaign guide page
+
-  local guide = findCampaignGuide()
+  -- set campaign guide page
+  local guide = findUniqueObjectWithTag("CampaignGuide")
   if guide then
     Wait.condition(
-      -- Called after the condition function returns true
+    -- Called after the condition function returns true
-      function()
+      function() log("Campaign Guide import successful!") end,
-        log("Campaign Guide import successful!")
+      -- Condition function that is called continiously until returs true or timeout is reached
-      end,
+      function() return guide.Book.setPage(importData["guide"]) end,
-      -- Condition function that is called continiously until returs true or timeout is reached 
-      function()
-        guide.Book.setPage(importData["guide"])
-        return guide.Book.getPage() == importData["guide"]
-      end,
       -- Amount of time in seconds until the Wait times out
       1,
       -- Called if the Wait times out
-      function()
+      function() log("Campaign Guide import failed!") end
-        log("Campaign Guide import failed!")
-      end
     )
   end
-  Wait.time(
+
-    function() optionPanelApi.loadSettings(importData["options"]) end,
+  Wait.time(function() optionPanelApi.loadSettings(importData["options"]) end, 0.5)
-    0.5
+
-  )
+  -- destroy Tour Starter token
-  getObjectFromGUID(TOUR_GUID).destruct()
+  local tourStarter = guidReferenceApi.getObjectByOwnerAndType("Mythos", "TourStarter")
+  tourStarter.destruct()
+
+  -- restore PlayArea image
   playAreaApi.updateSurface(importData["playmat"])
+
   broadcastToAll("Campaign successfully imported!", Color.Green)
 end
 
-
 -- Creates a campaign token with save data encoded into GM Notes based on the current state of the table
 function createCampaignToken(_, playerColor, _)
   -- clean up chaos tokens
   blessCurseApi.removeAll(playerColor)
   chaosBagApi.releaseAllSealedTokens(playerColor)
 
-  local campaignBoxGUID = ""
   -- find active campaign
+  local campaignBox
   for _, obj in ipairs(getObjectsWithTag("CampaignBox")) do
     if obj.type == "Bag" and #obj.getObjects() == 0 then
-      if campaignBoxGUID ~= "" then
+      if not campaignBox then
+        campaignBox = obj
+      else
         broadcastToAll("Multiple empty campaign box detected; delete all but one.", Color.Red)
         return
       end
-      campaignBoxGUID = obj.getGUID()
     end
   end
-  if campaignBoxGUID == "" then
+  if not campaignBox then
     broadcastToAll("Campaign box with all placed objects not found!", Color.Red)
     return
   end
-  local campaignLog = findCampaignLog()
+
+  local campaignLog = findUniqueObjectWithTag("CampaignLog")
   if campaignLog == nil then
     broadcastToAll("Campaign log not found!", Color.Red)
     return
   end
-  local traumaValues = nil
+
+  local traumaValues = {
+    0, 0, 0, 0,
+    0, 0, 0, 0
+  }
   local counterData = campaignLog.getVar("ref_buttonData")
   if counterData ~= nil then
-    traumaValues = {}
     printToAll("Trauma values found in campaign log!", "Green")
     for i = 1, 10, 3 do
       traumaValues[1 + (i - 1) / 3] = counterData.counter[i].value
@@ -220,78 +217,49 @@ function createCampaignToken(_, playerColor, _)
     printToAll("Trauma values could not be found in campaign log!", "Yellow")
     printToAll("Default values for health and sanity loaded.", "Yellow")
   end
-  local campaignGuide = findCampaignGuide()
+
+  local campaignGuide = findUniqueObjectWithTag("CampaignGuide")
   if campaignGuide == nil then
     broadcastToAll("Campaign guide not found!", Color.Red)
     return
   end
-  local campaignGuidePage = campaignGuide.Book.getPage()
+
   local campaignData = {
-    box = campaignBoxGUID,
+    box = campaignBox.getGUID(),
     log = campaignLog.getData(),
     bag = chaosBagApi.getChaosBagState(),
     trauma = traumaValues,
     decks = deckImporterApi.getUiState(),
     clueCount = playAreaApi.getInvestigatorCount(),
-    guide = campaignGuidePage,
+    guide = campaignGuide.Book.getPage(),
     options = optionPanelApi.getOptions(),
     playmat = playAreaApi.getSurface()
   }
   campaignTokenData.GMNotes = JSON.encode(campaignData)
-  campaignTokenData.Nickname = os.date("%b %d ") .. getObjectFromGUID(campaignBoxGUID).getName() .. " Save"
+  campaignTokenData.Nickname = os.date("%b %d ") .. campaignBox.getName() .. " Save"
-  spawnObjectData({
+  spawnObjectData({ data = campaignTokenData })
-    data = campaignTokenData,
-    position = {-21.25, 1.68, 55.59}
-  })
   broadcastToAll("Campaign successfully exported! Save coin object to import on a fresh save", Color.Green)
 end
 
-
+---------------------------------------------------------
 -- helper functions
+---------------------------------------------------------
 
-function findCampaignLog()
+function findUniqueObjectWithTag(tag)
-  local campaignLog = getObjectsWithTag("CampaignLog")
+  local objects = getObjectsWithTag(tag)
-  if campaignLog then
+  if not objects then return end
-    if #campaignLog == 1 then
+
-    return campaignLog[1]
+  if #objects == 1 then
-    else
+    return objects[1]
-      broadcastToAll("More than 1 campaign log detected; delete all but one.", Color.Red)
-      return nil
-    end
   else
+    broadcastToAll("More than 1 " .. tag .. " detected; delete all but one.", Color.Red)
     return nil
   end
 end
 
-function findCampaignGuide() 
+function setTrauma(trauma)
-  local campaignGuide = getObjectsWithTag("CampaignGuide")
+  for i = 1, 4 do
-  if campaignGuide then
+    playmatApi.updateCounter(COLORS[i], "DamageCounter", trauma[i])
-    if #campaignGuide == 1 then
+    playmatApi.updateCounter(COLORS[i], "HorrorCounter", trauma[i + 4])
-      return campaignGuide[1]
-      else
-        broadcastToAll("More than 1 campaign guide detected; delete all but one.", Color.Red)
-        return nil
-      end
-  else
-    return nil
-  end
-end
-
-function updateCounters(tableOfNewValues)
-  if tonumber(tableOfNewValues) then
-    local value = tableOfNewValues
-    tableOfNewValues = {}
-    for i = 1, #DAMAGE_HORROR_GUIDS do
-      table.insert(tableOfNewValues, value)
-    end
-  end
-  
-  for i, guid in ipairs(DAMAGE_HORROR_GUIDS) do
-    local TOKEN = getObjectFromGUID(guid)
-    if TOKEN ~= nil then
-      TOKEN.call("updateVal", tableOfNewValues[i])
-    else
-      printToAll(": No. " .. i .. " could not be found.", "Yellow")
-    end
   end
 end

src/accessories/CleanUpHelper.ttslua

@@ -3,79 +3,24 @@
 - puts everything on playmats and hands into respective trashcans
 - use the IGNORE_TAG to exclude objects from tidying (default: "CleanUpHelper_Ignore")]]
 
-local blessCurseManagerApi      = require("chaosbag/BlessCurseManagerApi")
+local blessCurseManagerApi = require("chaosbag/BlessCurseManagerApi")
-local chaosBagApi               = require("chaosbag/ChaosBagApi")
+local chaosBagApi          = require("chaosbag/ChaosBagApi")
-local playAreaApi               = require("core/PlayAreaApi")
+local guidReferenceApi     = require("core/GUIDReferenceApi")
-local playmatApi                = require("playermat/PlaymatApi")
+local playAreaApi          = require("core/PlayAreaApi")
-local soundCubeApi              = require("core/SoundCubeApi")
+local playmatApi           = require("playermat/PlaymatApi")
-local tokenSpawnTrackerApi      = require("core/token/TokenSpawnTrackerApi")
+local soundCubeApi         = require("core/SoundCubeApi")
-
+local tokenSpawnTrackerApi = require("core/token/TokenSpawnTrackerApi")
--- these objects will be ignored
-local IGNORE_GUIDS              = {
-  -- big playmat, change image panel and investigator counter
-  "b7b45b", "f182ee", "721ba2",
-  -- bless/curse manager
-  "afa06b", "bd0253", "5933fb",
-  -- stuff on agenda/act playmat
-  "85c4c6", "4a3aa4", "fea079", "b015d8", "11e0cf", "9f334f", "70b9f6", "0a5a29",
-  -- doom/location token bag
-  "47ffc3", "170f10",
-  -- table
-  "4ee1f2"
-}
 
 -- objects with this tag will be ignored
 local IGNORE_TAG                = "CleanUpHelper_ignore"
 
 -- colors and order for following tables
-local COLORS                    = { "White", "Orange", "Green", "Red", "Agenda" }
+local COLORS                    = { "White", "Orange", "Green", "Red", "Mythos" }
-
--- counter GUIDS (4x damage and 4x horror)
-local DAMAGE_HORROR_GUIDS       = {
-  "eb08d6", "e64eec", "1f5a0a", "591a45",
-  "468e88", "0257d9", "7b5729", "beb964",
-}
-
 local campaignLog
 local RESET_VALUES              = {}
-
+local loadingFailedBefore       = false
--- GUIDS of objects (in order of ownership relating to 'COLORS')
-local PLAYERMAT_GUIDS           = { "8b081b", "bd0ff4", "383d8b", "0840d5" }
-local RESOURCE_GUIDS            = { "4406f0", "816d84", "cd15ac", "a4b60d" }
-local TRACKER_GUIDS             = { "e598c2", "b4a5f7", "af7ed7", "e74881" }
-local CLUE_GUIDS                = { "d86b7c", "1769ed", "032300", "37be78" }
-local CLUE_CLICKER_GUIDS        = { "db85d6", "3f22e5", "891403", "4111de" }
-local TRASHCAN_GUIDS            = { "147e80", "f7b6c8", "5f896a", "4b8594", "70b9f6" }
-
--- values for physics.cast (4 entries for player zones, 5th entry for agenda/act deck, 6th for campaign log)
-local PHYSICS_POSITION          = {
-  { -54.5, 2, 21 },
-  { -54.5, 2, -21 },
-  { -27.0, 2, 26 },
-  { -27.0, 2, -26 },
-  { -02.0, 2, 10 },
-  { -00.0, 2, -27 }
-}
-
-local PHYSICS_ROTATION          = {
-  270,
-  270,
-  0,
-  180,
-  270,
-  0
-}
-
-local PHYSICS_SCALE             = {
-  { 36.6, 1, 14.5 },
-  { 36.6, 1, 14.5 },
-  { 34.0, 1, 14.5 },
-  { 34.0, 1, 14.5 },
-  { 55.0, 1, 13.5 },
-  { 05.0, 1, 05.0 }
-}
-
 local optionsVisible            = false
+
 local options                   = {}
 options["importTrauma"]         = true
 options["tidyPlayermats"]       = true
@@ -84,7 +29,6 @@ options["removeDrawnLines"]     = false
 local buttonParameters          = {}
 buttonParameters.function_owner = self
 
-local loadingFailedBefore       = false
 
 ---------------------------------------------------------
 -- option loading and GUI setup
@@ -131,14 +75,6 @@ function onLoad(savedData)
   buttonParameters.position.z     = 1.1
   buttonParameters.width          = 1550
   self.createButton(buttonParameters)
-
-  -- create single table for ignoring
-  for _, v in ipairs(CLUE_GUIDS) do table.insert(IGNORE_GUIDS, v) end
-  for _, v in ipairs(CLUE_CLICKER_GUIDS) do table.insert(IGNORE_GUIDS, v) end
-  for _, v in ipairs(RESOURCE_GUIDS) do table.insert(IGNORE_GUIDS, v) end
-  for _, v in ipairs(TRASHCAN_GUIDS) do table.insert(IGNORE_GUIDS, v) end
-  for _, v in ipairs(PLAYERMAT_GUIDS) do table.insert(IGNORE_GUIDS, v) end
-  for _, v in ipairs(DAMAGE_HORROR_GUIDS) do table.insert(IGNORE_GUIDS, v) end
 end
 
 ---------------------------------------------------------
@@ -178,13 +114,8 @@ function cleanUp(_, color)
   getTrauma()
 
   -- delay to account for potential state change
-  Wait.time(function()
+  Wait.time(updateCounters, 0.2)
-    updateCounters(RESOURCE_GUIDS, 5, "Resource")
-    updateCounters(CLUE_CLICKER_GUIDS, 0, "Clue clicker")
-    updateCounters(DAMAGE_HORROR_GUIDS, RESET_VALUES, "Damage / Horror")
-  end, 0.2)
 
-  resetSkillTrackers()
   resetDoomCounter()
   blessCurseManagerApi.removeAll(color)
   removeLines()
@@ -201,39 +132,20 @@ end
 -- modular functions, called by other functions
 ---------------------------------------------------------
 
-function updateCounters(tableOfGUIDs, newValues, info)
+function updateCounters()
-  -- instead of a table, this will be used if just a single value is provided
+  playmatApi.updateCounter("All", "ResourceCounter" , 5)
-  local singleValue = tonumber(newValues)
+  playmatApi.updateCounter("All", "ClickableClueCounter" , 0)
+  playmatApi.resetSkillTracker("All")
 
-  for i, guid in ipairs(tableOfGUIDs) do
+  for i = 1, 4 do
-    local TOKEN = getObjectFromGUID(guid)
+    playmatApi.updateCounter(COLORS[i], "DamageCounter", RESET_VALUES.Damage[i])
-    local newValue = singleValue or newValues[i]
+    playmatApi.updateCounter(COLORS[i], "HorrorCounter", RESET_VALUES.Horror[i])
-
-    if TOKEN ~= nil then
-      TOKEN.call("updateVal", newValue)
-    else
-      printToAll(info .. ": No. " .. i .. " could not be found.", "Yellow")
-    end
-  end
-end
-
--- set investigator skill trackers to "1, 1, 1, 1"
-function resetSkillTrackers()
-  for i, guid in ipairs(TRACKER_GUIDS) do
-    local obj = getObjectFromGUID(guid)
-
-    if obj ~= nil then
-      obj.call("updateStats", { 1, 1, 1, 1 })
-    else
-      printToAll("Skill tracker for " .. COLORS[i] .. " playmat could not be found.", "Yellow")
-    end
   end
 end
 
 -- reset doom on agenda
 function resetDoomCounter()
-  local doomCounter = getObjectFromGUID("85c4c6")
+  local doomCounter = guidReferenceApi.getObjectByOwnerAndType("Mythos", "DoomCounter")
-
   if doomCounter ~= nil then
     doomCounter.call("updateVal")
   else
@@ -241,19 +153,19 @@ function resetDoomCounter()
   end
 end
 
--- gets the GUID of a custom data helper (if present) and adds it to the ignore list
+-- adds the ignore tag to the custom data helper
 function ignoreCustomDataHelper()
   local customDataHelper = playAreaApi.getCustomDataHelper()
   if customDataHelper then
-    table.insert(IGNORE_GUIDS, customDataHelper.getGUID())
+    customDataHelper.addTag(IGNORE_TAG)
   end
 end
 
 -- read values for trauma from campaign log if enabled
 function getTrauma()
   RESET_VALUES = {
-    0, 0, 0, 0,
+    Damage = { 0, 0, 0, 0 },
-    0, 0, 0, 0
+    Horror = { 0, 0, 0, 0 }
   }
 
   -- stop here if trauma import is disabled
@@ -263,13 +175,12 @@ function getTrauma()
   end
 
   -- get campaign log
-  campaignLog = findObjects(6)[1]
+  campaignLog = getObjectsWithTag("CampaignLog")[1]
   if campaignLog == nil then
     printToAll("Campaign log not found in standard position!", "Yellow")
     printToAll("Default values for health and sanity loaded.", "Yellow")
     return
   end
-  campaignLog = campaignLog.hit_object
   loadTrauma()
 end
 
