Merge pull request #211 from argonui/victory-display

Victory Display: Visual update and automation

config.json

@@ -3,7 +3,6 @@
   "ComponentTags_path": "ComponentTags.json",
   "CustomUIAssets_path": "CustomUIAssets.json",
   "DecalPallet_path": "DecalPallet.json",
-  "Decals_path": "Decals.json",
   "GameComplexity": "",
   "GameMode": "Arkham Horror LCG - Super Complete Edition",
   "GameType": "",
@@ -188,7 +187,8 @@
     "Decoration-Ammo.0a3b03",
     "Decoration-Ammo.b43845",
     "Decoration-Ammo.d35ee9",
-    "ArkhamSCE300-1272023-Page1.f873a8"
+    "ArkhamSCE300-1272023-Page1.f873a8",
+    "VictoryDisplay.6ccd6d"
   ],
   "PlayArea": 1,
   "PlayerCounts": [

modsettings/Decals.json

@@ -1,20 +0,0 @@
-[
-  {
-    "CustomDecal": {
-      "ImageURL": "https://i.imgur.com/saWedQ0.png",
-      "Name": "Victory Display",
-      "Size": 15
-    },
-    "Transform": {
-      "posX": -1.76003075,
-      "posY": 1.491499,
-      "posZ": 28.6174583,
-      "rotX": 90,
-      "rotY": 89.6667938,
-      "rotZ": 0,
-      "scaleX": 15,
-      "scaleY": 15,
-      "scaleZ": 15
-    }
-  }
-]

modsettings/SnapPoints.json

@@ -207,78 +207,6 @@
       "z": -32.233
     }
   },
-  {
-    "Position": {
-      "x": 0.7,
-      "y": 1.481,
-      "z": 33.6
-    },
-    "Rotation": {
-      "x": 0,
-      "y": 270,
-      "z": 0
-    }
-  },
-  {
-    "Position": {
-      "x": -5.35,
-      "y": 1.481,
-      "z": 33.6
-    },
-    "Rotation": {
-      "x": 0,
-      "y": 270,
-      "z": 0
-    }
-  },
-  {
-    "Position": {
-      "x": -5.35,
-      "y": 1.481,
-      "z": 28.6
-    },
-    "Rotation": {
-      "x": 0,
-      "y": 270,
-      "z": 0
-    }
-  },
-  {
-    "Position": {
-      "x": 0.7,
-      "y": 1.481,
-      "z": 28.6
-    },
-    "Rotation": {
-      "x": 0,
-      "y": 270,
-      "z": 0
-    }
-  },
-  {
-    "Position": {
-      "x": 0.7,
-      "y": 1.481,
-      "z": 23.6
-    },
-    "Rotation": {
-      "x": 0,
-      "y": 270,
-      "z": 0
-    }
-  },
-  {
-    "Position": {
-      "x": -5.35,
-      "y": 1.481,
-      "z": 23.6
-    },
-    "Rotation": {
-      "x": 0,
-      "y": 270,
-      "z": 0
-    }
-  },
   {
     "Position": {
       "x": 65,