@@ -280,7 +191,14 @@ function loadTrauma()
 
   if trauma ~= nil then
     printToAll("Trauma values found in campaign log!", "Green")
-    RESET_VALUES = campaignLog.call("returnTrauma")
+    trauma = campaignLog.call("returnTrauma")
+    for i = 1, 8 do
+      if i < 5 then
+        RESET_VALUES.Damage[i] = trauma[i]
+      else
+        RESET_VALUES.Horror[i-4] = trauma[i]
+      end
+    end
     loadingFailedBefore = false
   elseif loadingFailedBefore then
     printToAll("Trauma values could not be found in campaign log!", "Yellow")
@@ -303,7 +221,7 @@ end
 -- remove drawn lines
 function removeLines()
   if options["removeDrawnLines"] then
-    printToAll("Removing vector lines...", "White")
+    printToAll("Removing global vector lines...", "White")
     Global.setVectorLines({})
   end
 end
@@ -312,40 +230,40 @@ end
 function discardHands()
   if not options["tidyPlayermats"] then return end
   for i = 1, 4 do
-    local trashcan = getObjectFromGUID(TRASHCAN_GUIDS[i])
+    local trash = guidReferenceApi.getObjectByOwnerAndType(COLORS[i], "Trash")
-    if trashcan == nil then return end
+    if trash == nil then return end
     local hand = Player[playmatApi.getPlayerColor(COLORS[i])].getHandObjects()
     for j = #hand, 1, -1 do
-      trashcan.putObject(hand[j])
+      trash.putObject(hand[j])
     end
   end
 end
 
 -- clean up for play area
 function tidyPlayareaCoroutine()
-  local trashcan = getObjectFromGUID(TRASHCAN_GUIDS[5])
+  local trash = guidReferenceApi.getObjectByOwnerAndType("Mythos", "Trash")
-  local PLAYMATZONE = getObjectFromGUID("a2f932")
+  local playAreaZone = guidReferenceApi.getObjectByOwnerAndType("Mythos", "PlayAreaZone")
 
-  if PLAYMATZONE == nil then
+  if playAreaZone == nil then
     printToAll("Scripting zone for main play area could not be found!", "Red")
-  elseif trashcan == nil then
+  elseif trash == nil then
     printToAll("Trashcan for main play area could not be found!", "Red")
   else
-    for _, obj in ipairs(PLAYMATZONE.getObjects()) do
+    for _, obj in ipairs(playAreaZone.getObjects()) do
       -- ignore these elements
-      if not tableContains(IGNORE_GUIDS, obj.getGUID()) and obj.hasTag(IGNORE_TAG) == false then
+      if obj.hasTag(IGNORE_TAG) == false and checkMemo(obj) == false then
         coroutine.yield(0)
-        trashcan.putObject(obj)
+        trash.putObject(obj)
       end
     end
   end
 
-  printToAll("Tidying playermats and agenda mat...", "White")
+  printToAll("Tidying playermats and mythos area...", "White")
   startLuaCoroutine(self, "tidyPlayerMatCoroutine")
   return 1
 end
 
--- clean up for the four playermats and the agenda/act playmat
+-- clean up for the four playermats and the mythos area
 function tidyPlayerMatCoroutine()
   for i = 1, 5 do
     -- only continue for playermat (1-4) if option enabled
@@ -353,32 +271,38 @@ function tidyPlayerMatCoroutine()
       -- delay for animation purpose
       for k = 1, 30 do coroutine.yield(0) end
 
-      -- get respective trashcan
+      -- get respective trash
-      local trashcan = getObjectFromGUID(TRASHCAN_GUIDS[i])
+      local trash = guidReferenceApi.getObjectByOwnerAndType(COLORS[i], "Trash")
-      if trashcan == nil then
+      if trash == nil then
         printToAll("Trashcan for " .. COLORS[i] .. " playmat could not be found!", "Red")
         return 1
       end
 
-      for _, entry in ipairs(findObjects(i)) do
+      local objList
-        local obj = entry.hit_object
+      if i < 5 then
-        local desc_low = string.lower(obj.getDescription())
+        objList = playmatApi.searchAroundPlaymat(COLORS[i])
+      else
+        objList = searchMythosArea()
+      end
 
+      for _, obj in ipairs(objList) do
         -- ignore these elements
-        if not tableContains(IGNORE_GUIDS, obj.getGUID()) and obj.hasTag(IGNORE_TAG) == false and
+        if obj.hasTag(IGNORE_TAG) == false
-            desc_low ~= "chaos bag" and desc_low ~= "action token" then
+            and obj.hasTag("ActionToken") == false
+            and obj.hasTag("chaosBag") == false
+            and checkMemo(obj) == false then
           coroutine.yield(0)
-          trashcan.putObject(obj)
+          trash.putObject(obj)
 
-          -- flip action tokens back to ready
+        -- flip action tokens back to ready
-        elseif desc_low == "action token" and obj.is_face_down then
+        elseif obj.hasTag("ActionToken") == false and obj.is_face_down then
           obj.flip()
         end
       end
 
       -- reset "activeInvestigatorId"
       if i < 5 then
-        local playermat = getObjectFromGUID(PLAYERMAT_GUIDS[i])
+        local playermat = guidReferenceApi.getObjectByOwnerAndType(COLORS[i], "Playermat")
         if playermat then
           playermat.setVar("activeInvestigatorId", "00000")
         end
@@ -386,7 +310,7 @@ function tidyPlayerMatCoroutine()
     end
   end
 
-  local datahelper = getObjectFromGUID("708279")
+  local datahelper = guidReferenceApi.getObjectByOwnerAndType("Mythos", "DataHelper")
   if datahelper then
     datahelper.setTable("SPAWNED_PLAYER_CARD_GUIDS", {})
   end
@@ -399,23 +323,31 @@ end
 -- helper functions
 ---------------------------------------------------------
 
--- find objects depending on index (1 to 4 for playermats, 5 for agenda/act playmat, 6 for campaign log)
+-- find objects in the mythos area
-function findObjects(num)
+function searchMythosArea()
-  return Physics.cast({
+  local searchResult = Physics.cast({
     direction    = { 0, 1, 0 },
     max_distance = 1,
     type         = 3,
-    size         = PHYSICS_SCALE[num],
+    size         = { 55, 1, 13.5 },
-    origin       = PHYSICS_POSITION[num],
+    origin       = { -2, 2, 10 },
-    orientation  = { 0, PHYSICS_ROTATION[num], 0 },
+    orientation  = { 0, 270, 0 },
     debug        = false
   })
+
+  local objList = {}
+  for _, v in ipairs(searchResult) do
+    table.insert(objList, v.hit_object)
+  end
+  return objList
 end
 
--- search a table for a value, return true if found (else returns false)
+-- checks if the object is owned by a playermat or the mythos, returns boolean
-function tableContains(table, value)
+function checkMemo(obj)
-  for _, v in ipairs(table) do
+  local memo = obj.getMemo()
-    if v == value then
+  if memo then
+    local decoded = JSON.decode(memo) or {}
+    if decoded.matColor then
       return true
     end
   end

src/accessories/TokenArranger.ttslua

@@ -312,6 +312,10 @@ function layout(_, _, isRightClick)
     local value = tonumber(objData.Nickname)
     local precedence = tokenPrecedence[objData.Nickname]
 
+    -- remove GUID to avoid issues for high latency clients
+    objData["GUID"] = nil
+
+    -- store data with value / precendence
     data[i] = {
       token = objData,
       value = value or precedence[1]

src/accessories/TokenArrangerApi.ttslua

@@ -1,11 +1,12 @@
 do
   local TokenArrangerApi = {}
+  local guidReferenceApi = require("core/GUIDReferenceApi")
 
   -- local function to call the token arranger, if it is on the table
   ---@param functionName String Name of the function to cal
   ---@param argument Variant Parameter to pass
   local function callIfExistent(functionName, argument)
-    local tokenArranger = getObjectsWithTag("TokenArranger")[1]
+    local tokenArranger = guidReferenceApi.getObjectByOwnerAndType("Mythos", "TokenArranger")
     if tokenArranger ~= nil then
       tokenArranger.call(functionName, argument)
     end

src/arkhamdb/ArkhamDb.ttslua

@@ -198,7 +198,7 @@ do
       local altArt     = { front = "normal", back = "normal" }
 
       -- translating front ID
-      if altFrontId > 90000 and altFrontId < 90047 then
+      if altFrontId > 90000 and altFrontId < 90050 then
         altArt.front = "parallel"
       elseif altFrontId > 01500 and altFrontId < 01506 then
         altArt.front = "revised"
@@ -207,7 +207,7 @@ do
       end
 
       -- translating back ID
-      if altBackId > 90000 and altBackId < 90047 then
+      if altBackId > 90000 and altBackId < 90050 then
         altArt.back = "parallel"
       elseif altBackId > 01500 and altBackId < 01506 then
         altArt.back = "revised"
@@ -295,7 +295,12 @@ do
       local card = allCardsBagApi.getCardById(cardId)
       if (card ~= nil and card.metadata.bonded ~= nil) then
         for _, bond in ipairs(card.metadata.bonded) do
-          bondedCards[bond.id] = bond.count
+          -- add a bonded card for each copy of the parent card (except for Pendant of the Queen)
+          if bond.id == "06022" then
+            bondedCards[bond.id] = bond.count
+          else
+            bondedCards[bond.id] = bond.count * cardCount
+          end
           -- We need to know which cards are bonded to determine their position, remember them
           bondedList[bond.id] = true
           -- Also adding taboo versions of bonded cards to the list

src/arkhamdb/DeckImporterApi.ttslua

@@ -1,7 +1,11 @@
 do
   local DeckImporterApi = {}
-  local DECK_IMPORTER_GUID = "a28140"
+  local guidReferenceApi = require("core/GUIDReferenceApi")
-  
+
+  local function getDeckImporter()
+    return guidReferenceApi.getObjectByOwnerAndType("Mythos", "DeckImporter")
+  end
+
   -- Returns a table with the full state of the UI, including options and deck IDs.
   -- This can be used to persist via onSave(), or provide values for a load operation
   -- Table values:
@@ -14,7 +18,7 @@ do
   --   investigators: True if investigator cards should be spawned
   DeckImporterApi.getUiState = function()
     local passthroughTable = {}
-    for k,v in pairs(getObjectFromGUID(DECK_IMPORTER_GUID).call("getUiState")) do
+    for k,v in pairs(getDeckImporter().call("getUiState")) do
       passthroughTable[k] = v
     end
     return passthroughTable
@@ -31,7 +35,7 @@ do
   --   loadNewest: True if the most upgraded version of the deck should be loaded
   --   investigators: True if investigator cards should be spawned
   DeckImporterApi.setUiState = function(uiStateTable)
-    return getObjectFromGUID(DECK_IMPORTER_GUID).call("setUiState", uiStateTable)
+    return getDeckImporter().call("setUiState", uiStateTable)
   end
 
   return DeckImporterApi

src/arkhamdb/DeckImporterMain.ttslua

@@ -88,6 +88,7 @@ function loadCards(slots, investigatorId, bondedList, customizations, playerColo
     handleAncestralKnowledge(cardsToSpawn)
     handleUnderworldMarket(cardsToSpawn, playerColor)
     handleHunchDeck(investigatorId, cardsToSpawn, playerColor)
+    handleSpiritDeck(investigatorId, cardsToSpawn, playerColor)
     handleCustomizableUpgrades(cardsToSpawn, customizations)
     handlePeteSignatureAssets(investigatorId, cardsToSpawn)
 
@@ -322,6 +323,48 @@ function handleHunchDeck(investigatorId, cardList, playerColor)
   end
 end
 
+-- If the investigator is Parallel Jim Culver, extract all Ally assets to SetAside5 to build the Spirit
+--     Deck.
+---@param investigatorId String ID for the deck's investigator card. Passed separately because the
+---    investigator may not be included in the cardList
+---@param cardList Table Deck list being created
+---@param playerColor String Color this deck is being loaded for
+function handleSpiritDeck(investigatorId, cardList, playerColor)
+  if investigatorId == "02004-p" or investigatorId == "02004-pb" then -- Parallel Jim Culver
+    local spiritList = {}
+    for i, card in ipairs(cardList) do
+      if card.metadata.id == "90053" or (
+          card.metadata.type == "Asset"
+          and card.metadata.traits ~= nil
+          and string.match(card.metadata.traits, "Ally")
+          and card.metadata.level ~= nil
+          and card.metadata.level < 3) then
+        table.insert(spiritList, i)
+      end
+    end
+    -- Process allies to move them to the spirit deck. This is done in reverse
+    -- order because the sorting needs to be reversed (deck sorts for face down)
+    -- Performance here may be an issue, as table.remove() is an O(n) operation
+    -- which makes the full shift O(n^2). But keep it simple unless it becomes
+    -- a problem
+    for i = #spiritList, 1, -1 do
+      local moving = cardList[spiritList[i]]
+      moving.zone = "SetAside5"
+      table.remove(cardList, spiritList[i])
+      table.insert(cardList, moving)
+    end
+    if #spiritList < 10 then
+      printToAll("Jim's spirit deck must have 9 Ally assets but the deck only has " .. (#spiritList - 1) ..
+          " Ally assets.", playerColor)
+    elseif #spiritList > 11 then
+      printToAll("Moved all " .. (#spiritList - 1) ..
+          " Ally assets to the spirit deck, reduce it to 10 (including Vengeful Shade).", playerColor)
+    else
+      printToAll("Built Jim's spirit deck", playerColor)
+    end
+  end
+end
+
 -- For any customization upgrade cards in the card list, process the metadata from the deck to
 -- set the save state to show the correct checkboxes/text field values
 ---@param cardList Table Deck list being created

src/arkhamdb/DeckImporterUi.ttslua

@@ -58,36 +58,9 @@ end
 --   loadNewest: True if the most upgraded version of the deck should be loaded
 --   investigators: True if investigator cards should be spawned
 function setUiState(uiStateTable)
-  -- Callback functions aren't triggered when editing buttons/inputs so values must be set manually
+  self.clearButtons()
-
+  self.clearInputs()
-  if uiStateTable["greenDeck"] then
+  initializeUi(uiStateTable)
-    greenDeckId = uiStateTable["greenDeck"]
-    self.editInput({index=0, value=greenDeckId})
-  end
-  if uiStateTable["redDeck"] then
-    redDeckId = uiStateTable["redDeck"]
-    self.editInput({index=1, value=redDeckId})
-  end
-  if uiStateTable["whiteDeck"] then
-    whiteDeckId = uiStateTable["whiteDeck"]
-    self.editInput({index=2, value=whiteDeckId})
-  end
-  if uiStateTable["orangeDeck"]then
-    orangeDeckId = uiStateTable["orangeDeck"]
-    self.editInput({index=3, value=orangeDeckId})
-  end
-  if uiStateTable["private"] then
-    privateDeck = uiStateTable["private"]
-    self.editButton { index = 0, label = PRIVATE_TOGGLE_LABELS[privateDeck] }
-  end
-  if uiStateTable["loadNewest"] then
-    loadNewestDeck = uiStateTable["loadNewest"]
-    self.editButton { index = 1, label = UPGRADED_TOGGLE_LABELS[loadNewestDeck] }
-  end
-  if uiStateTable["investigators"] then
-    loadInvestigators = uiStateTable["investigators"]
-    self.editButton { index = 2, label = LOAD_INVESTIGATOR_TOGGLE_LABELS[loadInvestigators] }
-  end
 end
 
 -- Sets up the UI for the deck loader, populating fields from the given save state table decoded from onLoad()

src/chaosbag/BlessCurseManagerApi.ttslua

@@ -1,10 +1,14 @@
 do
   local BlessCurseManagerApi = {}
-  local MANAGER_GUID = "5933fb"
+  local guidReferenceApi = require("core/GUIDReferenceApi")
+
+  local function getManager()
+    return guidReferenceApi.getObjectByOwnerAndType("Mythos", "BlessCurseManager")
+  end
 
   -- removes all taken tokens and resets the counts
   BlessCurseManagerApi.removeTakenTokensAndReset = function()
-    local BlessCurseManager = getObjectFromGUID(MANAGER_GUID)
+    local BlessCurseManager = getManager()
     Wait.time(function() BlessCurseManager.call("removeTakenTokens", "Bless") end, 0.05)
     Wait.time(function() BlessCurseManager.call("removeTakenTokens", "Curse") end, 0.10)
     Wait.time(function() BlessCurseManager.call("doReset", "White") end, 0.15)
@@ -12,30 +16,30 @@ do
 
   -- updates the internal count (called by cards that seal bless/curse tokens)
   BlessCurseManagerApi.sealedToken = function(type, guid)
-    getObjectFromGUID(MANAGER_GUID).call("sealedToken", { type = type, guid = guid })
+    getManager().call("sealedToken", { type = type, guid = guid })
   end
 
   -- updates the internal count (called by cards that seal bless/curse tokens)
   BlessCurseManagerApi.releasedToken = function(type, guid)
-    getObjectFromGUID(MANAGER_GUID).call("releasedToken", { type = type, guid = guid })
+    getManager().call("releasedToken", { type = type, guid = guid })
   end
 
   -- broadcasts the current status for bless/curse tokens
   ---@param playerColor String Color of the player to show the broadcast to
   BlessCurseManagerApi.broadcastStatus = function(playerColor)
-    getObjectFromGUID(MANAGER_GUID).call("broadcastStatus", playerColor)
+    getManager().call("broadcastStatus", playerColor)
   end
 
   -- removes all bless / curse tokens from the chaos bag and play
   ---@param playerColor String Color of the player to show the broadcast to
   BlessCurseManagerApi.removeAll = function(playerColor)
-    getObjectFromGUID(MANAGER_GUID).call("doRemove", playerColor)
+    getManager().call("doRemove", playerColor)
   end
 
   -- adds Wendy's menu to the hovered card (allows sealing of tokens)
   ---@param color String Color of the player to show the broadcast to
   BlessCurseManagerApi.addWendysMenu = function(playerColor, hoveredObject)
-    getObjectFromGUID(MANAGER_GUID).call("addMenuOptions", { playerColor = playerColor, hoveredObject = hoveredObject })
+    getManager().call("addMenuOptions", { playerColor = playerColor, hoveredObject = hoveredObject })
   end
   
   return BlessCurseManagerApi

src/core/DoomCounter.ttslua

@@ -1,3 +1,5 @@
+local guidReferenceApi = require("core/GUIDReferenceApi")
+
 local optionsVisible = false
 local options = {
   Agenda = true,
@@ -64,10 +66,9 @@ function startReset()
   if options.Agenda then
     updateVal(0)
   end
-  -- call the "Doom-in-Play"-counter
+  local doomInPlayCounter = guidReferenceApi.getObjectByOwnerAndType("Mythos", "DoomInPlayCounter")
-  local DoomInPlayCounter = getObjectFromGUID("652ff3")
+  if doomInPlayCounter then
-  if DoomInPlayCounter then
+    doomInPlayCounter.call("removeDoom", options)
-    DoomInPlayCounter.call("removeDoom", options)
   end
 end
 

src/core/DoomInPlayCounter.ttslua

@@ -1,25 +1,24 @@
--- common parameters
+local guidReferenceApi = require("core/GUIDReferenceApi")
-local castParameters        = {}
+local playmatApi = require("playermat/PlaymatApi")
-castParameters.direction    = { 0, 1, 0 }
-castParameters.type         = 3
-castParameters.max_distance = 0
 
-local zone
+local ZONE, TRASH, loopID
 local doomURL    = "https://i.imgur.com/EoL7yaZ.png"
 local IGNORE_TAG = "DoomCounter_ignore"
-
+local TOTAL_PLAY_AREA = {
--- playermats 1 to 4
+  upperLeft = {
-local originAndSize = {
+    x = -10,
-  { origin = { -55, 1.6, 16.5 }, size = { 12, 1, 25 } },
+    z = -35
-  { origin = { -55, 1.6, -16.5 }, size = { 12, 1, 25 } },
+  },
-  { origin = { -25, 1.6, 27 }, size = { 25, 1, 12 } },
+  lowerRight = {
-  { origin = { -25, 1.6, -27 }, size = { 25, 1, 12 } }
+    x = -60,
+    z = 35
+  }
 }
 
 -- create button, context menu and start loop
 function onLoad()
   self.createButton({
-    label = tostring(0),
+    label = "0",
     click_function = "none",
     function_owner = self,
     position = { 0, 0.06, 0 },
@@ -31,76 +30,65 @@ function onLoad()
     color = { 0, 0, 0, 0 }
   })
 
-  zone = getObjectFromGUID("a2f932")
+  TRASH = guidReferenceApi.getObjectByOwnerAndType("Mythos", "Trash")
+  ZONE = guidReferenceApi.getObjectByOwnerAndType("Mythos", "PlayAreaZone")
   loopID = Wait.time(countDoom, 2, -1)
 end
 
 -- main function
 function countDoom()
-  local doom = 0
+  local count = 0
-  for i = 1, 5 do doom = doom + search(i) end
+
-  self.editButton({ index = 0, label = tostring(doom) })
+  -- get doom in play
+  for _, obj in ipairs(getObjects()) do
+    count = count + getDoomAmount(obj)
+  end
+
+  self.editButton({ index = 0, label = tostring(count) })
 end
 
--- searches playermats (num = 1-4) or the scripting zone (num = 5)
+-- gets quantity (for stacks) of doom
-function search(num)
+function getDoomAmount(obj)
-  local val = 0
+  if (obj.is_face_down and obj.getCustomObject().image_bottom == doomURL)
-  if num == 5 then
+      and not obj.hasTag(IGNORE_TAG)
-    for _, obj in ipairs(zone.getObjects()) do
+      and inArea(obj.getPosition(), TOTAL_PLAY_AREA) then
-      val = val + isDoom(obj)
+    return math.abs(obj.getQuantity())
-    end
   else
-    castParameters.origin = originAndSize[num].origin
+    return 0
-    castParameters.size = originAndSize[num].size
-
-    for _, obj in ipairs(Physics.cast(castParameters)) do
-      val = val + isDoom(obj.hit_object)
-    end
   end
-  return val
-end
-
--- checks an object for the doom image and gets quantity (for stacks)
-function isDoom(obj)
-  if (obj.is_face_down and obj.getCustomObject().image_bottom == doomURL) or
-      (obj.name == "Custom_Token" and obj.getCustomObject().image == doomURL) then
-    if not obj.hasTag(IGNORE_TAG) then
-      return math.abs(obj.getQuantity())
-    end
-  end
-  return 0
 end
 
 -- removes doom from playermats / playarea
 function removeDoom(options)
-  local trashCan = getObjectFromGUID("70b9f6")
   local count = 0
-  if options.Playermats then
-    for i = 1, 4 do
-      castParameters.origin = originAndSize[i].origin
-      castParameters.size = originAndSize[i].size
 
-      for _, obj in ipairs(Physics.cast(castParameters)) do
+  if options.Playermats then
-        local obj = obj.hit_object
+    count = removeDoomFromList(playmatApi.searchAroundPlaymat("All"))
-        local amount = isDoom(obj)
-        if amount > 0 then
-          trashCan.putObject(obj)
-          count = count + amount
-        end
-      end
-    end
     broadcastToAll(count .. " doom removed from Playermats.", "White")
   end
 
-  local count = 0
   if options.Playarea then
-    for _, obj in ipairs(zone.getObjects()) do
+    count = removeDoomFromList(ZONE.getObjects())
-      local amount = isDoom(obj)
+    broadcastToAll(count .. " doom removed from Playerarea.", "White")
-      if amount > 0 then
-        trashCan.putObject(obj)
-        count = count + amount
-      end
-    end
-    broadcastToAll(count .. " doom removed from Playarea.", "White")
   end
 end
+
+-- removes doom from provided object list and returns the removed amount
+function removeDoomFromList(objList)
+  local count = 0
+  for _, obj in ipairs(objList) do
+    local amount = getDoomAmount(obj)
+    if amount > 0 then
+      TRASH.putObject(obj)
+      count = count + amount
+    end
+  end
+  return count
+end
+
+function inArea(point, bounds)
+  return (point.x < bounds.upperLeft.x
+      and point.x > bounds.lowerRight.x
+      and point.z > bounds.upperLeft.z
+      and point.z < bounds.lowerRight.z)
+end

src/core/GUIDReferenceApi.ttslua

@@ -0,0 +1,28 @@
+do
+  local GUIDReferenceApi = {}
+
+  local function getGuidHandler()
+    return getObjectFromGUID("123456")
+  end
+
+  -- returns all matching objects as a table with references
+  ---@param owner String Parent object for this search
+  ---@param type String Type of object to search for
+  GUIDReferenceApi.getObjectByOwnerAndType = function(owner, type)
+    return getGuidHandler().call("getObjectByOwnerAndType", { owner = owner, type = type })
+  end
+
+  -- returns all matching objects as a table with references
+  ---@param type String Type of object to search for
+  GUIDReferenceApi.getObjectsByType = function(type)
+    return getGuidHandler().call("getObjectsByType", type)
+  end
+
+  -- returns all matching objects as a table with references
+  ---@param owner String Parent object for this search
+  GUIDReferenceApi.getObjectsByOwner = function(owner)
+    return getGuidHandler().call("getObjectsByOwner", owner)
+  end
+
+  return GUIDReferenceApi
+end

src/core/GUIDReferenceHandler.ttslua

@@ -0,0 +1,101 @@
+local GuidReferences = {
+  White = {
+    ClueCounter = "d86b7c",
+    ClickableClueCounter = "db85d6",
+    DamageCounter = "eb08d6",
+    HandZone = "a70eee",
+    HorrorCounter = "468e88",
+    InvestigatorSkillTracker = "e598c2",
+    Playermat = "8b081b",
+    ResourceCounter = "4406f0",
+    Trash = "147e80"
+  },
+  Orange = {
+    ClueCounter = "1769ed",
+    ClickableClueCounter = "3f22e5",
+    DamageCounter = "e64eec",
+    HandZone = "5fe087",
+    HorrorCounter = "0257d9",
+    InvestigatorSkillTracker = "b4a5f7",
+    Playermat = "bd0ff4",
+    ResourceCounter = "816d84",
+    Trash = "f7b6c8"
+  },
+  Green = {
+    ClueCounter = "032300",
+    ClickableClueCounter = "891403",
+    DamageCounter = "1f5a0a",
+    HandZone = "0285cc",
+    HorrorCounter = "7b5729",
+    InvestigatorSkillTracker = "af7ed7",
+    Playermat = "383d8b",
+    ResourceCounter = "cd15ac",
+    Trash = "5f896a"
+  },
+  Red = {
+    ClueCounter = "37be78",
+    ClickableClueCounter = "4111de",
+    DamageCounter = "591a45",
+    HandZone = "be2f17",
+    HorrorCounter = "beb964",
+    InvestigatorSkillTracker = "e74881",
+    Playermat = "0840d5",
+    ResourceCounter = "a4b60d",
+    Trash = "4b8594"
+  },
+  Mythos = {
+    AllCardsBag = "15bb07",
+    BlessCurseManager = "5933fb",
+    CampaignThePathToCarcosa = "aca04c",
+    DataHelper = "708279",
+    DeckImporter = "a28140",
+    DoomCounter = "85c4c6",
+    DoomInPlayCounter = "652ff3",
+    InvestigatorCounter = "f182ee",
+    MasterClueCounter = "4a3aa4",
+    MythosArea = "9f334f",
+    NavigationOverlayHandler = "797ede",
+    OptionPanelSource = "830bd0",
+    PlaceholderBoxDummy = "a93466",
+    PlayArea = "721ba2",
+    PlayAreaZone = "a2f932",
+    PlayerCardPanel = "2d30ee",
+    ResourceTokenBag = "9fadf9",
+    RulesReference = "d99993",
+    SoundCube = "3c988f",
+    TokenArranger = "022907",
+    TokenSource = "124381",
+    TokenSpawnTracker = "e3ffc9",
+    TourStarter = "0e5aa8",
+    Trash = "70b9f6",
+    VictoryDisplay = "6ccd6d"
+  }
+}
+
+function getObjectByOwnerAndType(params)
+  local owner = params.owner or "Mythos"
+  local type = params.type
+  return getObjectFromGUID(GuidReferences[owner][type])
+end
+
+function getObjectsByType(type)
+  local objList = {}
+  for owner, objects in pairs(GuidReferences) do
+    local obj = getObjectFromGUID(objects[type])
+    if obj then
+      objList[owner] = obj
+    end
+  end
+  return objList
+end
+
+function getObjectsByOwner(owner)
+  local objList = {}
+  for type, guid in pairs(GuidReferences[owner]) do
+    local obj = getObjectFromGUID(guid)
+    if obj then
+      objList[type] = obj
+    end
+  end
+  return objList
+end

src/core/GameKeyHandler.ttslua

@@ -1,4 +1,5 @@
 local blessCurseManagerApi = require("chaosbag/BlessCurseManagerApi")
+local guidReferenceApi = require("core/GUIDReferenceApi")
 local optionPanelApi = require("core/OptionPanelApi")
 local playmatApi = require("playermat/PlaymatApi")
 local victoryDisplayApi = require("core/VictoryDisplayApi")
@@ -41,7 +42,8 @@ end
 
 -- adds 1 doom to the agenda
 function addDoomToAgenda()
-  getObjectFromGUID("85c4c6").call("addVal", 1)
+  local doomCounter = guidReferenceApi.getObjectByOwnerAndType("Mythos", "DoomCounter")
+  doomCounter.call("addVal", 1)
 end
 
 -- moves the hovered card to the victory display
@@ -105,7 +107,7 @@ function takeClueFromLocation(playerColor, hoveredObject)
   local pos = nil
   if clickableClues then
     pos = {x = 0.49, y = 2.66, z = 0.00}
-    playmatApi.updateClueClicker(playerColor, playmatApi.getClueCount(clickableClues, playerColor) + 1)
+    playmatApi.updateCounter(matColor, "ClickableClueCounter", _, 1)
   else
     pos = playmatApi.transformLocalPosition({x = -1.12, y = 0.05, z = 0.7}, matColor)
   end

src/core/Global.ttslua

@@ -1,4 +1,5 @@
 local blessCurseManagerApi = require("chaosbag/BlessCurseManagerApi")
+local guidReferenceApi = require("core/GUIDReferenceApi")
 local mythosAreaApi = require("core/MythosAreaApi")
 local navigationOverlayApi = require("core/NavigationOverlayApi")
 local playAreaApi = require("core/PlayAreaApi")
@@ -12,11 +13,8 @@ local tokenManager = require("core/token/TokenManager")
 -- general setup
 ---------------------------------------------------------
 
-ENCOUNTER_DECK_POS = {-3.93, 1, 5.76}
+ENCOUNTER_DECK_POS = { -3.93, 1, 5.76 }
-ENCOUNTER_DECK_DISCARD_POSITION = {-3.85, 1, 10.38}
+ENCOUNTER_DECK_DISCARD_POSITION = { -3.85, 1, 10.38 }
-
--- GUID of data helper
-DATA_HELPER_GUID = "708279"
 
 -- GUIDs that will not be interactable (e.g. parts of the table)
 local NOT_INTERACTABLE = {
@@ -37,14 +35,28 @@ chaosTokens = {}
 local chaosTokensLastMat = nil
 
 local bagSearchers = {}
-local MAT_COLORS = {"White", "Orange", "Green", "Red"}
+local MAT_COLORS = { "White", "Orange", "Green", "Red" }
 local hideTitleSplashWaitFunctionId = nil
 
 -- online functionality related variables
 local MOD_VERSION = "3.3.0"
 local SOURCE_REPO = 'https://raw.githubusercontent.com/chr1z93/loadable-objects/main'
-local library, requestObj, modMeta, notificationVisible
+local library, requestObj, modMeta
 local acknowledgedUpgradeVersions = {}
+local contentToShow = "campaigns"
+local currentListItem = 1
+local xmlVisibility = {
+  downloadWindow = false,
+  optionPanel = false,
+  updateNotification = false
+}
+local tabIdTable = {
+  tab1 = "campaigns",
+  tab2 = "scenarios",
+  tab3 = "fanmadeCampaigns",
+  tab4 = "fanmadeScenarios",
+  tab5 = "fanmadePlayerCards"
+}
 
 -- optionPanel data
 optionPanel = {}
@@ -101,14 +113,6 @@ ID_URL_MAP = {
 -- data for chaos token stat tracker
 ---------------------------------------------------------
 