objects/VictoryDisplay.6ccd6d.json

@@ -0,0 +1,182 @@
+{
+  "AltLookAngle": {
+    "x": 0,
+    "y": 0,
+    "z": 0
+  },
+  "AttachedSnapPoints": [
+    {
+      "Position": {
+        "x": 0,
+        "y": 0.05,
+        "z": 0.05
+      },
+      "Rotation": {
+        "x": 0,
+        "y": 0,
+        "z": 0
+      }
+    },
+    {
+      "Position": {
+        "x": 0.8,
+        "y": 0.05,
+        "z": 1
+      },
+      "Rotation": {
+        "x": 0,
+        "y": 0,
+        "z": 0
+      }
+    },
+    {
+      "Position": {
+        "x": 0,
+        "y": 0.05,
+        "z": 1
+      },
+      "Rotation": {
+        "x": 0,
+        "y": 0,
+        "z": 0
+      }
+    },
+    {
+      "Position": {
+        "x": 1.6,
+        "y": 0.05,
+        "z": 0.05
+      },
+      "Rotation": {
+        "x": 0,
+        "y": 0,
+        "z": 0
+      }
+    },
+    {
+      "Position": {
+        "x": 1.6,
+        "y": 0.05,
+        "z": 1
+      },
+      "Rotation": {
+        "x": 0,
+        "y": 0,
+        "z": 0
+      }
+    },
+    {
+      "Position": {
+        "x": -0.8,
+        "y": 0.05,
+        "z": 0.05
+      },
+      "Rotation": {
+        "x": 0,
+        "y": 0,
+        "z": 0
+      }
+    },
+    {
+      "Position": {
+        "x": -0.8,
+        "y": 0.05,
+        "z": 1
+      },
+      "Rotation": {
+        "x": 0,
+        "y": 0,
+        "z": 0
+      }
+    },
+    {
+      "Position": {
+        "x": -1.6,
+        "y": 0.05,
+        "z": 0.05
+      },
+      "Rotation": {
+        "x": 0,
+        "y": 0,
+        "z": 0
+      }
+    },
+    {
+      "Position": {
+        "x": -1.6,
+        "y": 0.05,
+        "z": 1
+      },
+      "Rotation": {
+        "x": 0,
+        "y": 0,
+        "z": 0
+      }
+    },
+    {
+      "Position": {
+        "x": 0.8,
+        "y": 0.05,
+        "z": 0.05
+      },
+      "Rotation": {
+        "x": 0,
+        "y": 0,
+        "z": 0
+      }
+    }
+  ],
+  "Autoraise": true,
+  "ColorDiffuse": {
+    "b": 1,
+    "g": 1,
+    "r": 1
+  },
+  "CustomImage": {
+    "CustomToken": {
+      "MergeDistancePixels": 15,
+      "Stackable": false,
+      "StandUp": false,
+      "Thickness": 0.1
+    },
+    "ImageScalar": 1,
+    "ImageSecondaryURL": "",
+    "ImageURL": "http://cloud-3.steamusercontent.com/ugc/2053113893674531758/8E71AC0C7F8198A791AB4EA4ED9D301904F9A752/",
+    "WidthScale": 0
+  },
+  "Description": "Automatically counts the earned VP from cards in the victory display and locations in the play area without clues on them.",
+  "DragSelectable": true,
+  "GMNotes": "",
+  "GUID": "6ccd6d",
+  "Grid": true,
+  "GridProjection": false,
+  "Hands": false,
+  "HideWhenFaceDown": false,
+  "IgnoreFoW": false,
+  "LayoutGroupSortIndex": 0,
+  "Locked": true,
+  "LuaScript": "require(\"core/VictoryDisplay\")",
+  "LuaScriptState": "",
+  "MeasureMovement": false,
+  "Name": "Custom_Token",
+  "Nickname": "Victory Display",
+  "Snap": false,
+  "Sticky": true,
+  "Tooltip": true,
+  "Tags": [
+    "CleanUpHelper_ignore"
+  ],
+  "Transform": {
+    "posX": -1.5,
+    "posY": 1.531,
+    "posZ": 30,
+    "rotX": 0,
+    "rotY": 270,
+    "rotZ": 0,
+    "scaleX": 4.5,
+    "scaleY": 1,
+    "scaleZ": 4.5
+  },
+  "Value": 0,
+  "XmlUI": ""
+}

src/core/PlayArea.ttslua

@@ -56,6 +56,8 @@ local draggingGuids = {}
 local locationData
 local currentScenario
 
+local missingData = {}
+
 ---------------------------------------------------------
 -- general code
 ---------------------------------------------------------
@@ -96,7 +98,12 @@ function onCollisionEnter(collisionInfo)
   local objType = obj.name
 
   -- only continue for cards
-  if not collisionEnabled or (objType ~= "Card" and objType ~= "CardCustom") then return end
+  if not collisionEnabled or (objType ~= "Card" and objType ~= "CardCustom") then
+    if objType == "Deck" then
+      table.insert(missingData, obj)
+    end
+    return
+  end
 
   -- check if we should spawn clues here and do so according to playercount
   local card = collisionInfo.collision_object
@@ -142,13 +149,17 @@ function onObjectPickUp(player, object)
   if showLocationLinks() and isInPlayArea(object) and object.getGMNotes() ~= nil and object.getGMNotes() ~= "" then
     local pickedUpGuid = object.getGUID()
     local metadata = JSON.decode(object.getGMNotes()) or { }
-    if (metadata.type == "Location") then
+    if metadata.type == "Location" then
       -- onCollisionExit sometimes comes 1 frame after onObjectPickUp (rather than before it or in
       -- the same frame).  This causes a mismatch in the data between dragging the on-table, and
       -- that one frame draws connectors on the card which then show up as shadows for snap points.
       -- Waiting ensures we always do thing in the expected Exit->PickUp order
       Wait.frames(function()
-          draggingGuids[pickedUpGuid] = metadata
+          if object.is_face_down then
+            draggingGuids[pickedUpGuid] = metadata.locationBack
+          else
+            draggingGuids[pickedUpGuid] = metadata.locationFront
+          end
           rebuildConnectionList()
         end, 2)
     end
@@ -188,14 +199,26 @@ end
 function maybeTrackLocation(card)
   -- Collision checks for any part of the card overlap, but our other tracking is centerpoint
   -- Ignore any collision where the centerpoint isn't in the area
-  if showLocationLinks() and isInPlayArea(card) then
+  if isInPlayArea(card) then
-    local metadata = JSON.decode(card.getGMNotes()) or { }
+    local metadata = JSON.decode(card.getGMNotes())
+    if metadata == nil then
+      table.insert(missingData, card)
+    else
       if metadata.type == "Location" then
-      locations[card.getGUID()] = metadata
+        if card.is_face_down then
+          locations[card.getGUID()] = metadata.locationBack
+        else
+          locations[card.getGUID()] = metadata.locationFront
+        end
+
+        -- only draw connection lines for not-excluded scenarios
+        if showLocationLinks() then
           rebuildConnectionList()
           drawBaseConnections()
         end
       end
+    end
+  end
 end
 
 -- Stop tracking a location for connection drawing.  This should be called for both collision exit
@@ -239,20 +262,20 @@ function rebuildConnectionList()
 
   -- Build a list of cards with each icon as their location ID
   for cardId, metadata in pairs(draggingGuids) do
-    buildLocListByIcon(cardId, iconCardList)
+    buildLocListByIcon(cardId, iconCardList, metadata)
   end
   for cardId, metadata in pairs(locations) do
-    buildLocListByIcon(cardId, iconCardList)
+    buildLocListByIcon(cardId, iconCardList, metadata)
   end
 