-local MAT_GUID_TO_COLOR = {
-  ["Overall"] = "Overall",
-  ["8b081b"]  = "White",
-  ["bd0ff4"]  = "Orange",
-  ["383d8b"]  = "Green",
-  ["0840d5"]  = "Red"
-}
-
 local tokenDrawingStats = {
   ["Overall"] = {},
   ["8b081b"]  = {},
@@ -122,7 +126,12 @@ local tokenDrawingStats = {
 ---------------------------------------------------------
 
 -- saving state of optionPanel to restore later
-function onSave() return JSON.encode({ optionPanel = optionPanel, acknowledgedUpgradeVersions = acknowledgedUpgradeVersions }) end
+function onSave()
+  return JSON.encode({
+    optionPanel = optionPanel,
+    acknowledgedUpgradeVersions = acknowledgedUpgradeVersions
+  })
+end
 
 function onLoad(savedData)
   if savedData then
@@ -142,6 +151,11 @@ function onLoad(savedData)
   resetChaosTokenStatTracker()
   getModVersion()
   math.randomseed(os.time())
+
+  -- initialization of loadable objects library (delay to let Navigation Overlay build)
+  Wait.time(function()
+    WebRequest.get(SOURCE_REPO .. '/library.json', libraryDownloadCallback)
+  end, 1)
 end
 
 -- Event hook for any object search.  When chaos tokens are manipulated while the chaos bag
@@ -289,8 +303,8 @@ function handleStatTrackerClick(_, _, isRightClick)
   if isRightClick then
     resetChaosTokenStatTracker()
   else
-    local squidKing = "Nobody"
+    local squidKing     = "Nobody"
-    local maxSquid  = 0
+    local maxSquid      = 0
     local foundAnyStats = false
 
     for key, personalStats in pairs(tokenDrawingStats) do
@@ -300,7 +314,9 @@ function handleStatTrackerClick(_, _, isRightClick)
         playerColor = "White"
         playerName = "Overall"
       else
-        playerColor = playmatApi.getPlayerColor(MAT_GUID_TO_COLOR[key])
+        -- get mat color
+        local matColor = playmatApi.getMatColorByPosition(getObjectFromGUID(key).getPosition())
+        playerColor = playmatApi.getPlayerColor(matColor)
         playerName = Player[playerColor].steam_name or playerColor
 
         local playerSquidCount = personalStats["Auto-fail"]
@@ -320,8 +336,8 @@ function handleStatTrackerClick(_, _, isRightClick)
       if totalCount > 0 then
         foundAnyStats = true
         printToAll("------------------------------")
-        printToAll(playerName ..  " Stats", playerColor)
+        printToAll(playerName .. " Stats", playerColor)
-        
+
         for tokenName, value in pairs(personalStats) do
           if value ~= 0 then
             printToAll(tokenName .. ': ' .. tostring(value))
@@ -334,7 +350,7 @@ function handleStatTrackerClick(_, _, isRightClick)
     -- detect if any player drew tokens
     if foundAnyStats then
       printToAll("------------------------------")
-      printToAll(squidKing .. " is an auto-fail magnet.", {255, 0, 0})
+      printToAll(squidKing .. " is an auto-fail magnet.", { 255, 0, 0 })
     else
       printToAll("No tokens have been drawn yet.", "Yellow")
     end
@@ -363,11 +379,11 @@ function createSetupButtons(args)
   if data ~= nil then
     local buttonParameters          = {}
     buttonParameters.function_owner = args.object
-    buttonParameters.position       = {0, 0.1, -0.15}
+    buttonParameters.position       = { 0, 0.1, -0.15 }
-    buttonParameters.scale          = {0.47, 1, 0.47}
+    buttonParameters.scale          = { 0.47, 1, 0.47 }
     buttonParameters.height         = 200
     buttonParameters.width          = 1150
-    buttonParameters.color          = {0.87, 0.8, 0.7}
+    buttonParameters.color          = { 0.87, 0.8, 0.7 }
 
     if data.easy ~= nil then
       buttonParameters.label = "Easy"
@@ -450,7 +466,8 @@ function fillContainer(args)
 end
 
 function getDataValue(storage, key)
-  local data = getObjectFromGUID(DATA_HELPER_GUID).getTable(storage)
+  local DATA_HELPER = guidReferenceApi.getObjectByOwnerAndType("Mythos", "DataHelper")
+  local data = DATA_HELPER.getTable(storage)
   if data ~= nil then
     local value = data[key]
     if value ~= nil then
@@ -495,7 +512,6 @@ function getChaosBagState()
   end
 
   return tokens
-
 end
 
 -- respawns the chaos bag with a new state of tokens
@@ -524,7 +540,7 @@ function setChaosBagState(tokenList)
   -- overwrite chaos bag content and respawn it
   chaosbagData.ContainedObjects = containedObjects
   chaosbag.destruct()
-  spawnObjectData({data = chaosbagData})
+  spawnObjectData({ data = chaosbagData })
 
   -- remove tokens that are still in play
   for _, token in pairs(chaosTokens) do
@@ -553,7 +569,7 @@ function spawnChaosToken(id)
       type = 'Custom_Tile',
       position = { 0.49, 3, 0 },
       scale = { 0.81, 1.0, 0.81 },
-      rotation = {0, 270, 0},
+      rotation = { 0, 270, 0 },
       callback_function = function(obj)
         obj.setName(ID_URL_MAP[id].name)
         chaosbag.putObject(obj)
@@ -603,7 +619,7 @@ function emptyChaosBag()
 
   local chaosbag = findChaosBag()
   for _, object in ipairs(chaosbag.getObjects()) do
-    chaosbag.takeObject({callback_function = function(item) item.destruct() end})
+    chaosbag.takeObject({ callback_function = function(item) item.destruct() end })
   end
 end
 
@@ -619,176 +635,410 @@ end
 -- Content Importing and XML functions
 ---------------------------------------------------------
 
-function onClick_refreshList()
+-- forwards the requested content type to the update function and sets highlight to clicked tab
-  local request = WebRequest.get(SOURCE_REPO .. '/library.json', completed_list_update)
+---@param tabId String Id of the clicked tab
-  requestObj = request
+function onClick_tab(_, _, tabId)
-  startLuaCoroutine(Global, 'downloadCoroutine')
+  for listId, listContent in pairs(tabIdTable) do
+    if listId == tabId then
+      UI.setClass(listId, 'downloadTab activeTab')
+      contentToShow = listContent
+    else
+      UI.setClass(listId, 'downloadTab')
+    end
+  end
+  currentListItem = 1
+  updateDownloadItemList()
 end
 
-function onClick_select(player, params)
+-- click function for the items in the download window
-  params = JSON.decode(urldecode(params))
+-- updates backgroundcolor for row panel and fontcolor for list item
+function onClick_select(_, _, identificationKey)
+  UI.setAttribute("panel" .. currentListItem, "color", "clear")
+  UI.setAttribute(contentToShow .. "_" .. currentListItem, "color", "white")
+  
+  -- parses the identification key (contentToShow_currentListItem)
+  if identificationKey then
+    contentToShow = nil
+    currentListItem = nil
+    for str in string.gmatch(identificationKey, "([^_]+)") do
+      if not contentToShow then
+        -- grab the first part to know the content type
+        contentToShow = str
+      else
+        -- get the index
+        currentListItem = tonumber(str)
+        break
+      end
+    end
+  end
+
+  UI.setAttribute("panel" .. currentListItem, "color", "grey")
+  UI.setAttribute(contentToShow .. "_" .. currentListItem, "color", "black")
+  updatePreviewWindow()
+end
+
+-- click function for the download button in the preview window
+function onClick_download()
+  placeholder_download(library[contentToShow][currentListItem])
+end
+
+-- the download button on the placeholder objects calls this to directly initiate a download
+---@param param Table contains url and guid of replacement object
+function placeholder_download(params)
   local url = SOURCE_REPO .. '/' .. params.url
-  local request = WebRequest.get(url, function (request) complete_obj_download(request, params) end )
+  requestObj = WebRequest.get(url, function (request) contentDownloadCallback(request, params) end)
-  requestObj = request
   startLuaCoroutine(Global, 'downloadCoroutine')
 end
 
-function onClick_load()
+function downloadCoroutine()
-  UI.show('progress_display')
+  -- show progress bar
-  UI.hide('load_button')
+  UI.setAttribute('download_progress', 'active', true)
+
+  -- update progress bar
+  while requestObj do
+    UI.setAttribute('download_progress', 'percentage', requestObj.download_progress * 100)
+    coroutine.yield(0)
+  end
+  UI.setAttribute('download_progress', 'percentage', 100)
+
+  -- wait 30 frames
+  for i = 1, 30 do
+    coroutine.yield(0)
+  end
+
+  -- hide progress bar
+  UI.setAttribute('download_progress', 'active', false)
+
+  -- hide download window
+  if xmlVisibility.downloadWindow then
+    xmlVisibility.downloadWindow = false
+    UI.hide('downloadWindow')
+  end
+  return 1
 end
 
+-- spawns a bag that contains every object from the library
+function onClick_downloadAll()
+  broadcastToAll("Download initiated - this will take a few minutes!")
+
+  -- hide download window
+  if xmlVisibility.downloadWindow then
+    xmlVisibility.downloadWindow = false
+    UI.hide('downloadWindow')
+  end
+
+  startLuaCoroutine(Global, "coroutineDownloadAll")
+end
+
+function coroutineDownloadAll()
+  local JSON = [[
+    {
+      "Name": "Bag",
+      "Transform": {
+        "posX": -39.5,
+        "posY": 2,
+        "posZ": -87,
+        "rotX": 0,
+        "rotY": 270,
+        "rotZ": 0,
+        "scaleX": 1.0,
+        "scaleY": 1.0,
+        "scaleZ": 1.0
+      },
+      "Nickname": "All Downloadable Content",
+      "Bag": {
+        "Order": 0
+      },
+      "ContainedObjects": [
+  ]]
+         
+  local contained = ""
+  local downloadedItems = 0
+  local skippedItems = 0
+
+  -- loop through the library to add content
+  for contentType, objectList in pairs(library) do
+    broadcastToAll("Downloading " .. contentType .. "...")
+    for _, params in ipairs(objectList) do
+      local request = WebRequest.get(SOURCE_REPO .. '/' .. params.url)
+      local start = os.time()
+      while true do
+        if request.is_done then
+          contained = contained .. request.text .. ","
+          downloadedItems = downloadedItems + 1
+          break
+        -- time-out if item can't be loaded in 5s
+        elseif request.is_error or (os.time() - start) > 5 then
+          skippedItems = skippedItems + 1
+          break
+        end
+        coroutine.yield(0)
+      end
+    end
+  end
+
+  JSON = JSON .. contained .. "]}"
+  spawnObjectJSON({json = JSON})
+
+  broadcastToAll(downloadedItems .. " objects downloaded.", "Green")
+  broadcastToAll(skippedItems .. " objects had a time-out / error.", "Orange")
+  return 1
+end
+
+-- spawns a placeholder box for the selected object
+function onClick_spawnPlaceholder()
+  -- get object references
+  local item = library[contentToShow][currentListItem]
+  local dummy = guidReferenceApi.getObjectByOwnerAndType("Mythos", "PlaceholderBoxDummy")
+  
+  -- error handling
+  if not item.boxsize or item.boxsize == "" or not item.boxart or item.boxart == "" then
+    print("Error loading object.")
+    return
+  end
+
+  -- get data for placeholder
+  local spawnPos = {-39.5, 2, -87}
+
+  local meshTable = {
+    big = "https://raw.githubusercontent.com/RobMayer/TTSLibrary/master/advboxes/core_h_MSH.obj",
+    small = "https://raw.githubusercontent.com/RobMayer/TTSLibrary/master/advboxes/tuckbox_h_MSH.obj",
+    wide = "http://pastebin.com/raw.php?i=uWAmuNZ2"
+  }
+
+  local scaleTable = {
+    big = {1.00, 0.14, 1.00},
+    small = {2.21, 0.46, 2.42},
+    wide = {2.00, 0.11, 1.69}
+  }
+
+  local placeholder = spawnObject({
+    type = "Custom_Model",
+    position = spawnPos,
+    rotation = {0, 270, 0},
+    scale = scaleTable[item.boxsize],
+  })
+  
+  placeholder.setCustomObject({
+    mesh = meshTable[item.boxsize],
+    diffuse = item.boxart,
+    material = 3
+  })
+
+  placeholder.setColorTint({1, 1, 1, 71/255})
+  placeholder.setName(item.name)
+  placeholder.setDescription("by " .. (item.author or "Unknown"))
+  placeholder.setGMNotes(item.url)
+  placeholder.setLuaScript(dummy.getLuaScript())
+  Player.getPlayers()[1].pingTable(spawnPos)
+
+  -- hide download window
+  if xmlVisibility.downloadWindow then
+    xmlVisibility.downloadWindow = false
+    UI.hide('downloadWindow')
+  end
+end
+
+-- toggles the visibility of the respective UI
+---@param player LuaPlayer Player that triggered this
+---@param title String Name of the UI to toggle
 function onClick_toggleUi(player, title)
   if title == "Navigation Overlay" then
     navigationOverlayApi.cycleVisibility(player.color)
     return
   end
 
-  UI.hide('optionPanel')
+  if xmlVisibility[title] then
-  UI.hide('load_ui')
+    -- small delay to allow button click sounds to play
-
+    Wait.time(function() UI.hide(title) end, 0.1)
-  -- when same button is clicked or close window button is pressed, don't open UI
-  if UI.getValue('title') ~= title and title ~= 'Hidden' then
-    UI.setValue('title', title)
-
-    if title == "Options" then
-      UI.show('optionPanel')
-    else
-      update_window_content(title)
-      UI.show('load_ui')
-    end
   else
-    UI.setValue('title', "Hidden")
+    UI.show(title)
+  end
+  xmlVisibility[title] = not xmlVisibility[title]
+end
+
+-- updates the preview window
+function updatePreviewWindow()
+  local item = library[contentToShow][currentListItem]
+  local tempImage = "http://cloud-3.steamusercontent.com/ugc/2115061845788345842/2CD6ABC551555CCF58F9D0DDB7620197BA398B06/"
+
+  -- set default image if not defined
+  if item.boxsize == nil or item.boxsize == "" or item.boxart == nil or item.boxart == "" then
+    item.boxsize = "big"
+    item.boxart = "http://cloud-3.steamusercontent.com/ugc/762723517667628371/18438B0A0045038A7099648AA3346DFCAA267C66/"
+  end
+
+  UI.setValue("previewTitle", item.name)
+  UI.setValue("previewAuthor", "by " .. (item.author or "- Author not found -"))
+  UI.setValue("previewDescription", item.description or "- Description not found -")
+
+  -- update mask according to size (hardcoded values to align image in mask)
+  local maskData = {}
+  if item.boxsize == "big" then
+    maskData = {
+      image = "box-cover-mask-big",
+      width = "870",
+      height = "435",
+      offsetXY = "154 60"
+    }
+  elseif item.boxsize == "small" then
+    maskData = {
+      image = "box-cover-mask-small",
+      width = "792",
+      height = "594",
+      offsetXY = "135 13"
+    }
+  elseif item.boxsize == "wide" then
+    maskData = {
+      image = "box-cover-mask-wide",
+      width = "756",
+      height = "630",
+      offsetXY = "-190 -70"
+    }
+  end
+
+  -- loading empty image as placeholder until real image is loaded
+  UI.setAttribute("previewArtImage", "image", tempImage)
+  
+  -- insert the image itself
+  UI.setAttribute("previewArtImage", "image", item.boxart)
+  UI.setAttributes("previewArtMask", maskData)
+end
+
+-- formats the json response from the webrequest into a key-value lua table
+-- strips the prefix from the community content items
+function formatLibrary(json_response)
+  library = {}
+  library["campaigns"] = json_response.campaigns
+  library["scenarios"] = json_response.scenarios
+  library["extras"] = json_response.extras
+  library["fanmadeCampaigns"] = {}
+  library["fanmadeScenarios"] = {}
+  library["fanmadePlayerCards"] = {}
+
+  for _, item in ipairs(json_response.community) do
+    local identifier = nil
+    for str in string.gmatch(item.name, "([^:]+)") do
+      if not identifier then
+        -- grab the first part to know the content type
+        identifier = str
+      else
+        -- update the name without the content type
+        item.name = str
+        break
+      end
+    end
+
+    if identifier == "Fan Investigators" then
+      table.insert(library["fanmadePlayerCards"], item)
+    elseif identifier == "Fan Campaign" then
+      table.insert(library["fanmadeCampaigns"], item)
+    elseif identifier == "Fan Scenario" then
+      table.insert(library["fanmadeScenarios"], item)
+    end
   end
 end
 