   -- Pair up all the icons
   locationConnections = { }
   for cardId, metadata in pairs(draggingGuids) do
-    buildConnection(cardId, iconCardList)
+    buildConnection(cardId, iconCardList, metadata)
   end
   for cardId, metadata in pairs(locations) do
     if draggingGuids[cardId] == nil then
-      buildConnection(cardId, iconCardList)
+      buildConnection(cardId, iconCardList, metadata)
     end
   end
 end
@@ -260,15 +283,14 @@ end
 -- Extracts the card's icon string into a list of individual location icons
 ---@param cardID String GUID of the card to pull the icon data from
 ---@param iconCardList Table A table of icon->GUID list.  Mutable, will be updated by this method
-function buildLocListByIcon(cardId, iconCardList)
+---@param locData Table A table containing the metadata for the card (for the correct side)
-  local card = getObjectFromGUID(cardId)
+function buildLocListByIcon(cardId, iconCardList, locData)
-  local locData = getLocationData(card)
   if locData ~= nil and locData.icons ~= nil then
     for icon in string.gmatch(locData.icons, "%a+") do
       if iconCardList[icon] == nil then
         iconCardList[icon] = { }
       end
-      table.insert(iconCardList[icon], card.getGUID())
+      table.insert(iconCardList[icon], cardId)
     end
   end
 end
@@ -277,25 +299,24 @@ end
 -- Playarea's locationConnections table.
 ---@param cardId String GUID of the card to build the connections for
 ---@param iconCardList Table A table of icon->GUID List.  Used to find matching icons for connections.
-function buildConnection(cardId, iconCardList)
+---@param locData Table A table containing the metadata for the card (for the correct side)
-  local card = getObjectFromGUID(cardId)
+function buildConnection(cardId, iconCardList, locData)
-  local locData = getLocationData(card)
   if locData ~= nil and locData.connections ~= nil then
-    locationConnections[card.getGUID()] = { }
+    locationConnections[cardId] = { }
     for icon in string.gmatch(locData.connections, "%a+") do
       if iconCardList[icon] ~= nil then
         for _, connectedGuid in ipairs(iconCardList[icon]) do
           -- If the reciprocal exists, convert it to BiDi, otherwise add as a one-way
           if locationConnections[connectedGuid] ~= nil
-              and locationConnections[connectedGuid][card.getGUID()] == ONE_WAY then
+              and locationConnections[connectedGuid][cardId] == ONE_WAY then
-            locationConnections[connectedGuid][card.getGUID()] = BIDIRECTIONAL
+            locationConnections[connectedGuid][cardId] = BIDIRECTIONAL
-            locationConnections[card.getGUID()][connectedGuid] = nil
+            locationConnections[cardId][connectedGuid] = nil
           else
             if locationConnections[connectedGuid] == nil then
               locationConnections[connectedGuid] = { }
             end
-            locationConnections[card.getGUID()][connectedGuid] = ONE_WAY
+            locationConnections[cardId][connectedGuid] = ONE_WAY
-            locationConnections[connectedGuid][card.getGUID()] = INCOMING_ONE_WAY
+            locationConnections[connectedGuid][cardId] = INCOMING_ONE_WAY
           end
         end
       end
@@ -303,22 +324,6 @@ function buildConnection(cardId, iconCardList)
   end
 end
 
--- Helper method to extract the location metadata from a card based on whether it's front or back
--- is showing.
----@param card String Card object to extract data from
----@return. Table with either the locationFront or locationBack metadata structure, or nil if the
---     metadata doesn't exist
-function getLocationData(card)
-  if card == nil then
-    return nil
-  end
-  if card.is_face_down then
-    return JSON.decode(card.getGMNotes()).locationBack
-  else
-    return JSON.decode(card.getGMNotes()).locationFront
-  end
-end
-
 -- Draws the lines for connections currently in locationConnections but not in draggingGuids.
 -- Constructed vectors will be set to the playmat
 function drawBaseConnections()
@@ -553,6 +558,64 @@ function setLimitSnapsByType(matchTypes)
   self.setSnapPoints(snaps)
 end
 
+-- count victory points on locations in play area
+---@return. Returns the total amount of VP found in the play area
+function countVP()
+  local totalVP = 0
+
+  for cardId, metadata in pairs(locations) do
+    if metadata ~= nil then
+      local cardVP = tonumber(metadata.victory) or 0
+      if cardVP ~= 0 and not cardHasClues(cardId) then
+        totalVP = totalVP + cardVP
+      end
+    end
+  end
+
+  return totalVP
+end
+
+-- checks if a card has clues on it, returns true if clues are on it
+---@param cardId String GUID of the card to check for clues
+function cardHasClues(cardId)
+  local card = getObjectFromGUID(cardId)
+  for _, v in ipairs(searchOnObj(card)) do
+    local obj = v.hit_object
+    if obj.memo == "clueDoom" and obj.is_face_down == false then
+      return true
+    end
+  end
+  return false
+end
+
+-- searches on an object (by using its bounds)
+---@param obj Object Object to search on
+function searchOnObj(obj)
+  return Physics.cast({
+    direction    = { 0, 1, 0 },
+    max_distance = 0.5,
+    type         = 3,
+    size         = obj.getBounds().size,
+    origin       = obj.getPosition()
+  })
+end
+
+-- highlights all locations in the play area without metadata
+---@param state Boolean True if highlighting should be enabled
+function highlightMissingData(state)
+  for i, obj in pairs(missingData) do
+    if obj ~= nil then
+      if state then
+        obj.highlightOff("Red")
+      else
+        obj.highlightOn("Red")
+      end
+    else
+      missingData[i] = nil
+    end
+  end
+end
+
 -- rebuilds local snap points (could be useful in the future again)
 function buildSnaps()
   local upperleft = { x = 1.53, z = -1.09}

src/core/PlayAreaApi.ttslua

@@ -55,5 +55,21 @@ do
         { container = container, object = object })
   end
 