-function downloadCoroutine()
+-- updates the window content to the requested content
-  while requestObj do
+function updateDownloadItemList()
-    UI.setAttribute('download_progress', 'percentage', requestObj.download_progress * 100)
+  if not library then return end
-    coroutine.yield(0)
-  end
-  return 1
-end
 
-function update_list(objects)
+  -- addition of list items according to library file
-  local ui = UI.getXmlTable()
+  local globalXml = UI.getXmlTable()
-  local update_height = find_tag_with_id(ui, 'ui_update_height')
+  local contentList = getXmlTableElementById(globalXml, 'contentList')
-  local update_children = find_tag_with_id(update_height.children, 'ui_update_point')
 
-  update_children.children = {}
+  contentList.children = {}
-
+  for i, v in ipairs(library[contentToShow]) do
-  for _, v in ipairs(objects) do
+    table.insert(contentList.children,
-    local s = JSON.encode(v);
+      {
-    table.insert(update_children.children,
+        tag = "Panel",
-      { tag = 'Text',
+        attributes = { id = "panel" .. i },
-        value = v.name,
+        children = {
-        attributes = { onClick = 'onClick_select(' .. urlencode(JSON.encode(v)) .. ')', alignment = 'MiddleLeft' }
+          tag = 'Text',
+          value = v.name,
+          attributes = {
+            id = contentToShow .. "_" .. i,
+            onClick = 'onClick_select',
+            alignment = 'MiddleLeft'
+          }
+        }
       })
   end
 
-  update_height.attributes.height = #(update_children.children) * 24
+  contentList.attributes.height = #contentList.children * 27
-  UI.setXmlTable(ui)
+  UI.setXmlTable(globalXml)
+
+  -- select the first item
+  Wait.time(onClick_select, 0.2)
 end
 
-function update_window_content(new_title)
+-- called after the webrequest of downloading an item
-  if not library then return end
+-- deletes the placeholder and spawns the downloaded item
+function contentDownloadCallback(request, params)
+  requestObj = nil
 
-  if new_title == 'Campaigns' then
+  -- error handling
-    update_list(library.campaigns)
-  elseif new_title == 'Standalone Scenarios' then
-    update_list(library.scenarios)
-  elseif new_title == 'Investigators' then
-    update_list(library.investigators)
-  elseif new_title == 'Community Content' then
-    update_list(library.community)
-  elseif new_title == 'Extras' then
-    update_list(library.extras)
-  else
-    update_list({})
-  end
-end
-
-function complete_obj_download(request, params)
-  assert(request.is_done)
   if request.is_error or request.response_code ~= 200 then
-    print('error: ' .. request.error)
+    print('Error: ' .. request.error)
-  else
+    return
-    if pcall(function()
+  end
-      local replaced_object
+
-      pcall(function()
+  -- initiate content spawning
-        if params.replace then
+  local spawnTable = { json = request.text }
-          replaced_object = getObjectFromGUID(params.replace)
+  if params.replace then
-        end
+    local replacedObject = getObjectFromGUID(params.replace)
-      end)
+    if replacedObject then
-      local json = request.text
+      spawnTable.position = replacedObject.getPosition()
-      if replaced_object then
+      spawnTable.rotation = replacedObject.getRotation()
-        local pos = replaced_object.getPosition()
+      spawnTable.scale    = replacedObject.getScale()
-        local rot = replaced_object.getRotation()
+      destroyObject(replacedObject)
-        destroyObject(replaced_object)
-        Wait.frames(function()
-          spawnObjectJSON({json = json, position = pos, rotation = rot})
-        end, 1)
-      else
-        spawnObjectJSON({json = json})
-      end
-    end) then
-      print('Object loaded.')
-    else
-      print('Error loading object.')
     end
   end
 
-  requestObj = nil
+  -- if spawned from menu, ping the position
-  UI.setAttribute('download_progress', 'percentage', 100)
+  if params.name then
-end
+    spawnTable["callback_function"] = function(obj)
-
+      Player.getPlayers()[1].pingTable(obj.getPosition())
--- the download button on the placeholder objects calls this to directly initiate a download
--- params is a table with url and guid of replacement object, which happens to match what onClick_select wants
-function placeholder_download(params)
-  onClick_select(nil, JSON.encode(params))
-end
-
-function completed_list_update(request)
-  assert(request.is_done)
-  if request.is_error or request.response_code ~= 200 then
-    print('error: ' .. request.error)
-  else
-    local json_response = nil
-    if pcall(function () json_response = JSON.decode(request.text) end) then
-      library = json_response
-      update_window_content(UI.getValue('title'))
-    else
-      print('error parsing downloaded library')
     end
   end
 
-  requestObj = nil
+  if pcall(function() spawnObjectJSON(spawnTable) end) then
-  UI.setAttribute('download_progress', 'percentage', 100)
+    print('Object loaded.')
+  else
+    print('Error loading object.')
+  end
 end
 
-function find_tag_with_id(ui, id)
+-- downloading of the library file
+function libraryDownloadCallback(request)
+  if request.is_error or request.response_code ~= 200 then
+    print('error: ' .. request.error)
+    return
+  end
+
+  local json_response = nil
+  if pcall(function () json_response = JSON.decode(request.text) end) then
+    formatLibrary(json_response)
+    updateDownloadItemList()
+  else
+    print('error parsing downloaded library')
+  end
+end
+
+-- loops through an XML table and returns the specified object
+---@param ui Table XmlTable (get this via getXmlTable)
+---@param id String Id of the object to return
+function getXmlTableElementById(ui, id)
   for _, obj in ipairs(ui) do
     if obj.attributes and obj.attributes.id and obj.attributes.id == id then return obj end
     if obj.children then
-      local result = find_tag_with_id(obj.children, id)
+      local result = getXmlTableElementById(obj.children, id)
       if result then return result end
     end
   end
   return nil
 end
 
-function urlencode(str)
-  local str = string.gsub(str, "([^A-Za-z0-9-_.~])",
-    function (c) return string.format("%%%02X", string.byte(c)) end)
-  return str
-end
-
-function urldecode(str)
-  local str = string.gsub(str, "%%(%x%x)",
-    function (h) return string.char(tonumber(h, 16)) end)
-  return str
-end
-
 ---------------------------------------------------------
 -- Option Panel related functionality
 ---------------------------------------------------------
@@ -875,7 +1125,8 @@ function applyOptionPanelChange(id, state)
     optionPanel[id] = state
 
     -- update master clue counter
-    getObjectFromGUID("4a3aa4").setVar("useClickableCounters", state)
+    local counter = guidReferenceApi.getObjectByOwnerAndType("Mythos", "MasterClueCounter")
+    counter.setVar("useClickableCounters", state)
 
   -- option: Play area snap tags
   elseif id == "playAreaSnapTags" then
@@ -944,8 +1195,9 @@ end
 -- copies the specified tool (by name) from the option panel source bag
 ---@param name String Name of the object that should be copied
 ---@param position Table Desired position of the object
+---@param rotation Table Desired rotation of the object (defaults to object's rotation)
 function spawnHelperObject(name, position, rotation)
-  local sourceBag = getObjectFromGUID("830bd0")
+  local sourceBag = guidReferenceApi.getObjectByOwnerAndType("Mythos","OptionPanelSource")
 
   -- error handling for missing sourceBag
   if not sourceBag then
@@ -953,7 +1205,7 @@ function spawnHelperObject(name, position, rotation)
     return
   end
 
-  local spawnTable = {position = position}
+  local spawnTable = { position = position }
 
   -- only overrride rotation if there is one provided (object's rotation used instead)
   if rotation then
@@ -1046,7 +1298,6 @@ end
 -- splash scenario title on setup
 function titleSplash(scenarioName)
   if optionPanel['showTitleSplash'] then
-
     -- if there's any ongoing title being displayed, hide it and cancel the waiting function
     if hideTitleSplashWaitFunctionId then
       Wait.stop(hideTitleSplashWaitFunctionId)
@@ -1088,7 +1339,7 @@ function compareVersion(request)
 
   -- stop here if on latest version
   if MOD_VERSION == modMeta["latestVersion"] then return end
-  
+
   -- stop here if "don't show again" was clicked for this version before
   if acknowledgedUpgradeVersions[modMeta["latestVersion"]] then return end
 
@@ -1110,25 +1361,14 @@ function updateNotificationLoading()
       highlightText = highlightText .. "\n• " .. entry
     end
   end
-  
+
   -- update the XML UI
-  UI.setValue("notificationHeader", "New version available: ".. modMeta["latestVersion"])
+  UI.setValue("notificationHeader", "New version available: " .. modMeta["latestVersion"])
   UI.setValue("releaseHighlightText", highlightText)
   UI.setAttribute("highlightRow", "preferredHeight", 20*#highlights)
   UI.setAttribute("updateNotification", "height", 20*#highlights + 125)
 end
 
--- triggered by clicking on the Finn Icon
-function onClick_FinnIcon()
-  if notificationVisible then
-    UI.hide("updateNotification")
-    notificationVisible = false
-  else
-    UI.show("updateNotification")
-    notificationVisible = true
-  end
-end
-
 -- close / don't show again buttons on the update notification
 function onClick_notification(_, parameter)
   if parameter == "dontShowAgain" then
@@ -1137,4 +1377,5 @@ function onClick_notification(_, parameter)
   end
   UI.hide("FinnIcon")
   UI.hide("updateNotification")
+  xmlVisibility["updateNotification"] = false
 end

src/core/MasterClueCounter.ttslua

@@ -20,11 +20,10 @@ function onLoad(savedData)
     width = 900,
     scale = { 1.5, 1.5, 1.5 },
     font_size = 650,
-    font_color = { 0, 0, 0, 100 },
+    font_color = { 1, 1, 1, 100 },
     color = { 0, 0, 0, 0 }
   })
-
+  Wait.time(sumClues, 2, -1)
-  loopID = Wait.time(sumClues, 2, -1)
 end
 
 -- removes all player clues by calling the respective function from the counting bowls / clickers

src/core/MythosArea.ttslua

@@ -1,3 +1,4 @@
+local guidReferenceApi = require("core/GUIDReferenceApi")
 local playAreaApi = require("core/PlayAreaApi")
 local tokenArrangerApi = require("accessories/TokenArrangerApi")
 local tokenChecker = require("core/token/TokenChecker")
@@ -20,11 +21,8 @@ local isReshuffling = false
 -- scenario metadata
 local currentScenario, useFrontData, tokenData
 
--- GUID of data helper
+-- object references
-local DATA_HELPER_GUID = "708279"
+local TRASH, DATA_HELPER
-
-local TRASHCAN
-local TRASHCAN_GUID = "70b9f6"
 
 -- we use this to turn off collision handling until onLoad() is complete
 local collisionEnabled = false
@@ -36,7 +34,8 @@ function onLoad(saveState)
     useFrontData      = loadedState.useFrontData or true
     tokenData         = loadedState.tokenData or {}
   end
-  TRASHCAN = getObjectFromGUID(TRASHCAN_GUID)
+  TRASH = guidReferenceApi.getObjectByOwnerAndType("Mythos", "Trash")
+  DATA_HELPER = guidReferenceApi.getObjectByOwnerAndType("Mythos", "DataHelper")
   collisionEnabled = true
 end
 
@@ -153,7 +152,7 @@ function actualEncounterCardDraw(card, params)
   local faceUpRotation = 0
   if not params.alwaysFaceUp then
     local metadata = JSON.decode(card.getGMNotes()) or {}
-    if metadata.hidden or getObjectFromGUID(DATA_HELPER_GUID).call('checkHiddenCard', card.getName()) then
+    if metadata.hidden or DATA_HELPER.call('checkHiddenCard', card.getName()) then
       faceUpRotation = 180
     end
   end
@@ -209,7 +208,7 @@ function removeTokensFromObject(object)
         obj.memo ~= nil and
         obj.getLock() == false and
         not tokenChecker.isChaosToken(obj) then
-      TRASHCAN.putObject(obj)
+      TRASH.putObject(obj)
     end
   end
 end

src/core/MythosAreaApi.ttslua

@@ -1,15 +1,19 @@
 do
   local MythosAreaApi = {}
-  local MYTHOS_AREA_GUID = "9f334f"
+  local guidReferenceApi = require("core/GUIDReferenceApi")
+
+  local function getMythosArea()
+    return guidReferenceApi.getObjectByOwnerAndType("Mythos", "MythosArea")
+  end
 
   -- returns the chaos token metadata (if provided through scenario reference card)
   MythosAreaApi.returnTokenData = function()
-    return getObjectFromGUID(MYTHOS_AREA_GUID).call("returnTokenData")
+    return getMythosArea().call("returnTokenData")
   end
-
+  
   -- draw an encounter card to the requested position/rotation
   MythosAreaApi.drawEncounterCard = function(pos, rotY, alwaysFaceUp)
-    getObjectFromGUID(MYTHOS_AREA_GUID).call("drawEncounterCard", {
+    getMythosArea().call("drawEncounterCard", {
       pos = pos,
       rotY = rotY,
       alwaysFaceUp = alwaysFaceUp

src/core/NavigationOverlayApi.ttslua

@@ -1,21 +1,25 @@
 do
   local NavigationOverlayApi = {}
-  local HANDLER_GUID = "797ede"
+  local guidReferenceApi = require("core/GUIDReferenceApi")
+
+  local function getNOHandler()
+    return guidReferenceApi.getObjectByOwnerAndType("Mythos", "NavigationOverlayHandler")
+  end
 
   -- Copies the visibility for the Navigation overlay
   ---@param startColor String Color of the player to copy from
   ---@param targetColor String Color of the targeted player
   NavigationOverlayApi.copyVisibility = function(startColor, targetColor)
-    getObjectFromGUID(HANDLER_GUID).call("copyVisibility", {
+    getNOHandler().call("copyVisibility", {
       startColor = startColor,
       targetColor = targetColor
     })
-  end
+  end  
 
   -- Changes the Navigation Overlay view ("Full View" --> "Play Areas" --> "Closed" etc.)
   ---@param playerColor String Color of the player to update the visibility for
   NavigationOverlayApi.cycleVisibility = function(playerColor)
-    getObjectFromGUID(HANDLER_GUID).call("cycleVisibility", playerColor)
+    getNOHandler().call("cycleVisibility", playerColor)
   end
 
   return NavigationOverlayApi

src/core/NavigationOverlayHandler.ttslua

@@ -328,7 +328,7 @@ function loadCamera(player, index)
     end
 
     -- search on the playmat for objects
-    local bounds = getDynamicViewBounds(playmatApi.searchPlaymat(matColor))
+    local bounds = getDynamicViewBounds(playmatApi.searchAroundPlaymat(matColor))
 
     lookHere = {
       position = { bounds.middleX, 0, bounds.middleZ },

src/core/PlayArea.ttslua

@@ -3,60 +3,60 @@
 ---------------------------------------------------------
 
 -- Location connection directional options
-local BIDIRECTIONAL = 0
+local BIDIRECTIONAL                 = 0
-local ONE_WAY = 1
+local ONE_WAY                       = 1
-local INCOMING_ONE_WAY = 2
+local INCOMING_ONE_WAY              = 2
 
 -- Connector draw parameters
-local CONNECTION_THICKNESS = 0.015
+local CONNECTION_THICKNESS          = 0.015
 local DRAGGING_CONNECTION_THICKNESS = 0.15
-local DRAGGING_CONNECTION_COLOR = { 0.8, 0.8, 0.8, 1 }
+local DRAGGING_CONNECTION_COLOR     = { 0.8, 0.8, 0.8, 1 }
-local CONNECTION_COLOR = { 0.4, 0.4, 0.4, 1 }
+local CONNECTION_COLOR              = { 0.4, 0.4, 0.4, 1 }
-local DIRECTIONAL_ARROW_DISTANCE = 3.5
+local DIRECTIONAL_ARROW_DISTANCE    = 3.5
-local ARROW_ARM_LENGTH = 0.9
+local ARROW_ARM_LENGTH              = 0.9
-local ARROW_ANGLE = 25
+local ARROW_ANGLE                   = 25
 
 -- Height to draw the connector lines, places them just above the table and always below cards
-local CONNECTION_LINE_Y = 1.529
+local CONNECTION_LINE_Y             = 1.529
 
 -- we use this to turn off collision handling until onLoad() is complete
-local collisionEnabled = false
+local collisionEnabled              = false
 
 -- used for recreating the link to a custom data helper after image change
-customDataHelper = nil
+customDataHelper                    = nil
 
-local DEFAULT_URL = "http://cloud-3.steamusercontent.com/ugc/998015670465071049/FFAE162920D67CF38045EFBD3B85AD0F916147B2/"
+local DEFAULT_URL                   =
+"http://cloud-3.steamusercontent.com/ugc/998015670465071049/FFAE162920D67CF38045EFBD3B85AD0F916147B2/"
 
-local SHIFT_OFFSETS = {
+local SHIFT_OFFSETS                 = {
   left  = { x = 0.00, y = 0, z = 7.67 },
   right = { x = 0.00, y = 0, z = -7.67 },
   up    = { x = 6.54, y = 0, z = 0.00 },
   down  = { x = -6.54, y = 0, z = 0.00 }
 }
-local SHIFT_EXCLUSION = {
+local SHIFT_EXCLUSION               = {
   ["b7b45b"] = true,
   ["f182ee"] = true,
   ["721ba2"] = true
 }
-local LOC_LINK_EXCLUDE_SCENARIOS = {
+local LOC_LINK_EXCLUDE_SCENARIOS    = {
   ["The Witching Hour"] = true,
   ["The Heart of Madness"] = true
 }
 
-local tokenManager = require("core/token/TokenManager")
+local guidReferenceApi = require("core/GUIDReferenceApi")
-local INVESTIGATOR_COUNTER_GUID = "f182ee"
+local tokenManager                  = require("core/token/TokenManager")
-local PLAY_AREA_ZONE_GUID = "a2f932"
 
-local clueData = {}
+local clueData                      = {}
-local spawnedLocationGUIDs = {}
+local spawnedLocationGUIDs          = {}
-local locations = {}
+local locations                     = {}
-local locationConnections = {}
+local locationConnections           = {}
-local draggingGuids = {}
+local draggingGuids                 = {}
 local locationData
 local currentScenario
 
-local missingData = {}
+local missingData                   = {}
-local countedVP   = {}
+local countedVP                     = {}
 
 ---------------------------------------------------------
 -- general code
@@ -71,8 +71,8 @@ end
 
 function onLoad(saveState)
   -- records locations we have spawned clues for
-  local save = JSON.decode(saveState) or { }
+  local save = JSON.decode(saveState) or {}
-  locations = save.trackedLocations or { }
+  locations = save.trackedLocations or {}
   currentScenario = save.currentScenario
 
   self.interactable = false
@@ -93,13 +93,13 @@ function updateSurface(newURL)
   local customInfo = self.getCustomObject()
 
   if newURL ~= "" and newURL ~= nil and newURL ~= DEFAULT_URL then
-      customInfo.image = newURL
+    customInfo.image = newURL
-      broadcastToAll("New Playmat Image Applied", { 0.2, 0.9, 0.2 })
+    broadcastToAll("New Playmat Image Applied", { 0.2, 0.9, 0.2 })
   else
-      customInfo.image = DEFAULT_URL
+    customInfo.image = DEFAULT_URL
-      broadcastToAll("Default Playmat Image Applied", { 0.2, 0.9, 0.2 })
+    broadcastToAll("Default Playmat Image Applied", { 0.2, 0.9, 0.2 })
   end
-  
+
   self.setCustomObject(customInfo)
 
   local guid = nil
@@ -108,7 +108,7 @@ function updateSurface(newURL)
   self.reload()
 
   if guid ~= nil then
-      Wait.time(function() updateLocations({ guid }) end, 1)
+    Wait.time(function() updateLocations({ guid }) end, 1)
   end
 end
 
@@ -129,12 +129,14 @@ function onCollisionEnter(collisionInfo)
   if shouldSpawnTokens(card) then
     tokenManager.spawnForCard(card)
   end
+  
   -- If this card was being dragged, clear the dragging connections.  A multi-drag/drop may send
   -- the dropped card immediately into a deck, so this has to be done here
   if draggingGuids[card.getGUID()] ~= nil then
     card.setVectorLines(nil)
     draggingGuids[card.getGUID()] = nil
   end
+  
   maybeTrackLocation(card)
 end
 
@@ -167,20 +169,20 @@ function onObjectPickUp(player, object)
   -- should be tracking
   if showLocationLinks() and isInPlayArea(object) and object.getGMNotes() ~= nil and object.getGMNotes() ~= "" then
     local pickedUpGuid = object.getGUID()
-    local metadata = JSON.decode(object.getGMNotes()) or { }
+    local metadata = JSON.decode(object.getGMNotes()) or {}
     if metadata.type == "Location" then
       -- onCollisionExit sometimes comes 1 frame after onObjectPickUp (rather than before it or in
       -- the same frame).  This causes a mismatch in the data between dragging the on-table, and
       -- that one frame draws connectors on the card which then show up as shadows for snap points.
       -- Waiting ensures we always do thing in the expected Exit->PickUp order
       Wait.frames(function()
-          if object.is_face_down then
+        if object.is_face_down then
-            draggingGuids[pickedUpGuid] = metadata.locationBack
+          draggingGuids[pickedUpGuid] = metadata.locationBack
-          else
+        else
-            draggingGuids[pickedUpGuid] = metadata.locationFront
+          draggingGuids[pickedUpGuid] = metadata.locationFront
-          end
+        end
-          rebuildConnectionList()
+        rebuildConnectionList()
-        end, 2)
+      end, 2)
     end
   end
 end
@@ -273,11 +275,11 @@ end
 -- drawBaseConnections()
 function rebuildConnectionList()
   if not showLocationLinks() then
-    locationConnections = { }
+    locationConnections = {}
     return
   end
 
-  local iconCardList = { }
+  local iconCardList = {}
 
   -- Build a list of cards with each icon as their location ID
   for cardId, metadata in pairs(draggingGuids) do
@@ -288,7 +290,7 @@ function rebuildConnectionList()
   end
 
   -- Pair up all the icons
-  locationConnections = { }
+  locationConnections = {}
   for cardId, metadata in pairs(draggingGuids) do
     buildConnection(cardId, iconCardList, metadata)
   end
@@ -307,7 +309,7 @@ function buildLocListByIcon(cardId, iconCardList, locData)
   if locData ~= nil and locData.icons ~= nil then
     for icon in string.gmatch(locData.icons, "%a+") do
       if iconCardList[icon] == nil then
-        iconCardList[icon] = { }
+        iconCardList[icon] = {}
       end
       table.insert(iconCardList[icon], cardId)
     end
@@ -321,19 +323,19 @@ end
 ---@param locData Table A table containing the metadata for the card (for the correct side)
 function buildConnection(cardId, iconCardList, locData)
   if locData ~= nil and locData.connections ~= nil then
-    locationConnections[cardId] = { }
+    locationConnections[cardId] = {}
     for icon in string.gmatch(locData.connections, "%a+") do
       if iconCardList[icon] ~= nil then
         for _, connectedGuid in ipairs(iconCardList[icon]) do
           -- If the reciprocal exists, convert it to BiDi, otherwise add as a one-way
           if locationConnections[connectedGuid] ~= nil
               and (locationConnections[connectedGuid][cardId] == ONE_WAY
-                  or locationConnections[connectedGuid][cardId] == BIDIRECTIONAL) then
+                or locationConnections[connectedGuid][cardId] == BIDIRECTIONAL) then
             locationConnections[connectedGuid][cardId] = BIDIRECTIONAL
             locationConnections[cardId][connectedGuid] = nil
           else
             if locationConnections[connectedGuid] == nil then
-              locationConnections[connectedGuid] = { }
+              locationConnections[connectedGuid] = {}
             end
             locationConnections[cardId][connectedGuid] = ONE_WAY
             locationConnections[connectedGuid][cardId] = INCOMING_ONE_WAY
@@ -348,10 +350,10 @@ end
 -- Constructed vectors will be set to the playmat
 function drawBaseConnections()
   if not showLocationLinks() then
-    locationConnections = { }
+    locationConnections = {}
     return
   end
-  local cardConnectionLines = { }
+  local cardConnectionLines = {}
 
   for originGuid, targetGuids in pairs(locationConnections) do
     -- Objects should reliably exist at this point, but since this can be called during onUpdate the
@@ -380,8 +382,8 @@ function drawDraggingConnections()
   if not showLocationLinks() then
     return
   end
-  local cardConnectionLines = { }
+  local cardConnectionLines = {}
-  local ownedVectors = { }
+  local ownedVectors = {}
 
   for originGuid, _ in pairs(draggingGuids) do
     targetGuids = locationConnections[originGuid]
@@ -389,7 +391,7 @@ function drawDraggingConnections()
     -- object checks are conservative just to make sure.
     local origin = getObjectFromGUID(originGuid)
     if draggingGuids[originGuid] and origin ~= nil and targetGuids ~= nil then
-      ownedVectors[originGuid] = { }
+      ownedVectors[originGuid] = {}
       for targetGuid, direction in pairs(targetGuids) do
         local target = getObjectFromGUID(targetGuid)
         if target != nil then
@@ -427,9 +429,9 @@ function addBidirectionalVector(card1, card2, vectorOwner, lines)
   local pos2 = vectorOwner.positionToLocal(cardPos2)
 
   table.insert(lines, {
-      points = { pos1, pos2 },
+    points = { pos1, pos2 },
-      color = vectorOwner == self and CONNECTION_COLOR or DRAGGING_CONNECTION_COLOR,
+    color = vectorOwner == self and CONNECTION_COLOR or DRAGGING_CONNECTION_COLOR,
-      thickness = vectorOwner == self and CONNECTION_THICKNESS or DRAGGING_CONNECTION_THICKNESS,
+    thickness = vectorOwner == self and CONNECTION_THICKNESS or DRAGGING_CONNECTION_THICKNESS,
   })
 end
 
@@ -451,11 +453,13 @@ function addOneWayVector(origin, target, vectorOwner, lines)
   -- Calculate card distance to be closer for horizontal positions than vertical, since cards are
   -- taller than they are wide
   local heading = Vector(originPos):sub(targetPos):heading("y")
-  local distanceFromCard = DIRECTIONAL_ARROW_DISTANCE * 0.7 + DIRECTIONAL_ARROW_DISTANCE * 0.3 * math.abs(math.sin(math.rad(heading)))
+  local distanceFromCard = DIRECTIONAL_ARROW_DISTANCE * 0.7 +
+  DIRECTIONAL_ARROW_DISTANCE * 0.3 * math.abs(math.sin(math.rad(heading)))
 
   -- Calculate the three possible arrow positions.  These are offset by half the arrow length to
   -- make them visually balanced by keeping the arrows centered, not tracking the point
-  local midpoint = Vector(originPos):add(targetPos):scale(Vector(0.5, 0.5, 0.5)):moveTowards(targetPos, ARROW_ARM_LENGTH / 2)
+  local midpoint = Vector(originPos):add(targetPos):scale(Vector(0.5, 0.5, 0.5)):moveTowards(targetPos,
+    ARROW_ARM_LENGTH / 2)
   local closeToOrigin = Vector(originPos):moveTowards(targetPos, distanceFromCard + ARROW_ARM_LENGTH / 2)
   local closeToTarget = Vector(targetPos):moveTowards(originPos, distanceFromCard - ARROW_ARM_LENGTH / 2)
 
@@ -474,14 +478,16 @@ end
 ---    positioning and scaling, as well as highlighting connections during a drag operation
 ---@param lines Table List of vector line elements.  Mutable, will be updated to add this arrow
 function addArrowLines(arrowheadPos, originPos, vectorOwner, lines)
-  local arrowArm1 = Vector(arrowheadPos):moveTowards(originPos, ARROW_ARM_LENGTH):sub(arrowheadPos):rotateOver("y", -1 * ARROW_ANGLE):add(arrowheadPos)
+  local arrowArm1 = Vector(arrowheadPos):moveTowards(originPos, ARROW_ARM_LENGTH):sub(arrowheadPos):rotateOver("y",
-  local arrowArm2 = Vector(arrowheadPos):moveTowards(originPos, ARROW_ARM_LENGTH):sub(arrowheadPos):rotateOver("y", ARROW_ANGLE):add(arrowheadPos)
+    -1 * ARROW_ANGLE):add(arrowheadPos)
+  local arrowArm2 = Vector(arrowheadPos):moveTowards(originPos, ARROW_ARM_LENGTH):sub(arrowheadPos):rotateOver("y",
+    ARROW_ANGLE):add(arrowheadPos)
 
   local head = vectorOwner.positionToLocal(arrowheadPos)
   local arm1 = vectorOwner.positionToLocal(arrowArm1)
   local arm2 = vectorOwner.positionToLocal(arrowArm2)
   table.insert(lines, {
-    points = { arm1, head, arm2},
+    points = { arm1, head, arm2 },
     color = vectorOwner == self and CONNECTION_COLOR or DRAGGING_CONNECTION_COLOR,
     thickness = vectorOwner == self and CONNECTION_THICKNESS or DRAGGING_CONNECTION_THICKNESS,
   })
@@ -508,7 +514,7 @@ function shiftContentsRight(playerColor)
 end
 
 function shiftContents(playerColor, direction)
-  local zone = getObjectFromGUID(PLAY_AREA_ZONE_GUID)
+  local zone = guidReferenceApi.getObjectByOwnerAndType("Mythos", "PlayAreaZone")
   if not zone then
     broadcastToColor("Scripting zone couldn't be found.", playerColor, "Red")
     return
@@ -530,8 +536,8 @@ function isInPlayArea(object)
   local bounds = self.getBounds()
   local position = object.getPosition()
   -- Corners are arbitrary since it's all global - c1 goes down both axes, c2 goes up
-  local c1 = { x = bounds.center.x - bounds.size.x / 2, z = bounds.center.z - bounds.size.z / 2}
+  local c1 = { x = bounds.center.x - bounds.size.x / 2, z = bounds.center.z - bounds.size.z / 2 }
-  local c2 = { x = bounds.center.x + bounds.size.x / 2, z = bounds.center.z + bounds.size.z / 2}
+  local c2 = { x = bounds.center.x + bounds.size.x / 2, z = bounds.center.z + bounds.size.z / 2 }
 
   return position.x > c1.x and position.x < c2.x and position.z > c1.z and position.z < c2.z
 end
@@ -582,7 +588,7 @@ function countVP()
       local cardVP = tonumber(metadata.victory) or 0
       if cardVP ~= 0 and not cardHasClues(cardId) then
         totalVP = totalVP + cardVP
-        if cardVP >0 then
+        if cardVP > 0 then
           table.insert(countedVP, getObjectFromGUID(cardId))
         end
       end
@@ -651,8 +657,8 @@ end
 
 -- rebuilds local snap points (could be useful in the future again)
 function buildSnaps()
-  local upperleft = { x = 1.53, z = -1.09}
+  local upperleft = { x = 1.53, z = -1.09 }
-  local lowerright = {x = -1.53, z = 1.55}
+  local lowerright = { x = -1.53, z = 1.55 }
   local snaps = {}
 
   -- creates 81 snap points, for uneven rows + columns it makes a rotation snap point
@@ -666,7 +672,7 @@ function buildSnaps()
 
       -- enable rotation snaps for uneven rows / columns
       if (i % 2 ~= 0) and (j % 2 ~= 0) then
-        snap.rotation = {0, 0, 0}
+        snap.rotation = { 0, 0, 0 }
         snap.rotation_snap = true
       end
 