+  -- counts the VP on locations in the play area
+  PlayAreaApi.countVP = function()
+    return getObjectFromGUID(PLAY_AREA_GUID).call("countVP")
+  end
+
+  -- highlights all locations in the play area without metadata
+  ---@param state Boolean True if highlighting should be enabled
+  PlayAreaApi.highlightMissingData = function(state)
+    return getObjectFromGUID(PLAY_AREA_GUID).call("highlightMissingData", state)
+  end
+  
+  -- Checks if an object is in the play area (returns true or false)
+  PlayAreaApi.isInPlayArea = function(object)
+    return getObjectFromGUID(PLAY_AREA_GUID).call("isInPlayArea", object)
+  end
+
   return PlayAreaApi
 end

src/core/VictoryDisplay.ttslua

@@ -0,0 +1,218 @@
+local playAreaApi = require("core/PlayAreaApi")
+local pendingCall = false
+local messageSent = {}
+local currentlyHighlighting = false
+local missingData = {}
+
+-- button creation when loading the game
+function onLoad()
+  -- index 0: VP - "Display"
+  local buttonParameters          = {}
+  buttonParameters.label          = "0"
+  buttonParameters.click_function = "none"
+  buttonParameters.function_owner = self
+  buttonParameters.scale          = { 0.15, 0.15, 0.15 }
+  buttonParameters.width          = 0
+  buttonParameters.height         = 0
+  buttonParameters.font_size      = 600
+  buttonParameters.font_color     = { 1, 1, 1 }
+  buttonParameters.position       = { x = -0.72, y = 0.06, z = -0.69 }
+  self.createButton(buttonParameters)
+
+  -- index 1: VP - "Play Area"
+  buttonParameters.position.x = 0.65
+  self.createButton(buttonParameters)
+
+  -- index 2: VP - "Total"
+  buttonParameters.position.x = 1.69
+  self.createButton(buttonParameters)
+
+  -- index 3: highlighting button
+  self.createButton({
+    label          = "!",
+    click_function = "highlightMissingData",
+    tooltip        = "Enable highlighting of cards without metadata (VP on these is not counted).",
+    function_owner = self,
+    scale          = { 0.15, 0.15, 0.15 },
+    color          = { 1, 0, 0 },
+    width          = 700,
+    height         = 800,
+    font_size      = 700,
+    font_color     = { 1, 1, 1 },
+    position       = { x = 1.82, y = 0.06, z = -1.32 }
+  })
+  -- update the display label once
+  Wait.time(updateCount, 1)
+end
+
+---------------------------------------------------------
+-- events with descriptions
+---------------------------------------------------------
+
+-- dropping an object on the victory display
+function onCollisionEnter()
+  -- stop if there is already an update call running
+  if pendingCall then return end
+  pendingCall = true
+  Wait.time(updateCount, 0.2)
+end
+
+-- removing an object from the victory display
+function onCollisionExit()
+  -- stop if there is already an update call running
+  if pendingCall then return end
+  pendingCall = true
+  Wait.time(updateCount, 0.2)
+end
+
+-- picking a clue or location up
+function onObjectPickUp(_, obj)
+  maybeUpdate(obj)
+end
+
+-- dropping a clue or location
+function onObjectDrop(_, obj)
+  maybeUpdate(obj, 1)
+end
+
+-- flipping a clue/doom or location
+function onObjectRotate(obj, _, flip, _, _, oldFlip)
+  if flip == oldFlip then return end
+  maybeUpdate(obj, 1, true)
+end
+
+-- destroying a clue or location
+function onObjectDestroy(obj)
+  maybeUpdate(obj)
+end
+
+---------------------------------------------------------
+-- main functionality
+---------------------------------------------------------
+
+function maybeUpdate(obj, delay, flipped)
+  -- stop if there is already an update call running
+  if pendingCall then return end
+
+  -- stop if obj is nil (by e.g. dropping a clue onto another and making a stack)