@@ -678,6 +684,6 @@ end
 
 -- utility function
 function round(num, numDecimalPlaces)
-  local mult = 10^(numDecimalPlaces or 0)
+  local mult = 10 ^ (numDecimalPlaces or 0)
   return math.floor(num * mult + 0.5) / mult
 end

src/core/PlayAreaApi.ttslua

@@ -1,105 +1,109 @@
 do
-  local PlayAreaApi = { }
+  local PlayAreaApi = {}
-  local PLAY_AREA_GUID = "721ba2"
+  local guidReferenceApi = require("core/GUIDReferenceApi")
-  local INVESTIGATOR_COUNTER_GUID = "f182ee"
+
+  local function getPlayArea()
+    return guidReferenceApi.getObjectByOwnerAndType("Mythos", "PlayArea")
+  end
+
+  local function getInvestigatorCounter()
+    return guidReferenceApi.getObjectByOwnerAndType("Mythos", "InvestigatorCounter")
+  end
 
   -- Returns the current value of the investigator counter from the playmat
   ---@return Integer.  Number of investigators currently set on the counter
   PlayAreaApi.getInvestigatorCount = function()
-    return getObjectFromGUID(INVESTIGATOR_COUNTER_GUID).getVar("val")
+    return getInvestigatorCounter().getVar("val")
   end
 
   -- Updates the current value of the investigator counter from the playmat
   ---@param count Number of investigators to set on the counter
   PlayAreaApi.setInvestigatorCount = function(count)
-    return getObjectFromGUID(INVESTIGATOR_COUNTER_GUID).call("updateVal", count)
+    getInvestigatorCounter().call("updateVal", count)
   end
 
   -- Move all contents on the play area (cards, tokens, etc) one slot in the given direction.  Certain
-  -- fixed objects will be ignored, as will anything the player has tagged with
+  -- fixed objects will be ignored, as will anything the player has tagged with 'displacement_excluded'
-  -- 'displacement_excluded'
+  ---@param playerColor Color Color of the player requesting the shift for messages
-  ---@param playerColor Color of the player requesting the shift.  Used solely to send an error
-  ---    message in the unlikely case that the scripting zone has been deleted
   PlayAreaApi.shiftContentsUp = function(playerColor)
-    return getObjectFromGUID(PLAY_AREA_GUID).call("shiftContentsUp", playerColor)
+    return getPlayArea().call("shiftContentsUp", playerColor)
   end
 
   PlayAreaApi.shiftContentsDown = function(playerColor)
-    return getObjectFromGUID(PLAY_AREA_GUID).call("shiftContentsDown", playerColor)
+    return getPlayArea().call("shiftContentsDown", playerColor)
   end
 
   PlayAreaApi.shiftContentsLeft = function(playerColor)
-    return getObjectFromGUID(PLAY_AREA_GUID).call("shiftContentsLeft", playerColor)
+    return getPlayArea().call("shiftContentsLeft", playerColor)
   end
 
   PlayAreaApi.shiftContentsRight = function(playerColor)
-    return getObjectFromGUID(PLAY_AREA_GUID).call("shiftContentsRight", playerColor)
+    return getPlayArea().call("shiftContentsRight", playerColor)
   end
 
   -- Reset the play area's tracking of which cards have had tokens spawned.
   PlayAreaApi.resetSpawnedCards = function()
-    return getObjectFromGUID(PLAY_AREA_GUID).call("resetSpawnedCards")
+    return getPlayArea().call("resetSpawnedCards")
   end
 
   -- Event to be called when the current scenario has changed.
   ---@param scenarioName Name of the new scenario
   PlayAreaApi.onScenarioChanged = function(scenarioName)
-    getObjectFromGUID(PLAY_AREA_GUID).call("onScenarioChanged", scenarioName)
+    getPlayArea().call("onScenarioChanged", scenarioName)
   end
 
   -- Sets this playmat's snap points to limit snapping to locations or not.
   -- If matchTypes is false, snap points will be reset to snap all cards.
   ---@param matchTypes Boolean  Whether snap points should only snap for the matching card types.
   PlayAreaApi.setLimitSnapsByType = function(matchCardTypes)
-    getObjectFromGUID(PLAY_AREA_GUID).call("setLimitSnapsByType", matchCardTypes)
+    getPlayArea().call("setLimitSnapsByType", matchCardTypes)
   end
 
   -- Receiver for the Global tryObjectEnterContainer event.  Used to clear vector lines from dragged
   -- cards before they're destroyed by entering the container
   PlayAreaApi.tryObjectEnterContainer = function(container, object)
-    getObjectFromGUID(PLAY_AREA_GUID).call("tryObjectEnterContainer",
+    getPlayArea().call("tryObjectEnterContainer", { container = container, object = object })
-        { container = container, object = object })
   end
 
   -- counts the VP on locations in the play area
   PlayAreaApi.countVP = function()
-    return getObjectFromGUID(PLAY_AREA_GUID).call("countVP")
+    return getPlayArea().call("countVP")
   end
 
   -- highlights all locations in the play area without metadata
   ---@param state Boolean True if highlighting should be enabled
   PlayAreaApi.highlightMissingData = function(state)
-    return getObjectFromGUID(PLAY_AREA_GUID).call("highlightMissingData", state)
+    return getPlayArea().call("highlightMissingData", state)
   end
   
   -- highlights all locations in the play area with VP
   ---@param state Boolean True if highlighting should be enabled
   PlayAreaApi.highlightCountedVP = function(state)
-    return getObjectFromGUID(PLAY_AREA_GUID).call("highlightCountedVP", state)
+    return getPlayArea().call("highlightCountedVP", state)
   end
 
   -- Checks if an object is in the play area (returns true or false)
   PlayAreaApi.isInPlayArea = function(object)
-    return getObjectFromGUID(PLAY_AREA_GUID).call("isInPlayArea", object)
+    return getPlayArea().call("isInPlayArea", object)
   end
 
   PlayAreaApi.getSurface = function()
-    return getObjectFromGUID(PLAY_AREA_GUID).getCustomObject().image
+    return getPlayArea().getCustomObject().image
   end
 
   PlayAreaApi.updateSurface = function(url)
-    return getObjectFromGUID(PLAY_AREA_GUID).call("updateSurface", url)
+    return getPlayArea().call("updateSurface", url)
   end
   
   -- Called by Custom Data Helpers to push their location data into the Data Helper.  This adds the
   -- data to the local token manager instance.
   ---@param args Table Single-value array holding the GUID of the Custom Data Helper making the call
   PlayAreaApi.updateLocations = function(args)
-    getObjectFromGUID(PLAY_AREA_GUID).call("updateLocations", args)
+    getPlayArea().call("updateLocations", args)
   end
 
   PlayAreaApi.getCustomDataHelper = function()
-    return getObjectFromGUID(PLAY_AREA_GUID).getVar("customDataHelper")
+    return getPlayArea().getVar("customDataHelper")
   end
 
   return PlayAreaApi

src/core/SoundCubeApi.ttslua

@@ -1,5 +1,6 @@
 do
   local SoundCubeApi = {}
+  local guidReferenceApi = require("core/GUIDReferenceApi")
 
   -- this table links the name of a trigger effect to its index
   local soundIndices = {
@@ -9,7 +10,8 @@ do
   }
 
   local function playTriggerEffect(index)
-    getObjectsWithTag("SoundCube")[1].AssetBundle.playTriggerEffect(index)
+    local SoundCube = guidReferenceApi.getObjectByOwnerAndType("Mythos", "SoundCube")
+    SoundCube.AssetBundle.playTriggerEffect(index)
   end
 
   -- plays the by name requested sound

src/core/VictoryDisplay.ttslua

@@ -1,4 +1,5 @@
 local chaosBagApi = require("chaosbag/ChaosBagApi")
+local guidReferenceApi = require("core/GUIDReferenceApi")
 local playAreaApi = require("core/PlayAreaApi")
 local tokenChecker = require("core/token/TokenChecker")
 
@@ -10,13 +11,8 @@ local countedVP   = {}
 local highlightMissing = false
 local highlightCounted = false
 
-local TRASHCAN
-local TRASHCAN_GUID = "70b9f6"
-
 -- button creation when loading the game
 function onLoad()
-  TRASHCAN = getObjectFromGUID(TRASHCAN_GUID)
-
   -- index 0: VP - "Display"
   local buttonParameters          = {}
   buttonParameters.label          = "0"
@@ -236,8 +232,7 @@ end
 function highlightCountedVP()
   self.editButton({
     index = 4,
-    tooltip = (highlightCounted and "Enable" or "Disable") ..
+    tooltip = (highlightCounted and "Enable" or "Disable") .. " highlighting of cards with VP."
-        " highlighting of cards with VP."
   })
   for _, obj in pairs(countedVP) do
     if obj ~= nil then
@@ -254,6 +249,8 @@ end
 
 -- places the provided card in the first empty spot
 function placeCard(card)
+  local trash = guidReferenceApi.getObjectByOwnerAndType("Mythos", "Trash")
+  
   -- check snap point states
   local snaps = self.getSnapPoints()
   table.sort(snaps, function(a, b) return a.position.x > b.position.x end)
@@ -283,7 +280,7 @@ function placeCard(card)
       local chaosBag = chaosBagApi.findChaosBag()
       chaosBag.putObject(obj)
     elseif obj.memo ~= nil and obj.getLock() == false then
-      TRASHCAN.putObject(obj)
+      trash.putObject(obj)
     end
   end
   
@@ -327,13 +324,3 @@ function checkSnapPointState(pos)
     origin       = pos
   })
 end
-
--- search a table for a value, return true if found (else returns false)
-function tableContains(table, value)
-  for _, v in ipairs(table) do
-    if v == value then
-      return true
-    end
-  end
-  return false
-end

src/core/VictoryDisplayApi.ttslua

@@ -1,18 +1,22 @@
 do
   local VictoryDisplayApi = {}
-  local VD_GUID = "6ccd6d"
+  local guidReferenceApi = require("core/GUIDReferenceApi")
+
+  local function getVictoryDisplay()
+    return guidReferenceApi.getObjectByOwnerAndType("Mythos", "VictoryDisplay")
+  end
 
   -- triggers an update of the Victory count
   ---@param delay Number Delay in seconds after which the update call is executed
   VictoryDisplayApi.update = function(delay)
-    getObjectFromGUID(VD_GUID).call("startUpdate", delay)
+    getVictoryDisplay().call("startUpdate", delay)
   end
 
   -- moves a card to the victory display (in the first empty spot)
   ---@param object Object Object that should be checked and potentially moved
   VictoryDisplayApi.placeCard = function(object)
     if object ~= nil and object.tag == "Card" then
-      getObjectFromGUID(VD_GUID).call("placeCard", object)
+      getVictoryDisplay().call("placeCard", object)
     end
   end
 

src/core/token/TokenManager.ttslua

@@ -1,4 +1,5 @@
 do
+  local guidReferenceApi = require("core/GUIDReferenceApi")
   local optionPanelApi = require("core/OptionPanelApi")
   local playAreaApi = require("core/PlayAreaApi")
   local tokenSpawnTrackerApi = require("core/token/TokenSpawnTrackerApi")
@@ -119,15 +120,10 @@ do
     ["supply"] = 7
   }
 
-  -- Source for tokens
-  local TOKEN_SOURCE_GUID = "124381"
-
   -- Table of data extracted from the token source bag, keyed by the Memo on each token which
   -- should match the token type keys ("resource", "clue", etc)
   local tokenTemplates
 
-  local DATA_HELPER_GUID = "708279"
-
   local playerCardData
   local locationData
 
@@ -225,9 +221,11 @@ do
       -- Copy the offsets to make sure we don't change the static values
       local baseOffsets = offsets
       offsets = { }
+
+      -- get a vector for the shifting (downwards local to the card)
+      local shiftDownVector = Vector(0, 0, shiftDown):rotateOver("y", card.getRotation().y)
       for i, baseOffset in ipairs(baseOffsets) do
-        offsets[i] = baseOffset
+        offsets[i] = baseOffset + shiftDownVector
-        offsets[i][3] = offsets[i][3] + shiftDown
       end
     end
 
@@ -340,8 +338,8 @@ do
     if tokenTemplates ~= nil then
       return
     end
-    tokenTemplates = { }
+    tokenTemplates = {}
-    local tokenSource = getObjectFromGUID(TOKEN_SOURCE_GUID)
+    local tokenSource = guidReferenceApi.getObjectByOwnerAndType("Mythos", "TokenSource")
     for _, tokenTemplate in ipairs(tokenSource.getData().ContainedObjects) do
       local tokenName = tokenTemplate.Memo
       tokenTemplates[tokenName] = tokenTemplate
@@ -353,7 +351,7 @@ do
     if playerCardData ~= nil then
       return
     end
-    local dataHelper = getObjectFromGUID(DATA_HELPER_GUID)
+    local dataHelper = guidReferenceApi.getObjectByOwnerAndType("Mythos", "DataHelper")
     playerCardData = dataHelper.getTable('PLAYER_CARD_DATA')
     locationData = dataHelper.getTable('LOCATIONS_DATA')
   end
@@ -368,18 +366,16 @@ do
     if uses == nil then return end
 
     -- go through tokens to spawn
-    local type, token, tokenCount
+    local tokenCount
     for i, useInfo in ipairs(uses) do
-      type = useInfo.type
+      tokenCount = (useInfo.count or 0) + (useInfo.countPerInvestigator or 0) * playAreaApi.getInvestigatorCount()
-      token = useInfo.token
+      if extraUses ~= nil and extraUses[useInfo.type] ~= nil then
-      tokenCount = (useInfo.count or 0)
+        tokenCount = tokenCount + extraUses[useInfo.type]
-          + (useInfo.countPerInvestigator or 0) * playAreaApi.getInvestigatorCount()
-      if extraUses ~= nil and extraUses[type] ~= nil then
-        tokenCount = tokenCount + extraUses[type]
       end
       -- Shift each spawned group after the first down so they don't pile on each other
-      TokenManager.spawnTokenGroup(card, token, tokenCount, (i - 1) * 0.8, type)
+      TokenManager.spawnTokenGroup(card, useInfo.token, tokenCount, (i - 1) * 0.8, useInfo.type)
     end
+    
     tokenSpawnTrackerApi.markTokensSpawned(card.getGUID())
   end
 
@@ -403,9 +399,8 @@ do
   ---@param playerData Table Player card data structure retrieved from the DataHelper.  Should be
   --     the right data for this card.
   internal.spawnPlayerCardTokensFromDataHelper = function(card, playerData)
-    token = playerData.tokenType
+    local token = playerData.tokenType
-    tokenCount = playerData.tokenCount
+    local tokenCount = playerData.tokenCount
-    --log("Spawning data helper tokens for "..card.getName()..'['..card.getDescription()..']: '..tokenCount.."x "..token)
     TokenManager.spawnTokenGroup(card, token, tokenCount)
     tokenSpawnTrackerApi.markTokensSpawned(card.getGUID())
   end
@@ -438,7 +433,6 @@ do
       return 0
     end
 
-    --log(card.getName() .. ' : ' .. locationData.type .. ' : ' .. locationData.value .. ' : ' .. locationData.clueSide)
     if ((card.is_face_down and locationData.clueSide == 'back')
         or (not card.is_face_down and locationData.clueSide == 'front')) then
       if locationData.type == 'fixed' then

src/core/token/TokenSpawnTracker.ttslua

@@ -1,26 +1,15 @@
-local spawnedCardGuids = { }
+local spawnedCardGuids = {}
 
-local HAND_ZONES = { }
+function onSave() return JSON.encode({ cards = spawnedCardGuids }) end
-HAND_ZONES["a70eee"] = true -- White
-HAND_ZONES["0285cc"] = true -- Green
-HAND_ZONES["5fe087"] = true -- Orange
-HAND_ZONES["be2f17"] = true -- Red
 
 function onLoad(saveState)
   if saveState ~= nil then
-    local saveTable = JSON.decode(saveState) or { }
+    local saveTable = JSON.decode(saveState) or {}
-    spawnedCardGuids = saveTable.cards or { }
+    spawnedCardGuids = saveTable.cards or {}
   end
-
   createResetMenuItems()
 end
 
-function onSave()
-  return JSON.encode({
-    cards = spawnedCardGuids
-  })
-end
-
 function createResetMenuItems()
   self.addContextMenuItem("Reset All", resetAll)
   self.addContextMenuItem("Reset Locations", resetAllLocations)
@@ -39,14 +28,20 @@ function resetTokensSpawned(cardGuid)
   spawnedCardGuids[cardGuid] = nil
 end
 
-function resetAllAssetAndEvents()
+function resetAll() spawnedCardGuids = {} end
-  local resetList = { }
+
+function resetAllLocations() resetSpecificTypes("Location") end
+
+function resetAllAssetAndEvents() resetSpecificTypes("Asset", "Event") end
+
+function resetSpecificTypes(type1, type2)
+  local resetList = {}
   for cardGuid, _ in pairs(spawnedCardGuids) do
     local card = getObjectFromGUID(cardGuid)
     if card ~= nil then
-      local cardMetadata = JSON.decode(card.getGMNotes()) or { }
+      local cardMetadata = JSON.decode(card.getGMNotes()) or {}
       -- Check this by type rather than the PlayerCard tag so we don't reset weaknesses
-      if cardMetadata.type == "Asset" or cardMetadata.type == "Event" then
+      if cardMetadata.type == type1 or cardMetadata.type == type2 then
         resetList[cardGuid] = true
       end
     end
@@ -56,30 +51,9 @@ function resetAllAssetAndEvents()
   end
 end
 
-function resetAllLocations()
-  local resetList = { }
-  for cardGuid, _ in pairs(spawnedCardGuids) do
-    local card = getObjectFromGUID(cardGuid)
-    if card ~= nil then
-      local cardMetadata = JSON.decode(card.getGMNotes()) or { }
-      -- Check this by type rather than the PlayerCard tag so we don't reset weaknesses
-      if cardMetadata.type == "Location" then
-        resetList[cardGuid] = true
-      end
-    end
-  end
-  for cardGuid, _ in pairs(resetList) do
-    spawnedCardGuids[cardGuid] = nil
-  end
-end
-
-function resetAll()
-  spawnedCardGuids = { }
-end
-
 -- Listener to reset card token spawns when they enter a hand.
 function onObjectEnterZone(zone, enterObject)
-  if HAND_ZONES[zone.getGUID()] then
+  if zone.type == "Hand" and enterObject.type == "Card" then
     resetTokensSpawned(enterObject.getGUID())
   end
 end

src/core/token/TokenSpawnTrackerApi.ttslua

@@ -1,29 +1,33 @@
 do
-  local TokenSpawnTracker = { }
+  local TokenSpawnTracker = {}
-  local SPAWN_TRACKER_GUID = "e3ffc9"
+  local guidReferenceApi = require("core/GUIDReferenceApi")
+
+  local function getSpawnTracker()
+    return guidReferenceApi.getObjectByOwnerAndType("Mythos", "TokenSpawnTracker")
+  end
 
   TokenSpawnTracker.hasSpawnedTokens = function(cardGuid)
-    return getObjectFromGUID(SPAWN_TRACKER_GUID).call("hasSpawnedTokens", cardGuid)
+    return getSpawnTracker().call("hasSpawnedTokens", cardGuid)
   end
 
   TokenSpawnTracker.markTokensSpawned = function(cardGuid)
-    return getObjectFromGUID(SPAWN_TRACKER_GUID).call("markTokensSpawned", cardGuid)
+    return getSpawnTracker().call("markTokensSpawned", cardGuid)
   end
 
   TokenSpawnTracker.resetTokensSpawned = function(cardGuid)
-    return getObjectFromGUID(SPAWN_TRACKER_GUID).call("resetTokensSpawned", cardGuid)
+    return getSpawnTracker().call("resetTokensSpawned", cardGuid)
   end
 
   TokenSpawnTracker.resetAllAssetAndEvents = function()
-    return getObjectFromGUID(SPAWN_TRACKER_GUID).call("resetAllAssetAndEvents")
+    return getSpawnTracker().call("resetAllAssetAndEvents")
   end
 
   TokenSpawnTracker.resetAllLocations = function()
-    return getObjectFromGUID(SPAWN_TRACKER_GUID).call("resetAllLocations")
+    return getSpawnTracker().call("resetAllLocations")
   end
 
   TokenSpawnTracker.resetAll = function()
-    return getObjectFromGUID(SPAWN_TRACKER_GUID).call("resetAll")
+    return getSpawnTracker().call("resetAll")
   end
 
   return TokenSpawnTracker

src/core/tour/TourManager.ttslua

@@ -1,8 +1,9 @@
 do
   require("core/tour/TourScript")
   require("core/tour/TourCard")
-  local TourManager = { }
+  local TourManager = {}
-  local internal = { }
+  local internal = {}
+  local guidReferenceApi = require("core/GUIDReferenceApi")
 
   -- Base IDs for various tour card UI elements.  Actual IDs will have _[playerColor] appended
   local CARD_ID = "tourCard"
@@ -123,8 +124,9 @@ do
       delay = delay + 0.5
     end
     local lookPos
-    if TOUR_SCRIPT[cardIndex].showObj ~= nil then
+    local objReferenceData = TOUR_SCRIPT[cardIndex].objReferenceData
-      local lookAtObj = getObjectFromGUID(TOUR_SCRIPT[cardIndex].showObj)
+    if objReferenceData ~= nil then
+      local lookAtObj = guidReferenceApi.getObjectByOwnerAndType(objReferenceData.owner, objReferenceData.type)
       lookPos = lookAtObj.getPosition()
       lookPos.y = TOUR_SCRIPT[cardIndex].distanceFromObj or 0
       -- Since camera isn't directly above the hook, changing the Y affects the visual position of

src/core/tour/TourScript.ttslua

@@ -15,7 +15,7 @@ TOUR_SCRIPT = {
   {
     narrator = "Daisy",
     text = "If you're new to the game, the library here has everything you'll need.  A little research can go a long way, and looking into old newspapers for the weird and unusual can yield some surprisingly helpful information.\n\nI put a few right there that might prove enlightening.",
-    showObj = "d99993",
+    objReferenceData = { owner = "Mythos", type = "RulesReference" },
     distanceFromObj = 20,
     position = "west",
     speakerSide = "right"
@@ -23,7 +23,7 @@ TOUR_SCRIPT = {
   {
     narrator = "Mandy",
     text = "To survive what's coming you'll need a deck.  If it's safely hidden away on ArkhamDB you can load it here, and even find the newest version after an upgrade without changing the ID.\n\nNo need to publish all your decks, use 'Private' and you can see it.  Just make sure to select 'Make your decks public' in ArkhamDB.",
-    showObj = "a28140",
+    objReferenceData = { owner = "Mythos", type = "DeckImporter" },
     distanceFromObj = -5,
     position = "northwest",
     skipCentering = true,
@@ -31,7 +31,7 @@ TOUR_SCRIPT = {
   {
     narrator = "Daniela",
     text = "I prefer the hands-on approach to building things, if you do too you can build a deck yourself.\n\nAll the cards you could ever need are here, laid out like a disassembled engine.  Place the cards on the table, copy them for your deck, and you'll be ready for anything.",
-    showObj = "2d30ee",
+    objReferenceData = { owner = "Mythos", type = "PlayerCardPanel" },
     distanceFromObj = -7,
     position = "south",
     speakerSide = "right"
@@ -39,7 +39,7 @@ TOUR_SCRIPT = {
   {
     narrator = "Finn",
     text = "Ready to face the unknown?  We've smuggled shocking revelations and devious enemies from all over the world.  Download the campaign you want to play, then Place it on the table to see the scenarios.\n\nJust remember - if it turns out to be too much for you, I was never here.",
-    showObj = "aca04c",
+    objReferenceData = { owner = "Mythos", type = "CampaignThePathToCarcosa" },
     distanceFromObj = 20,
     position = "northwest",
   },
@@ -77,7 +77,7 @@ TOUR_SCRIPT = {
   {
     narrator = "Preston",
     text = "I can afford to buy what I need, but for those less well-off we've provided an endless pool of tokens to track your game.  Simply drag one out of the pools here.\n\nResources are my favorite of course, but damage and horror are as inevitable as taxes.  I leave those to my bookkeeper though.  Those tokens can work like counters, use the number keys to change the value.",
-    showObj = "9fadf9",
+    objReferenceData = { owner = "Mythos", type = "ResourceTokenBag" },
     position = "north",
     skipCentering = true,
     speakerSide = "right"

src/playercards/AllCardsBagApi.ttslua

@@ -1,29 +1,33 @@
 do
   local AllCardsBagApi = {}
-  local ALL_CARDS_BAG_GUID = "15bb07"
+  local guidReferenceApi = require("core/GUIDReferenceApi")
+
+  local function getAllCardsBag()
+    return guidReferenceApi.getObjectByOwnerAndType("Mythos", "AllCardsBag")
+  end
 
   -- Returns a specific card from the bag, based on ArkhamDB ID
-  -- @param table:
+  ---@param id table String ID of the card to retrieve
-  --     id: String ID of the card to retrieve
+  ---@return table table
-  -- @return: If the indexes are still being constructed, an empty table is
+  --  If the indexes are still being constructed, an empty table is
-  --     returned.  Otherwise, a single table with the following fields
+  --  returned.  Otherwise, a single table with the following fields
-  --       cardData: TTS object data, suitable for spawning the card
+  --    cardData: TTS object data, suitable for spawning the card
-  --       cardMetadata: Table of parsed metadata
+  --    cardMetadata: Table of parsed metadata
   AllCardsBagApi.getCardById = function(id)
-    return getObjectFromGUID(ALL_CARDS_BAG_GUID).call("getCardById", {id = id})
+    return getAllCardsBag().call("getCardById", {id = id})
   end
 
   -- Gets a random basic weakness from the bag.  Once a given ID has been returned
   -- it will be removed from the list and cannot be selected again until a reload
   -- occurs or the indexes are rebuilt, which will refresh the list to include all
   -- weaknesses.
-  -- @return: String ID of the selected weakness.
+  ---@return id String ID of the selected weakness.
   AllCardsBagApi.getRandomWeaknessId = function()
-    return getObjectFromGUID(ALL_CARDS_BAG_GUID).call("getRandomWeaknessId")
+    return getAllCardsBag().call("getRandomWeaknessId")
   end
 
   AllCardsBagApi.isIndexReady = function()
-    return getObjectFromGUID(ALL_CARDS_BAG_GUID).call("isIndexReady")
+    return getAllCardsBag().call("isIndexReady")
   end
 
   -- Called by Hotfix bags when they load.  If we are still loading indexes, then
@@ -32,40 +36,38 @@ do
   -- called once indexing is complete it means the hotfix bag has been added
   -- later, and we should rebuild the index to integrate the hotfix bag.
   AllCardsBagApi.rebuildIndexForHotfix = function()
-    return getObjectFromGUID(ALL_CARDS_BAG_GUID).call("rebuildIndexForHotfix")
+    return getAllCardsBag().call("rebuildIndexForHotfix")
   end
 
   -- Searches the bag for cards which match the given name and returns a list.  Note that this is
   -- an O(n) search without index support.  It may be slow.
-  -- @param
+  ---@param name String or string fragment to search for names
-  --   name String or string fragment to search for names
+  ---@param exact Boolean Whether the name match should be exact
-  --   exact Whether the name match should be exact
   AllCardsBagApi.getCardsByName = function(name, exact)
-    return getObjectFromGUID(ALL_CARDS_BAG_GUID).call("getCardsByName", {name = name, exact = exact})
+    return getAllCardsBag().call("getCardsByName", {name = name, exact = exact})
   end
 
   AllCardsBagApi.isBagPresent = function()
-    return getObjectFromGUID(ALL_CARDS_BAG_GUID) and true
+    return getAllCardsBag() and true
   end
 
   -- Returns a list of cards from the bag matching a class and level (0 or upgraded)
-  -- @param 
+  ---@param class String class to retrieve ("Guardian", "Seeker", etc)
-  --     class: String class to retrieve ("Guardian", "Seeker", etc)
+  ---@param upgraded Boolean true for upgraded cards (Level 1-5), false for Level 0
-  --     upgraded: true for upgraded cards (Level 1-5), false for Level 0
+  ---@return: If the indexes are still being constructed, returns an empty table.
-  -- @return: If the indexes are still being constructed, returns an empty table.
   --     Otherwise, a list of tables, each with the following fields
   --       cardData: TTS object data, suitable for spawning the card
   --       cardMetadata: Table of parsed metadata
   AllCardsBagApi.getCardsByClassAndLevel = function(class, upgraded)
-    return getObjectFromGUID(ALL_CARDS_BAG_GUID).call("getCardsByClassAndLevel", {class = class, upgraded = upgraded})
+    return getAllCardsBag().call("getCardsByClassAndLevel", {class = class, upgraded = upgraded})
   end
 
   AllCardsBagApi.getCardsByCycle = function(cycle)
-    return getObjectFromGUID(ALL_CARDS_BAG_GUID).call("getCardsByCycle", cycle)
+    return getAllCardsBag().call("getCardsByCycle", cycle)
   end
 
   AllCardsBagApi.getUniqueWeaknesses = function()
-    return getObjectFromGUID(ALL_CARDS_BAG_GUID).call("getUniqueWeaknesses")
+    return getAllCardsBag().call("getUniqueWeaknesses")
   end
 
   return AllCardsBagApi

src/playercards/PlayerCardPanelData.ttslua

@@ -245,9 +245,9 @@ INVESTIGATORS["Jenny Barnes"] = {
 	starterDeck = "2624961"
 }
 INVESTIGATORS["Jim Culver"] = {
-	cards = { "02004" },
+	cards = { "02004", "02004-p", "02004-pf", "02004-pb" },
 	minicards = { "02004-m" },
-	signatures = { "02012", "02013" },
+	signatures = { "02012", "02013", "90050", "90051", "90052", "90053" },
 	starterDeck = "2624965"
 }
 INVESTIGATORS["\"Ashcan\" Pete"] = {

src/playercards/cards/FamilyInheritance.ttslua

@@ -16,8 +16,8 @@ function searchSelf()
 
   for _, obj in ipairs(searchArea(self.getPosition(), { 2.5, 0.5, 3.5 })) do
     local obj = obj.hit_object
-    if obj.getCustomObject().image ==
+    local image = obj.getCustomObject().image
-        "http://cloud-3.steamusercontent.com/ugc/1758068501357192910/11DDDC7EF621320962FDCF3AE3211D5EDC3D1573/" then
+    if image == "http://cloud-3.steamusercontent.com/ugc/1758068501357192910/11DDDC7EF621320962FDCF3AE3211D5EDC3D1573/" then
       foundTokens = foundTokens + math.abs(obj.getQuantity())
       obj.destruct()
     elseif obj.getMemo() == "resourceCounter" then
@@ -47,7 +47,7 @@ end
 function takeAll(playerColor)
   searchSelf()
   local matColor = playmatApi.getMatColorByPosition(self.getPosition())
-  playmatApi.gainResources(foundTokens, matColor)
+  playmatApi.updateCounter(matColor, "ResourceCounter", foundTokens)
 
   if clickableResourceCounter then
     clickableResourceCounter.call("updateVal", 0)

src/playercards/cards/ShortSupply.ttslua

@@ -1,4 +1,4 @@
-local playmatAPI = require("playermat/PlaymatApi")
+local playmatApi = require("playermat/PlaymatApi")
 
 function onLoad()
   self.addContextMenuItem("Discard 10 cards", shortSupply)
@@ -6,11 +6,11 @@ end
 
 -- called by context menu entry
 function shortSupply(color)
-  local matColor = playmatAPI.getMatColorByPosition(self.getPosition())
+  local matColor = playmatApi.getMatColorByPosition(self.getPosition())
 
   -- get draw deck and discard position
-  local drawDeck = playmatAPI.getDrawDeck(matColor)
+  local drawDeck = playmatApi.getDrawDeck(matColor)
-  local discardPos = playmatAPI.getDiscardPosition(matColor)
+  local discardPos = playmatApi.getDiscardPosition(matColor)
 
   -- error handling
   if discardPos == nil then
@@ -21,7 +21,7 @@ function shortSupply(color)
   if drawDeck == nil then
     broadcastToColor("Deck not found!", color, "Yellow")
     return
-  elseif drawDeck.tag ~= "Deck" then
+  elseif drawDeck.type ~= "Deck" then
     broadcastToColor("Deck only contains a single card!", color, "Yellow")
     return
   end