+  if obj == nil then return end
+
+  -- only continue for clues / doom tokens or locations
+  if obj.hasTag("Location") then
+  elseif obj.memo == "clueDoom" then
+    -- only continue if the clue side is up or a doom token is being flipped
+    if obj.is_face_down == true and flipped ~= true then return end
+  else
+    return
+  end
+
+  -- only continue if the obj in in the play area
+  if not playAreaApi.isInPlayArea(obj) then return end
+
+  -- set this flag to limit function calls (will be reset by "updateCount")
+  pendingCall = true
+
+  -- update the count with delay (or 0 if no delay is provided)
+  -- this is needed to let tokens drop on the card
+  delay = tonumber(delay) or 0
+  Wait.time(updateCount, delay + 0.2)
+end
+
+-- counts the VP in the victory display and request the VP count from the play area
+function updateCount()
+  missingData            = {}
+  local victoryPoints    = {}
+  victoryPoints.display  = 0
+  victoryPoints.playArea = playAreaApi.countVP()
+
+  -- count cards in victory display
+  for _, v in ipairs(searchOnObj(self)) do
+    local obj = v.hit_object
+
+    -- check metadata for VP
+    if obj.tag == "Card" then
+      victoryPoints.display = victoryPoints.display + getCardVP(obj, JSON.decode(obj.getGMNotes()))
+
+    -- handling for stacked cards
+    elseif obj.tag == "Deck" then
+      for _, deepObj in ipairs(obj.getObjects()) do
+        victoryPoints.display = victoryPoints.display + getCardVP(obj, JSON.decode(deepObj.gm_notes))
+      end
+    end
+  end
+
+  -- update the buttons that are used as labels
+  self.editButton({ index = 0, label = victoryPoints.display })
+  self.editButton({ index = 1, label = victoryPoints.playArea })
+  self.editButton({ index = 2, label = victoryPoints.display + victoryPoints.playArea })
+
+  -- allow new update calls
+  pendingCall = false
+end
+
+-- gets the VP count from the notes
+function getCardVP(obj, notes)
+  local cardVP
+  if notes ~= nil then
+    -- enemy, treachery etc.
+    cardVP = tonumber(notes.victory)
+
+    -- location
+    if not cardVP then
+      -- check the correct side of the location
+      if not obj.is_face_down and notes.locationFront ~= nil then
+        cardVP = tonumber(notes.locationFront.victory)
+      elseif notes.locationBack ~= nil then
+        cardVP = tonumber(notes.locationBack.victory)
+      end
+    end
+  else
+    table.insert(missingData, obj)
+  end
+  return cardVP or 0
+end
+
+-- toggles the highlight for objects with missing metadata
+function highlightMissingData()
+  self.editButton({
+    index = 3,
+    tooltip = (currentlyHighlighting and "Enable" or "Disable") ..
+        " highlighting of cards without metadata (VP on these is not counted)."
+  })
+  for _, obj in pairs(missingData) do
+    if obj ~= nil then
+      if currentlyHighlighting then
+        obj.highlightOff("Red")
+      else
+        obj.highlightOn("Red")
+      end
+    end
+  end
+  playAreaApi.highlightMissingData(currentlyHighlighting)
+  currentlyHighlighting = not currentlyHighlighting
+end
+
+---------------------------------------------------------
+-- utility functions
+---------------------------------------------------------
+
+-- searches on an object
+function searchOnObj(obj)
+  return Physics.cast({
+    direction    = { 0, 1, 0 },
+    max_distance = 0.5,
+    type         = 3,
+    size         = obj.getBounds().size,
+    origin       = obj.getPosition()
+  })
+end
+
+-- search a table for a value, return true if found (else returns false)
+function tableContains(table, value)
+  for _, v in ipairs(table) do
+    if v == value then
+      return true
+    end
+  end
+  return false
+end